v63-0002-Add-logical-slot-sync-capability-to-the-physical.patch

application/octet-stream

Filename: v63-0002-Add-logical-slot-sync-capability-to-the-physical.patch
Type: application/octet-stream
Part: 4
Message: Re: Synchronizing slots from primary to standby

Patch

Format: format-patch
Series: patch v63-0002
Subject: Add logical slot sync capability to the physical standby
File+
doc/src/sgml/bgworker.sgml 53 12
doc/src/sgml/config.sgml 25 2
doc/src/sgml/logicaldecoding.sgml 33 0
doc/src/sgml/system-views.sgml 16 0
src/backend/access/transam/xlog.c 4 1
src/backend/access/transam/xlogrecovery.c 15 0
src/backend/catalog/system_views.sql 2 1
src/backend/postmaster/bgworker.c 4 0
src/backend/postmaster/postmaster.c 10 0
src/backend/replication/libpqwalreceiver/libpqwalreceiver.c 41 0
src/backend/replication/logical/logical.c 12 0
src/backend/replication/logical/Makefile 1 0
src/backend/replication/logical/meson.build 1 0
src/backend/replication/logical/slotsync.c 1176 0
src/backend/replication/slot.c 27 5
src/backend/replication/slotfuncs.c 8 6
src/backend/replication/walreceiverfuncs.c 16 0
src/backend/replication/walsender.c 2 2
src/backend/storage/ipc/ipci.c 2 0
src/backend/tcop/postgres.c 11 0
src/backend/utils/activity/wait_event_names.txt 2 0
src/backend/utils/misc/guc_tables.c 10 0
src/backend/utils/misc/postgresql.conf.sample 1 0
src/include/catalog/pg_proc.dat 3 3
src/include/postmaster/bgworker.h 1 0
src/include/replication/logicalworker.h 1 0
src/include/replication/slot.h 16 1
src/include/replication/walreceiver.h 19 0
src/include/replication/worker_internal.h 10 0
src/test/recovery/t/050_standby_failover_slots_sync.pl 165 1
src/test/regress/expected/rules.out 3 2
src/test/regress/expected/sysviews.out 2 1
src/tools/pgindent/typedefs.list 2 0
From 0fca5f53107b7afef839319f0b50faa7b607d44f Mon Sep 17 00:00:00 2001
From: Hou Zhijie <sherlockcpp@foxmail.com>
Date: Fri, 12 Jan 2024 20:41:19 +0800
Subject: [PATCH v63 2/6] Add logical slot sync capability to the physical
 standby

This patch implements synchronization of logical replication slots
from the primary server to the physical standby so that logical
replication can be resumed after failover.

GUC 'enable_syncslot' enables a physical standby to synchronize failover
logical replication slots from the primary server.

The logical replication slots on the primary can be synchronized to the hot
standby by enabling the failover option during slot creation and setting
'enable_syncslot' on the standby. For the synchronization to work, it is
mandatory to have a physical replication slot between the primary and the
standby, and hot_standby_feedback must be enabled on the standby.

All the failover logical replication slots on the primary (assuming
configurations are appropriate) are automatically created on the physical
standbys and are synced periodically. Slot-sync worker on the standby server
ping the primary server at regular intervals to get the necessary
failover logical slots information and create/update the slots locally.

The nap time of the worker is tuned according to the activity on the primary.
The worker waits for a period of time before the next synchronization, with the
duration varying based on whether any slots were updated during the last
cycle.

The logical slots created by slot-sync worker on physical standbys are not
allowed to be dropped or consumed. Any attempt to perform logical decoding on
such slots will result in an error.

If a logical slot is invalidated on the primary, then that slot on the standby
is also invalidated.

If a logical slot on the primary is valid but is invalidated on the standby,
then that slot is dropped and recreated on the standby in next sync-cycle
provided the slot still exists on the primary server. It is okay to recreate
such slots as long as these are not consumable on the standby (which is the
case currently). This situation may occur due to the following reasons:
- The max_slot_wal_keep_size on the standby is insufficient to retain WAL
  records from the restart_lsn of the slot.
- primary_slot_name is temporarily reset to null and the physical slot is
  removed.
- The primary changes wal_level to a level lower than logical.

The slots synchronization status on the standby can be monitored using
'synced' column of pg_replication_slots view.
---
 doc/src/sgml/bgworker.sgml                    |   65 +-
 doc/src/sgml/config.sgml                      |   27 +-
 doc/src/sgml/logicaldecoding.sgml             |   33 +
 doc/src/sgml/system-views.sgml                |   16 +
 src/backend/access/transam/xlog.c             |    5 +-
 src/backend/access/transam/xlogrecovery.c     |   15 +
 src/backend/catalog/system_views.sql          |    3 +-
 src/backend/postmaster/bgworker.c             |    4 +
 src/backend/postmaster/postmaster.c           |   10 +
 .../libpqwalreceiver/libpqwalreceiver.c       |   41 +
 src/backend/replication/logical/Makefile      |    1 +
 src/backend/replication/logical/logical.c     |   12 +
 src/backend/replication/logical/meson.build   |    1 +
 src/backend/replication/logical/slotsync.c    | 1176 +++++++++++++++++
 src/backend/replication/slot.c                |   32 +-
 src/backend/replication/slotfuncs.c           |   14 +-
 src/backend/replication/walreceiverfuncs.c    |   16 +
 src/backend/replication/walsender.c           |    4 +-
 src/backend/storage/ipc/ipci.c                |    2 +
 src/backend/tcop/postgres.c                   |   11 +
 .../utils/activity/wait_event_names.txt       |    2 +
 src/backend/utils/misc/guc_tables.c           |   10 +
 src/backend/utils/misc/postgresql.conf.sample |    1 +
 src/include/catalog/pg_proc.dat               |    6 +-
 src/include/postmaster/bgworker.h             |    1 +
 src/include/replication/logicalworker.h       |    1 +
 src/include/replication/slot.h                |   17 +-
 src/include/replication/walreceiver.h         |   19 +
 src/include/replication/worker_internal.h     |   10 +
 .../t/050_standby_failover_slots_sync.pl      |  166 ++-
 src/test/regress/expected/rules.out           |    5 +-
 src/test/regress/expected/sysviews.out        |    3 +-
 src/tools/pgindent/typedefs.list              |    2 +
 33 files changed, 1694 insertions(+), 37 deletions(-)
 create mode 100644 src/backend/replication/logical/slotsync.c

diff --git a/doc/src/sgml/bgworker.sgml b/doc/src/sgml/bgworker.sgml
index 2c393385a9..a7cfe6c58c 100644
--- a/doc/src/sgml/bgworker.sgml
+++ b/doc/src/sgml/bgworker.sgml
@@ -114,18 +114,59 @@ typedef struct BackgroundWorker
 
   <para>
    <structfield>bgw_start_time</structfield> is the server state during which
-   <command>postgres</command> should start the process; it can be one of
-   <literal>BgWorkerStart_PostmasterStart</literal> (start as soon as
-   <command>postgres</command> itself has finished its own initialization; processes
-   requesting this are not eligible for database connections),
-   <literal>BgWorkerStart_ConsistentState</literal> (start as soon as a consistent state
-   has been reached in a hot standby, allowing processes to connect to
-   databases and run read-only queries), and
-   <literal>BgWorkerStart_RecoveryFinished</literal> (start as soon as the system has
-   entered normal read-write state).  Note the last two values are equivalent
-   in a server that's not a hot standby.  Note that this setting only indicates
-   when the processes are to be started; they do not stop when a different state
-   is reached.
+   <command>postgres</command> should start the process. Note that this setting
+   only indicates when the processes are to be started; they do not stop when
+   a different state is reached. Possible values are:
+
+   <variablelist>
+    <varlistentry>
+     <term><literal>BgWorkerStart_PostmasterStart</literal></term>
+     <listitem>
+      <para>
+       <indexterm><primary>BgWorkerStart_PostmasterStart</primary></indexterm>
+       Start as soon as postgres itself has finished its own initialization;
+       processes requesting this are not eligible for database connections.
+      </para>
+     </listitem>
+    </varlistentry>
+
+    <varlistentry>
+     <term><literal>BgWorkerStart_ConsistentState</literal></term>
+     <listitem>
+      <para>
+       <indexterm><primary>BgWorkerStart_ConsistentState</primary></indexterm>
+       Start as soon as a consistent state has been reached in a hot-standby,
+       allowing processes to connect to databases and run read-only queries.
+      </para>
+     </listitem>
+    </varlistentry>
+
+    <varlistentry>
+     <term><literal>BgWorkerStart_ConsistentState_HotStandby</literal></term>
+     <listitem>
+      <para>
+       <indexterm><primary>BgWorkerStart_ConsistentState_HotStandby</primary></indexterm>
+       Same meaning as <literal>BgWorkerStart_ConsistentState</literal> but
+       it is more strict in terms of the server i.e. start the worker only
+       if it is hot-standby.
+      </para>
+     </listitem>
+    </varlistentry>
+
+    <varlistentry>
+     <term><literal>BgWorkerStart_RecoveryFinished</literal></term>
+     <listitem>
+      <para>
+       <indexterm><primary>BgWorkerStart_RecoveryFinished</primary></indexterm>
+       Start as soon as the system has entered normal read-write state. Note
+       that the <literal>BgWorkerStart_ConsistentState</literal> and
+      <literal>BgWorkerStart_RecoveryFinished</literal> are equivalent
+       in a server that's not a hot standby.
+      </para>
+     </listitem>
+    </varlistentry>
+
+   </variablelist>
   </para>
 
   <para>
diff --git a/doc/src/sgml/config.sgml b/doc/src/sgml/config.sgml
index 61038472c5..bd2d2f871e 100644
--- a/doc/src/sgml/config.sgml
+++ b/doc/src/sgml/config.sgml
@@ -4612,8 +4612,13 @@ ANY <replaceable class="parameter">num_sync</replaceable> ( <replaceable class="
           <varname>primary_conninfo</varname> string, or in a separate
           <filename>~/.pgpass</filename> file on the standby server (use
           <literal>replication</literal> as the database name).
-          Do not specify a database name in the
-          <varname>primary_conninfo</varname> string.
+         </para>
+         <para>
+          If slot synchronization is enabled (see
+          <xref linkend="guc-enable-syncslot"/>) then it is also
+          necessary to specify <literal>dbname</literal> in the
+          <varname>primary_conninfo</varname> string. This will only be used for
+          slot synchronization. It is ignored for streaming.
          </para>
          <para>
           This parameter can only be set in the <filename>postgresql.conf</filename>
@@ -4938,6 +4943,24 @@ ANY <replaceable class="parameter">num_sync</replaceable> ( <replaceable class="
       </listitem>
      </varlistentry>
 
+     <varlistentry id="guc-enable-syncslot" xreflabel="enable_syncslot">
+      <term><varname>enable_syncslot</varname> (<type>boolean</type>)
+      <indexterm>
+       <primary><varname>enable_syncslot</varname> configuration parameter</primary>
+      </indexterm>
+      </term>
+      <listitem>
+       <para>
+        It enables a physical standby to synchronize logical failover slots
+        from the primary server so that logical subscribers are not blocked
+        after failover.
+       </para>
+       <para>
+        It is disabled by default. This parameter can only be set in the
+        <filename>postgresql.conf</filename> file or on the server command line.
+       </para>
+      </listitem>
+     </varlistentry>
      </variablelist>
     </sect2>
 
diff --git a/doc/src/sgml/logicaldecoding.sgml b/doc/src/sgml/logicaldecoding.sgml
index cd152d4ced..6721d8951d 100644
--- a/doc/src/sgml/logicaldecoding.sgml
+++ b/doc/src/sgml/logicaldecoding.sgml
@@ -346,6 +346,39 @@ postgres=# select * from pg_logical_slot_get_changes('regression_slot', NULL, NU
      <function>pg_log_standby_snapshot</function> function on the primary.
     </para>
 
+    <para>
+     A logical replication slot on the primary can be synchronized to the hot
+     standby by enabling the failover option during slot creation and setting
+     <xref linkend="guc-enable-syncslot"/> on the standby. For the synchronization
+     to work, it is mandatory to have a physical replication slot between the
+     primary and the standby, and <varname>hot_standby_feedback</varname> must
+     be enabled on the standby. It's also highly recommended that the said
+     physical replication slot is named in <varname>standby_slot_names</varname>
+     list on the primary, to prevent the subscriber from consuming changes
+     faster than the hot standby.
+    </para>
+
+    <para>
+     The ability to resume logical replication after failover depends upon the
+     <link linkend="view-pg-replication-slots">pg_replication_slots</link>.<structfield>synced</structfield>
+     value for the synchronized slots on the standby at the time of failover.
+     Only persistent slots that have attained synced state as true on the standby
+     before failover can be used for logical replication after failover.
+     Temporary slots will be dropped, therefore logical replication for those
+     slots cannot be resumed. For example, if the synchronized slot could not
+     become persistent on the standby due to a disabled subscription, then the
+     subscription cannot be resumed after failover even when it is enabled.
+    </para>
+
+    <para>
+     To resume logical replication after failover from the synced logical
+     slots, the subscription's 'conninfo' must be altered to point to the
+     new primary server. This is done using
+     <link linkend="sql-altersubscription-params-connection"><command>ALTER SUBSCRIPTION ... CONNECTION</command></link>.
+     It is recommended that subscriptions are first disabled before promoting
+     the standby and are enabled back after altering the connection string.
+    </para>
+
     <caution>
      <para>
       Replication slots persist across crashes and know nothing about the state
diff --git a/doc/src/sgml/system-views.sgml b/doc/src/sgml/system-views.sgml
index 1868b95836..4f36a2f732 100644
--- a/doc/src/sgml/system-views.sgml
+++ b/doc/src/sgml/system-views.sgml
@@ -2566,6 +2566,22 @@ SELECT * FROM pg_locks pl LEFT JOIN pg_prepared_xacts ppx
        after failover. Always false for physical slots.
       </para></entry>
      </row>
+
+     <row>
+      <entry role="catalog_table_entry"><para role="column_definition">
+       <structfield>synced</structfield> <type>bool</type>
+      </para>
+      <para>
+      True if this is a logical slot that was synced from a primary server.
+      </para>
+      <para>
+       On a hot standby, the slots with the synced column marked as true can
+       neither be used for logical decoding nor dropped by the user. The value
+       of this column has no meaning on the primary server; the column value on
+       the primary is default false for all slots but may (if leftover from a
+       promoted standby) also be true.
+      </para></entry>
+     </row>
     </tbody>
    </tgroup>
   </table>
diff --git a/src/backend/access/transam/xlog.c b/src/backend/access/transam/xlog.c
index 478377c4a2..2d66d0d84b 100644
--- a/src/backend/access/transam/xlog.c
+++ b/src/backend/access/transam/xlog.c
@@ -3596,6 +3596,9 @@ XLogGetLastRemovedSegno(void)
 /*
  * Return the oldest WAL segment on the given TLI that still exists in
  * XLOGDIR, or 0 if none.
+ *
+ * If the given TLI is 0, return the oldest WAL segment among all the currently
+ * existing WAL segments.
  */
 XLogSegNo
 XLogGetOldestSegno(TimeLineID tli)
@@ -3619,7 +3622,7 @@ XLogGetOldestSegno(TimeLineID tli)
 						 wal_segment_size);
 
 		/* Ignore anything that's not from the TLI of interest. */
-		if (tli != file_tli)
+		if (tli != 0 && tli != file_tli)
 			continue;
 
 		/* If it's the oldest so far, update oldest_segno. */
diff --git a/src/backend/access/transam/xlogrecovery.c b/src/backend/access/transam/xlogrecovery.c
index 1b48d7171a..e38a9587e2 100644
--- a/src/backend/access/transam/xlogrecovery.c
+++ b/src/backend/access/transam/xlogrecovery.c
@@ -50,6 +50,7 @@
 #include "postmaster/startup.h"
 #include "replication/slot.h"
 #include "replication/walreceiver.h"
+#include "replication/worker_internal.h"
 #include "storage/fd.h"
 #include "storage/ipc.h"
 #include "storage/latch.h"
@@ -1441,6 +1442,20 @@ FinishWalRecovery(void)
 	 */
 	XLogShutdownWalRcv();
 
+	/*
+	 * Shutdown the slot sync workers to prevent potential conflicts between
+	 * user processes and slotsync workers after a promotion.
+	 *
+	 * We do not update the 'synced' column from true to false here, as any
+	 * failed update could leave 'synced' column false for some slots. This
+	 * could cause issues during slot sync after restarting the server as a
+	 * standby. While updating after switching to the new timeline is an
+	 * option, it does not simplify the handling for 'synced' column.
+	 * Therefore, we retain the 'synced' column as true after promotion as it
+	 * may provide useful information about the slot origin.
+	 */
+	ShutDownSlotSync();
+
 	/*
 	 * We are now done reading the xlog from stream. Turn off streaming
 	 * recovery to force fetching the files (which would be required at end of
diff --git a/src/backend/catalog/system_views.sql b/src/backend/catalog/system_views.sql
index e43a93739d..ad57bade07 100644
--- a/src/backend/catalog/system_views.sql
+++ b/src/backend/catalog/system_views.sql
@@ -1024,7 +1024,8 @@ CREATE VIEW pg_replication_slots AS
             L.safe_wal_size,
             L.two_phase,
             L.conflict_reason,
-            L.failover
+            L.failover,
+            L.synced
     FROM pg_get_replication_slots() AS L
             LEFT JOIN pg_database D ON (L.datoid = D.oid);
 
diff --git a/src/backend/postmaster/bgworker.c b/src/backend/postmaster/bgworker.c
index 67f92c24db..46828b8a89 100644
--- a/src/backend/postmaster/bgworker.c
+++ b/src/backend/postmaster/bgworker.c
@@ -21,6 +21,7 @@
 #include "postmaster/postmaster.h"
 #include "replication/logicallauncher.h"
 #include "replication/logicalworker.h"
+#include "replication/worker_internal.h"
 #include "storage/dsm.h"
 #include "storage/ipc.h"
 #include "storage/latch.h"
@@ -129,6 +130,9 @@ static const struct
 	{
 		"ApplyWorkerMain", ApplyWorkerMain
 	},
+	{
+		"ReplSlotSyncWorkerMain", ReplSlotSyncWorkerMain
+	},
 	{
 		"ParallelApplyWorkerMain", ParallelApplyWorkerMain
 	},
diff --git a/src/backend/postmaster/postmaster.c b/src/backend/postmaster/postmaster.c
index feb471dd1d..d90d5d1576 100644
--- a/src/backend/postmaster/postmaster.c
+++ b/src/backend/postmaster/postmaster.c
@@ -116,6 +116,7 @@
 #include "postmaster/walsummarizer.h"
 #include "replication/logicallauncher.h"
 #include "replication/walsender.h"
+#include "replication/worker_internal.h"
 #include "storage/fd.h"
 #include "storage/ipc.h"
 #include "storage/pg_shmem.h"
@@ -1010,6 +1011,12 @@ PostmasterMain(int argc, char *argv[])
 	 */
 	ApplyLauncherRegister();
 
+	/*
+	 * Register the slot sync worker here to kick start slot-sync operation
+	 * sooner on the physical standby.
+	 */
+	SlotSyncWorkerRegister();
+
 	/*
 	 * process any libraries that should be preloaded at postmaster start
 	 */
@@ -5799,6 +5806,9 @@ bgworker_should_start_now(BgWorkerStartTime start_time)
 		case PM_HOT_STANDBY:
 			if (start_time == BgWorkerStart_ConsistentState)
 				return true;
+			if (start_time == BgWorkerStart_ConsistentState_HotStandby &&
+					 pmState != PM_RUN)
+				return true;
 			/* fall through */
 
 		case PM_RECOVERY:
diff --git a/src/backend/replication/libpqwalreceiver/libpqwalreceiver.c b/src/backend/replication/libpqwalreceiver/libpqwalreceiver.c
index c5232cee2f..934c1a3ab0 100644
--- a/src/backend/replication/libpqwalreceiver/libpqwalreceiver.c
+++ b/src/backend/replication/libpqwalreceiver/libpqwalreceiver.c
@@ -34,6 +34,7 @@
 #include "utils/memutils.h"
 #include "utils/pg_lsn.h"
 #include "utils/tuplestore.h"
+#include "utils/varlena.h"
 
 PG_MODULE_MAGIC;
 
@@ -58,6 +59,7 @@ static void libpqrcv_get_senderinfo(WalReceiverConn *conn,
 									char **sender_host, int *sender_port);
 static char *libpqrcv_identify_system(WalReceiverConn *conn,
 									  TimeLineID *primary_tli);
+static char *libpqrcv_get_dbname_from_conninfo(const char *conninfo);
 static int	libpqrcv_server_version(WalReceiverConn *conn);
 static void libpqrcv_readtimelinehistoryfile(WalReceiverConn *conn,
 											 TimeLineID tli, char **filename,
@@ -100,6 +102,7 @@ static WalReceiverFunctionsType PQWalReceiverFunctions = {
 	.walrcv_send = libpqrcv_send,
 	.walrcv_create_slot = libpqrcv_create_slot,
 	.walrcv_alter_slot = libpqrcv_alter_slot,
+	.walrcv_get_dbname_from_conninfo = libpqrcv_get_dbname_from_conninfo,
 	.walrcv_get_backend_pid = libpqrcv_get_backend_pid,
 	.walrcv_exec = libpqrcv_exec,
 	.walrcv_disconnect = libpqrcv_disconnect
@@ -432,6 +435,44 @@ libpqrcv_server_version(WalReceiverConn *conn)
 	return PQserverVersion(conn->streamConn);
 }
 
+/*
+ * Get database name from the primary server's conninfo.
+ *
+ * If dbname is not found in connInfo, return NULL value.
+ */
+static char *
+libpqrcv_get_dbname_from_conninfo(const char *connInfo)
+{
+	PQconninfoOption *opts;
+	char	   *dbname = NULL;
+	char	   *err = NULL;
+
+	opts = PQconninfoParse(connInfo, &err);
+	if (opts == NULL)
+	{
+		/* The error string is malloc'd, so we must free it explicitly */
+		char	   *errcopy = err ? pstrdup(err) : "out of memory";
+
+		PQfreemem(err);
+		ereport(ERROR,
+				(errcode(ERRCODE_SYNTAX_ERROR),
+				 errmsg("invalid connection string syntax: %s", errcopy)));
+	}
+
+	for (PQconninfoOption *opt = opts; opt->keyword != NULL; ++opt)
+	{
+		/*
+		 * If multiple dbnames are specified, then the last one will be
+		 * returned
+		 */
+		if (strcmp(opt->keyword, "dbname") == 0 && opt->val &&
+			opt->val[0] != '\0')
+			dbname = pstrdup(opt->val);
+	}
+
+	return dbname;
+}
+
 /*
  * Start streaming WAL data from given streaming options.
  *
diff --git a/src/backend/replication/logical/Makefile b/src/backend/replication/logical/Makefile
index 2dc25e37bb..ba03eeff1c 100644
--- a/src/backend/replication/logical/Makefile
+++ b/src/backend/replication/logical/Makefile
@@ -25,6 +25,7 @@ OBJS = \
 	proto.o \
 	relation.o \
 	reorderbuffer.o \
+	slotsync.o \
 	snapbuild.o \
 	tablesync.o \
 	worker.o
diff --git a/src/backend/replication/logical/logical.c b/src/backend/replication/logical/logical.c
index ca09c683f1..5aefb10ecb 100644
--- a/src/backend/replication/logical/logical.c
+++ b/src/backend/replication/logical/logical.c
@@ -524,6 +524,18 @@ CreateDecodingContext(XLogRecPtr start_lsn,
 				 errmsg("replication slot \"%s\" was not created in this database",
 						NameStr(slot->data.name))));
 
+	/*
+	 * Do not allow consumption of a "synchronized" slot until the standby
+	 * gets promoted.
+	 */
+	if (RecoveryInProgress() && slot->data.synced)
+		ereport(ERROR,
+				errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+				errmsg("cannot use replication slot \"%s\" for logical"
+					   " decoding", NameStr(slot->data.name)),
+				errdetail("This slot is being synced from the primary server."),
+				errhint("Specify another replication slot."));
+
 	/*
 	 * Check if slot has been invalidated due to max_slot_wal_keep_size. Avoid
 	 * "cannot get changes" wording in this errmsg because that'd be
diff --git a/src/backend/replication/logical/meson.build b/src/backend/replication/logical/meson.build
index 1050eb2c09..3dec36a6de 100644
--- a/src/backend/replication/logical/meson.build
+++ b/src/backend/replication/logical/meson.build
@@ -11,6 +11,7 @@ backend_sources += files(
   'proto.c',
   'relation.c',
   'reorderbuffer.c',
+  'slotsync.c',
   'snapbuild.c',
   'tablesync.c',
   'worker.c',
diff --git a/src/backend/replication/logical/slotsync.c b/src/backend/replication/logical/slotsync.c
new file mode 100644
index 0000000000..f90ebef9d0
--- /dev/null
+++ b/src/backend/replication/logical/slotsync.c
@@ -0,0 +1,1176 @@
+/*-------------------------------------------------------------------------
+ * slotsync.c
+ *	   PostgreSQL worker for synchronizing slots to a standby server from the
+ *         primary server.
+ *
+ * Copyright (c) 2024, PostgreSQL Global Development Group
+ *
+ * IDENTIFICATION
+ *	  src/backend/replication/logical/slotsync.c
+ *
+ * This file contains the code for slot sync worker on a physical standby
+ * to fetch logical failover slots information from the primary server,
+ * create the slots on the standby and synchronize them periodically.
+ *
+ * While creating the slot on physical standby, if the local restart_lsn and/or
+ * local catalog_xmin is ahead of those on the remote then the worker cannot
+ * create the local slot in sync with the primary server because that would
+ * mean moving the local slot backwards and the standby might not have WALs
+ * retained for old LSN. In this case, the worker will mark the slot as
+ * RS_TEMPORARY. Once the primary server catches up, the worker will mark the
+ * slot as RS_PERSISTENT (which means sync-ready) and will perform the sync
+ * periodically.
+ *
+ * The worker also takes care of dropping the slots which were created by it
+ * and are currently not needed to be synchronized.
+ *
+ * It waits for a period of time before the next synchronization, with the
+ * duration varying based on whether any slots were updated during the last
+ * cycle. Refer to the comments above wait_for_slot_activity() for more details.
+ *---------------------------------------------------------------------------
+ */
+
+#include "postgres.h"
+
+#include "access/genam.h"
+#include "access/table.h"
+#include "access/xlog_internal.h"
+#include "access/xlogrecovery.h"
+#include "catalog/pg_database.h"
+#include "commands/dbcommands.h"
+#include "pgstat.h"
+#include "postmaster/bgworker.h"
+#include "postmaster/interrupt.h"
+#include "replication/logical.h"
+#include "replication/logicallauncher.h"
+#include "replication/logicalworker.h"
+#include "replication/walreceiver.h"
+#include "replication/worker_internal.h"
+#include "storage/ipc.h"
+#include "storage/procarray.h"
+#include "tcop/tcopprot.h"
+#include "utils/builtins.h"
+#include "utils/fmgroids.h"
+#include "utils/guc_hooks.h"
+#include "utils/pg_lsn.h"
+#include "utils/varlena.h"
+
+/*
+ * Structure to hold information fetched from the primary server about a logical
+ * replication slot.
+ */
+typedef struct RemoteSlot
+{
+	char	   *name;
+	char	   *plugin;
+	char	   *database;
+	bool		two_phase;
+	bool		failover;
+	XLogRecPtr	restart_lsn;
+	XLogRecPtr	confirmed_lsn;
+	TransactionId catalog_xmin;
+
+	/* RS_INVAL_NONE if valid, or the reason of invalidation */
+	ReplicationSlotInvalidationCause invalidated;
+} RemoteSlot;
+
+/*
+ * Struct for sharing information between startup process and slot
+ * sync worker.
+ *
+ * Slot sync worker's pid is needed by the startup process in order to
+ * shut it down during promotion. Startup process shuts down the slot
+ * sync worker and also sets stopSignaled=true to handle the race condition
+ * when postmaster has not noticed the promotion yet and thus may end up
+ * restarting slot sync worker. If stopSignaled is set, the worker will
+ * exit in such a case.
+ */
+typedef struct SlotSyncWorkerCtxStruct
+{
+	pid_t		pid;
+	bool		stopSignaled;
+	slock_t		mutex;
+} SlotSyncWorkerCtxStruct;
+
+SlotSyncWorkerCtxStruct *SlotSyncWorker = NULL;
+
+/* GUC variable */
+bool		enable_syncslot = false;
+
+/*
+ * Sleep time in ms between slot-sync cycles.
+ * See wait_for_slot_activity() for how we adjust this
+ */
+static long sleep_ms;
+
+static void ProcessSlotSyncInterrupts(WalReceiverConn *wrconn);
+
+/*
+ * If necessary, update local slot metadata based on the data from the remote
+ * slot.
+ *
+ * If no update was needed (the data of the remote slot is the same as the
+ * local slot) return false, otherwise true.
+ */
+static bool
+local_slot_update(RemoteSlot *remote_slot)
+{
+	Oid			remote_dbid;
+	ReplicationSlot *slot = MyReplicationSlot;
+
+	Assert(slot->data.invalidated == RS_INVAL_NONE);
+
+	remote_dbid = get_database_oid(remote_slot->database, false);
+
+	if (strcmp(remote_slot->plugin, NameStr(slot->data.plugin)) == 0 &&
+		remote_dbid == slot->data.database &&
+		remote_slot->restart_lsn == slot->data.restart_lsn &&
+		remote_slot->catalog_xmin == slot->data.catalog_xmin &&
+		remote_slot->two_phase == slot->data.two_phase &&
+		remote_slot->failover == slot->data.failover &&
+		remote_slot->confirmed_lsn == slot->data.confirmed_flush)
+		return false;
+
+	SpinLockAcquire(&slot->mutex);
+	namestrcpy(&slot->data.plugin, remote_slot->plugin);
+	slot->data.database = remote_dbid;
+	slot->data.two_phase = remote_slot->two_phase;
+	slot->data.failover = remote_slot->failover;
+	slot->data.restart_lsn = remote_slot->restart_lsn;
+	slot->data.confirmed_flush = remote_slot->confirmed_lsn;
+	slot->data.catalog_xmin = remote_slot->catalog_xmin;
+	SpinLockRelease(&slot->mutex);
+
+	if (remote_slot->catalog_xmin != slot->data.catalog_xmin)
+		ReplicationSlotsComputeRequiredXmin(false);
+
+	if (remote_slot->restart_lsn != slot->data.restart_lsn)
+		ReplicationSlotsComputeRequiredLSN();
+
+	return true;
+}
+
+/*
+ * Get list of local logical slots which are synchronized from
+ * the primary server.
+ */
+static List *
+get_local_synced_slots(void)
+{
+	List	   *local_slots = NIL;
+
+	LWLockAcquire(ReplicationSlotControlLock, LW_SHARED);
+
+	for (int i = 0; i < max_replication_slots; i++)
+	{
+		ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i];
+
+		/* Check if it is a synchronized slot */
+		if (s->in_use && s->data.synced)
+		{
+			Assert(SlotIsLogical(s));
+			local_slots = lappend(local_slots, s);
+		}
+	}
+
+	LWLockRelease(ReplicationSlotControlLock);
+
+	return local_slots;
+}
+
+/*
+ * Helper function to check if local_slot is present in remote_slots list.
+ *
+ * It also checks if the slot on the standby server was invalidated while the
+ * corresponding remote slot in the list remained valid. If found so, it sets
+ * the locally_invalidated flag to true.
+ */
+static bool
+check_sync_slot_on_remote(ReplicationSlot *local_slot, List *remote_slots,
+						  bool *locally_invalidated)
+{
+	foreach_ptr(RemoteSlot, remote_slot, remote_slots)
+	{
+		if (strcmp(remote_slot->name, NameStr(local_slot->data.name)) == 0)
+		{
+			/*
+			 * If remote slot is not invalidated but local slot is marked as
+			 * invalidated, then set the bool.
+			 */
+			SpinLockAcquire(&local_slot->mutex);
+			*locally_invalidated =
+				(remote_slot->invalidated == RS_INVAL_NONE) &&
+				(local_slot->data.invalidated != RS_INVAL_NONE);
+			SpinLockRelease(&local_slot->mutex);
+
+			return true;
+		}
+	}
+
+	return false;
+}
+
+/*
+ * Drop obsolete slots
+ *
+ * Drop the slots that no longer need to be synced i.e. these either do not
+ * exist on the primary or are no longer enabled for failover.
+ *
+ * Additionally, it drops slots that are valid on the primary but got
+ * invalidated on the standby. This situation may occur due to the following
+ * reasons:
+ * - The max_slot_wal_keep_size on the standby is insufficient to retain WAL
+ *   records from the restart_lsn of the slot.
+ * - primary_slot_name is temporarily reset to null and the physical slot is
+ *   removed.
+ * - The primary changes wal_level to a level lower than logical.
+ *
+ * The assumption is that these dropped slots will get recreated in next
+ * sync-cycle and it is okay to drop and recreate such slots as long as these
+ * are not consumable on the standby (which is the case currently).
+ */
+static void
+drop_obsolete_slots(List *remote_slot_list)
+{
+	List	   *local_slots = get_local_synced_slots();
+
+	foreach_ptr(ReplicationSlot, local_slot, local_slots)
+	{
+		bool		remote_exists = false;
+		bool		locally_invalidated = false;
+
+		remote_exists = check_sync_slot_on_remote(local_slot, remote_slot_list,
+												  &locally_invalidated);
+
+		/*
+		 * Drop the local slot either if it is not in the remote slots list or
+		 * is invalidated while remote slot is still valid.
+		 */
+		if (!remote_exists || locally_invalidated)
+		{
+			ReplicationSlotAcquire(NameStr(local_slot->data.name), true);
+			Assert(MyReplicationSlot->data.synced);
+			ReplicationSlotDropAcquired();
+
+			ereport(LOG,
+					errmsg("dropped replication slot \"%s\" of dbid %d",
+						   NameStr(local_slot->data.name),
+						   local_slot->data.database));
+		}
+	}
+}
+
+/*
+ * Reserve WAL for the currently active slot using the specified WAL location
+ * (restart_lsn).
+ *
+ * If the given WAL location has been removed, reserve WAL using the oldest
+ * existing WAL segment.
+ */
+static void
+reserve_wal_for_slot(XLogRecPtr restart_lsn)
+{
+	XLogSegNo	oldest_segno;
+	XLogSegNo	segno;
+	ReplicationSlot *slot = MyReplicationSlot;
+
+	Assert(slot != NULL);
+	Assert(XLogRecPtrIsInvalid(slot->data.restart_lsn));
+
+	while (true)
+	{
+		SpinLockAcquire(&slot->mutex);
+		slot->data.restart_lsn = restart_lsn;
+		SpinLockRelease(&slot->mutex);
+
+		/* Prevent WAL removal as fast as possible */
+		ReplicationSlotsComputeRequiredLSN();
+
+		XLByteToSeg(slot->data.restart_lsn, segno, wal_segment_size);
+
+		/*
+		 * Find the oldest existing WAL segment file.
+		 *
+		 * Normally, we can determine it by using the last removed segment
+		 * number. However, if no WAL segment files have been removed by a
+		 * checkpoint since startup, we need to search for the oldest segment
+		 * file currently existing in XLOGDIR.
+		 */
+		oldest_segno = XLogGetLastRemovedSegno() + 1;
+
+		if (oldest_segno == 1)
+			oldest_segno = XLogGetOldestSegno(0);
+
+		/*
+		 * If all required WAL is still there, great, otherwise retry. The
+		 * slot should prevent further removal of WAL, unless there's a
+		 * concurrent ReplicationSlotsComputeRequiredLSN() after we've written
+		 * the new restart_lsn above, so normally we should never need to loop
+		 * more than twice.
+		 */
+		if (segno >= oldest_segno)
+			break;
+
+		/* Retry using the location of the oldest wal segment */
+		XLogSegNoOffsetToRecPtr(oldest_segno, 0, wal_segment_size, restart_lsn);
+	}
+}
+
+/*
+ * Update the LSNs and persist the slot for further syncs if the remote
+ * restart_lsn and catalog_xmin have caught up with the local ones, otherwise
+ * do nothing.
+ *
+ * Return true either if the slot is marked as RS_PERSISTENT (sync-ready) or
+ * is synced periodically (if it was already sync-ready). Return false
+ * otherwise.
+ */
+static bool
+update_and_persist_slot(RemoteSlot *remote_slot)
+{
+	ReplicationSlot *slot = MyReplicationSlot;
+
+	/*
+	 * Check if the primary server has caught up. Refer to the comment atop
+	 * the file for details on this check.
+	 *
+	 * We also need to check if remote_slot's confirmed_lsn becomes valid. It
+	 * is possible to get null values for confirmed_lsn and catalog_xmin if on
+	 * the primary server the slot is just created with a valid restart_lsn
+	 * and slot-sync worker has fetched the slot before the primary server
+	 * could set valid confirmed_lsn and catalog_xmin.
+	 */
+	if (remote_slot->restart_lsn < slot->data.restart_lsn ||
+		XLogRecPtrIsInvalid(remote_slot->confirmed_lsn) ||
+		TransactionIdPrecedes(remote_slot->catalog_xmin,
+							  slot->data.catalog_xmin))
+	{
+		/*
+		 * The remote slot didn't catch up to locally reserved position.
+		 *
+		 * We do not drop the slot because the restart_lsn can be ahead of the
+		 * current location when recreating the slot in the next cycle. It may
+		 * take more time to create such a slot. Therefore, we keep this slot
+		 * and attempt the wait and synchronization in the next cycle.
+		 */
+		return false;
+	}
+
+	(void) local_slot_update(remote_slot);
+	ReplicationSlotPersist();
+
+	ereport(LOG,
+			errmsg("newly locally created slot \"%s\" is sync-ready now",
+				   remote_slot->name));
+
+	return true;
+}
+
+/*
+ * Synchronize single slot to given position.
+ *
+ * This creates a new slot if there is no existing one and updates the
+ * metadata of the slot as per the data received from the primary server.
+ *
+ * The slot is created as a temporary slot and stays in the same state until the
+ * the remote_slot catches up with locally reserved position and local slot is
+ * updated. The slot is then persisted and is considered as sync-ready for
+ * periodic syncs.
+ *
+ * Returns TRUE if the local slot is updated.
+ */
+static bool
+synchronize_one_slot(WalReceiverConn *wrconn, RemoteSlot *remote_slot)
+{
+	ReplicationSlot *slot;
+	bool		slot_updated = false;
+	XLogRecPtr	latestWalEnd;
+
+	/*
+	 * Sanity check: Make sure that concerned WAL is received before syncing
+	 * slot to target lsn received from the primary server.
+	 *
+	 * This check should never pass as on the primary server, we have waited
+	 * for the standby's confirmation before updating the logical slot.
+	 */
+	latestWalEnd = GetWalRcvLatestWalEnd();
+	if (remote_slot->confirmed_lsn > latestWalEnd)
+	{
+		elog(ERROR, "exiting from slot synchronization as the received slot sync"
+			 " LSN %X/%X for slot \"%s\" is ahead of the standby position %X/%X",
+			 LSN_FORMAT_ARGS(remote_slot->confirmed_lsn),
+			 remote_slot->name,
+			 LSN_FORMAT_ARGS(latestWalEnd));
+	}
+
+	/* Search for the named slot */
+	if ((slot = SearchNamedReplicationSlot(remote_slot->name, true)))
+	{
+		bool		synced;
+
+		SpinLockAcquire(&slot->mutex);
+		synced = slot->data.synced;
+		SpinLockRelease(&slot->mutex);
+
+		/* User created slot with the same name exists, raise ERROR. */
+		if (!synced)
+			ereport(ERROR,
+					errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+					errmsg("exiting from slot synchronization on receiving"
+						   " the failover slot \"%s\" from the primary server",
+						   remote_slot->name),
+					errdetail("A user-created slot with the same name already"
+							  " exists on the standby."));
+
+		/*
+		 * Slot created by the slot sync worker exists, sync it.
+		 *
+		 * It is important to acquire the slot here before checking
+		 * invalidation. If we don't acquire the slot first, there could be a
+		 * race condition that the local slot could be invalidated just after
+		 * checking the 'invalidated' flag here and we could end up
+		 * overwriting 'invalidated' flag to remote_slot's value. See
+		 * InvalidatePossiblyObsoleteSlot() where it invalidates slot directly
+		 * if the slot is not acquired by other processes.
+		 */
+		ReplicationSlotAcquire(remote_slot->name, true);
+
+		Assert(slot == MyReplicationSlot);
+
+		/*
+		 * Copy the invalidation cause from remote only if local slot is not
+		 * invalidated locally, we don't want to overwrite existing one.
+		 */
+		if (slot->data.invalidated == RS_INVAL_NONE)
+		{
+			SpinLockAcquire(&slot->mutex);
+			slot->data.invalidated = remote_slot->invalidated;
+			SpinLockRelease(&slot->mutex);
+
+			/* Make sure the invalidated state persists across server restart */
+			ReplicationSlotMarkDirty();
+			ReplicationSlotSave();
+			slot_updated = true;
+		}
+
+		/* Skip the sync of an invalidated slot */
+		if (slot->data.invalidated != RS_INVAL_NONE)
+		{
+			ReplicationSlotRelease();
+			return slot_updated;
+		}
+
+		/* Slot not ready yet, let's attempt to make it sync-ready now. */
+		if (slot->data.persistency == RS_TEMPORARY)
+		{
+			slot_updated = update_and_persist_slot(remote_slot);
+		}
+
+		/* Slot ready for sync, so sync it. */
+		else
+		{
+			/*
+			 * Sanity check: As long as the invalidations are handled
+			 * appropriately as above, this should never happen.
+			 */
+			if (remote_slot->restart_lsn < slot->data.restart_lsn)
+				elog(ERROR,
+					 "cannot synchronize local slot \"%s\" LSN(%X/%X)"
+					 " to remote slot's LSN(%X/%X) as synchronization"
+					 " would move it backwards", remote_slot->name,
+					 LSN_FORMAT_ARGS(slot->data.restart_lsn),
+					 LSN_FORMAT_ARGS(remote_slot->restart_lsn));
+
+			/* Make sure the slot changes persist across server restart */
+			if (local_slot_update(remote_slot))
+			{
+				slot_updated = true;
+				ReplicationSlotMarkDirty();
+				ReplicationSlotSave();
+			}
+		}
+	}
+	/* Otherwise create the slot first. */
+	else
+	{
+		TransactionId xmin_horizon = InvalidTransactionId;
+
+		/* Skip creating the local slot if remote_slot is invalidated already */
+		if (remote_slot->invalidated != RS_INVAL_NONE)
+			return false;
+
+		/* Ensure that we have transaction env needed by get_database_oid() */
+		Assert(IsTransactionState());
+
+		ReplicationSlotCreate(remote_slot->name, true, RS_TEMPORARY,
+							  remote_slot->two_phase,
+							  remote_slot->failover,
+							  true /* synced */ );
+
+		/* For shorter lines. */
+		slot = MyReplicationSlot;
+
+		SpinLockAcquire(&slot->mutex);
+		slot->data.database = get_database_oid(remote_slot->database, false);
+		namestrcpy(&slot->data.plugin, remote_slot->plugin);
+		SpinLockRelease(&slot->mutex);
+
+		reserve_wal_for_slot(remote_slot->restart_lsn);
+
+		LWLockAcquire(ProcArrayLock, LW_EXCLUSIVE);
+		xmin_horizon = GetOldestSafeDecodingTransactionId(true);
+		SpinLockAcquire(&slot->mutex);
+		slot->data.catalog_xmin = xmin_horizon;
+		SpinLockRelease(&slot->mutex);
+		ReplicationSlotsComputeRequiredXmin(true);
+		LWLockRelease(ProcArrayLock);
+
+		(void) update_and_persist_slot(remote_slot);
+		slot_updated = true;
+	}
+
+	ReplicationSlotRelease();
+
+	return slot_updated;
+}
+
+/*
+ * Maps the pg_replication_slots.conflict_reason text value to
+ * ReplicationSlotInvalidationCause enum value
+ */
+static ReplicationSlotInvalidationCause
+get_slot_invalidation_cause(char *conflict_reason)
+{
+	Assert(conflict_reason);
+
+	if (strcmp(conflict_reason, SLOT_INVAL_WAL_REMOVED_TEXT) == 0)
+		return RS_INVAL_WAL_REMOVED;
+	else if (strcmp(conflict_reason, SLOT_INVAL_HORIZON_TEXT) == 0)
+		return RS_INVAL_HORIZON;
+	else if (strcmp(conflict_reason, SLOT_INVAL_WAL_LEVEL_TEXT) == 0)
+		return RS_INVAL_WAL_LEVEL;
+	else
+		Assert(0);
+
+	/* Keep compiler quiet */
+	return RS_INVAL_NONE;
+}
+
+/*
+ * Synchronize slots.
+ *
+ * Gets the failover logical slots info from the primary server and updates
+ * the slots locally. Creates the slots if not present on the standby.
+ *
+ * Returns TRUE if any of the slots gets updated in this sync-cycle.
+ */
+static bool
+synchronize_slots(WalReceiverConn *wrconn)
+{
+#define SLOTSYNC_COLUMN_COUNT 9
+	Oid			slotRow[SLOTSYNC_COLUMN_COUNT] = {TEXTOID, TEXTOID, LSNOID,
+	LSNOID, XIDOID, BOOLOID, BOOLOID, TEXTOID, TEXTOID};
+
+	WalRcvExecResult *res;
+	TupleTableSlot *tupslot;
+	StringInfoData s;
+	List	   *remote_slot_list = NIL;
+	bool		some_slot_updated = false;
+	XLogRecPtr	latestWalEnd;
+
+	/*
+	 * The primary_slot_name is not set yet or WALs not received yet.
+	 * Synchronization is not possible if the walreceiver is not started.
+	 */
+	latestWalEnd = GetWalRcvLatestWalEnd();
+	SpinLockAcquire(&WalRcv->mutex);
+	if ((WalRcv->slotname[0] == '\0') ||
+		XLogRecPtrIsInvalid(latestWalEnd))
+	{
+		SpinLockRelease(&WalRcv->mutex);
+		return false;
+	}
+	SpinLockRelease(&WalRcv->mutex);
+
+	/* The syscache access in walrcv_exec() needs a transaction env. */
+	StartTransactionCommand();
+
+	initStringInfo(&s);
+
+	/* Construct query to fetch slots with failover enabled. */
+	appendStringInfo(&s,
+					 "SELECT slot_name, plugin, confirmed_flush_lsn,"
+					 " restart_lsn, catalog_xmin, two_phase, failover,"
+					 " database, conflict_reason"
+					 " FROM pg_catalog.pg_replication_slots"
+					 " WHERE failover and NOT temporary");
+
+	/* Execute the query */
+	res = walrcv_exec(wrconn, s.data, SLOTSYNC_COLUMN_COUNT, slotRow);
+	pfree(s.data);
+
+	if (res->status != WALRCV_OK_TUPLES)
+		ereport(ERROR,
+				errmsg("could not fetch failover logical slots info"
+					   " from the primary server: %s", res->err));
+
+	/* Construct the remote_slot tuple and synchronize each slot locally */
+	tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
+	while (tuplestore_gettupleslot(res->tuplestore, true, false, tupslot))
+	{
+		bool		isnull;
+		RemoteSlot *remote_slot = palloc0(sizeof(RemoteSlot));
+		Datum		d;
+
+		remote_slot->name = TextDatumGetCString(slot_getattr(tupslot, 1, &isnull));
+		Assert(!isnull);
+
+		remote_slot->plugin = TextDatumGetCString(slot_getattr(tupslot, 2, &isnull));
+		Assert(!isnull);
+
+		/*
+		 * It is possible to get null values for LSN and Xmin if slot is
+		 * invalidated on the primary server, so handle accordingly.
+		 */
+		d = slot_getattr(tupslot, 3, &isnull);
+		remote_slot->confirmed_lsn = isnull ? InvalidXLogRecPtr :
+			DatumGetLSN(d);
+
+		d = slot_getattr(tupslot, 4, &isnull);
+		remote_slot->restart_lsn = isnull ? InvalidXLogRecPtr : DatumGetLSN(d);
+
+		d = slot_getattr(tupslot, 5, &isnull);
+		remote_slot->catalog_xmin = isnull ? InvalidTransactionId :
+			DatumGetTransactionId(d);
+
+		remote_slot->two_phase = DatumGetBool(slot_getattr(tupslot, 6, &isnull));
+		Assert(!isnull);
+
+		remote_slot->failover = DatumGetBool(slot_getattr(tupslot, 7, &isnull));
+		Assert(!isnull);
+
+		remote_slot->database = TextDatumGetCString(slot_getattr(tupslot,
+																 8, &isnull));
+		Assert(!isnull);
+
+		d = slot_getattr(tupslot, 9, &isnull);
+		remote_slot->invalidated = isnull ? RS_INVAL_NONE :
+			get_slot_invalidation_cause(TextDatumGetCString(d));
+
+		/* Create list of remote slots */
+		remote_slot_list = lappend(remote_slot_list, remote_slot);
+
+		ExecClearTuple(tupslot);
+	}
+
+	/* Drop local slots that no longer need to be synced. */
+	drop_obsolete_slots(remote_slot_list);
+
+	/* Now sync the slots locally */
+	foreach_ptr(RemoteSlot, remote_slot, remote_slot_list)
+		some_slot_updated |= synchronize_one_slot(wrconn, remote_slot);
+
+	/* We are done, free remote_slot_list elements */
+	list_free_deep(remote_slot_list);
+
+	walrcv_clear_result(res);
+
+	CommitTransactionCommand();
+
+	return some_slot_updated;
+}
+
+/*
+ * Checks the primary server info.
+ *
+ * Using the specified primary server connection, check whether we are a
+ * cascading standby. It also validates primary_slot_name for non-cascading
+ * standbys.
+ */
+static void
+check_primary_info(WalReceiverConn *wrconn, bool *am_cascading_standby)
+{
+#define PRIMARY_INFO_OUTPUT_COL_COUNT 2
+	WalRcvExecResult *res;
+	Oid			slotRow[PRIMARY_INFO_OUTPUT_COL_COUNT] = {BOOLOID, BOOLOID};
+	StringInfoData cmd;
+	bool		isnull;
+	TupleTableSlot *tupslot;
+	bool		valid;
+	bool		remote_in_recovery;
+
+	/* The syscache access in walrcv_exec() needs a transaction env. */
+	StartTransactionCommand();
+
+	Assert(am_cascading_standby != NULL);
+
+	*am_cascading_standby = false;	/* overwritten later if cascading */
+
+	initStringInfo(&cmd);
+	appendStringInfo(&cmd,
+					 "SELECT pg_is_in_recovery(), count(*) = 1"
+					 " FROM pg_replication_slots"
+					 " WHERE slot_type='physical' AND slot_name=%s",
+					 quote_literal_cstr(PrimarySlotName));
+
+	res = walrcv_exec(wrconn, cmd.data, PRIMARY_INFO_OUTPUT_COL_COUNT, slotRow);
+	pfree(cmd.data);
+
+	if (res->status != WALRCV_OK_TUPLES)
+		ereport(ERROR,
+				errmsg("could not fetch primary_slot_name \"%s\" info from the"
+					   " primary server: %s", PrimarySlotName, res->err));
+
+	tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
+	(void) tuplestore_gettupleslot(res->tuplestore, true, false, tupslot);
+
+	/* It must return one tuple */
+	Assert(tuplestore_tuple_count(res->tuplestore) == 1);
+
+	remote_in_recovery = DatumGetBool(slot_getattr(tupslot, 1, &isnull));
+	Assert(!isnull);
+
+	if (remote_in_recovery)
+	{
+		/* No need to check further, just set am_cascading_standby to true */
+		*am_cascading_standby = true;
+	}
+	else
+	{
+		/* We are a normal standby */
+		valid = DatumGetBool(slot_getattr(tupslot, 2, &isnull));
+		Assert(!isnull);
+
+		if (!valid)
+			ereport(ERROR,
+					errcode(ERRCODE_INVALID_PARAMETER_VALUE),
+					errmsg("exiting from slot synchronization due to bad configuration"),
+			/* translator: second %s is a GUC variable name */
+					errdetail("The primary server slot \"%s\" specified by %s is not valid.",
+							  PrimarySlotName, "primary_slot_name"));
+	}
+
+	ExecClearTuple(tupslot);
+	walrcv_clear_result(res);
+	CommitTransactionCommand();
+}
+
+/*
+ * Check that all necessary GUCs for slot synchronization are set
+ * appropriately. If not, raise an ERROR.
+ *
+ * If all checks pass, extracts the dbname from the primary_conninfo GUC and
+ * returns it.
+ */
+static char *
+validate_parameters_and_get_dbname(void)
+{
+	char	   *dbname;
+
+	/* Sanity check. */
+	Assert(enable_syncslot);
+
+	/*
+	 * A physical replication slot(primary_slot_name) is required on the
+	 * primary to ensure that the rows needed by the standby are not removed
+	 * after restarting, so that the synchronized slot on the standby will not
+	 * be invalidated.
+	 */
+	if (PrimarySlotName == NULL || strcmp(PrimarySlotName, "") == 0)
+		ereport(ERROR,
+		/* translator: %s is a GUC variable name */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("%s must be defined.", "primary_slot_name"));
+
+	/*
+	 * hot_standby_feedback must be enabled to cooperate with the physical
+	 * replication slot, which allows informing the primary about the xmin and
+	 * catalog_xmin values on the standby.
+	 */
+	if (!hot_standby_feedback)
+		ereport(ERROR,
+		/* translator: %s is a GUC variable name */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("%s must be enabled.", "hot_standby_feedback"));
+
+	/*
+	 * Logical decoding requires wal_level >= logical and we currently only
+	 * synchronize logical slots.
+	 */
+	if (wal_level < WAL_LEVEL_LOGICAL)
+		ereport(ERROR,
+		/* translator: %s is a GUC variable name */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("wal_level must be >= logical."));
+
+	/*
+	 * The primary_conninfo is required to make connection to primary for
+	 * getting slots information.
+	 */
+	if (PrimaryConnInfo == NULL || strcmp(PrimaryConnInfo, "") == 0)
+		ereport(ERROR,
+		/* translator: %s is a GUC variable name */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("%s must be defined.", "primary_conninfo"));
+
+	/*
+	 * The slot sync worker needs a database connection for walrcv_exec to
+	 * work.
+	 */
+	dbname = walrcv_get_dbname_from_conninfo(PrimaryConnInfo);
+	if (dbname == NULL)
+		ereport(ERROR,
+
+		/*
+		 * translator: 'dbname' is a specific option; %s is a GUC variable
+		 * name
+		 */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("'dbname' must be specified in %s.", "primary_conninfo"));
+
+	return dbname;
+}
+
+/*
+ * Re-read the config file.
+ *
+ * If any of the slot sync GUCs have changed, exit the worker and
+ * let it get restarted by the postmaster.
+ */
+static void
+slotsync_reread_config(void)
+{
+	char	   *old_primary_conninfo = pstrdup(PrimaryConnInfo);
+	char	   *old_primary_slotname = pstrdup(PrimarySlotName);
+	bool		old_hot_standby_feedback = hot_standby_feedback;
+	bool		conninfo_changed;
+	bool		primary_slotname_changed;
+
+	ConfigReloadPending = false;
+	ProcessConfigFile(PGC_SIGHUP);
+
+	conninfo_changed = strcmp(old_primary_conninfo, PrimaryConnInfo) != 0;
+	primary_slotname_changed = strcmp(old_primary_slotname, PrimarySlotName) != 0;
+
+	if (conninfo_changed ||
+		primary_slotname_changed ||
+		(old_hot_standby_feedback != hot_standby_feedback))
+	{
+		ereport(LOG,
+				errmsg("slot sync worker will restart because of"
+					   " a parameter change"));
+		/* The exit code 1 will make postmaster restart this worker */
+		proc_exit(1);
+	}
+
+	pfree(old_primary_conninfo);
+	pfree(old_primary_slotname);
+}
+
+/*
+ * Interrupt handler for main loop of slot sync worker.
+ */
+static void
+ProcessSlotSyncInterrupts(WalReceiverConn *wrconn)
+{
+	CHECK_FOR_INTERRUPTS();
+
+	if (ShutdownRequestPending)
+	{
+		walrcv_disconnect(wrconn);
+		ereport(LOG,
+				errmsg("replication slot sync worker is shutting down"
+					   " on receiving SIGINT"));
+		proc_exit(0);
+	}
+
+	if (ConfigReloadPending)
+		slotsync_reread_config();
+}
+
+/*
+ * Cleanup function for logical replication launcher.
+ *
+ * Called on logical replication launcher exit.
+ */
+static void
+slotsync_worker_onexit(int code, Datum arg)
+{
+	SpinLockAcquire(&SlotSyncWorker->mutex);
+	SlotSyncWorker->pid = InvalidPid;
+	SpinLockRelease(&SlotSyncWorker->mutex);
+}
+
+/*
+ * Sleep for long enough that we believe it's likely that the slots on primary
+ * get updated.
+ *
+ * If there is no slot activity the wait time between sync-cycles will double
+ * (to a maximum of 30s). If there is some slot activity the wait time between
+ * sync-cycles is reset to the minimum (200ms).
+ */
+static void
+wait_for_slot_activity(bool some_slot_updated, bool am_cascading_standby)
+{
+#define MIN_WORKER_NAPTIME_MS  200
+#define MAX_WORKER_NAPTIME_MS  30000	/* 30s */
+
+	int			rc;
+
+	if (am_cascading_standby)
+	{
+		/*
+		 * Slot synchronization is currently not supported on cascading
+		 * standby. So if we are on the cascading standby, we will skip the
+		 * sync and take a longer nap before we check again whether we are
+		 * still cascading standby or not.
+		 */
+		sleep_ms = MAX_WORKER_NAPTIME_MS;
+	}
+	else if (!some_slot_updated)
+	{
+		/*
+		 * No slots were updated, so double the sleep time, but not beyond the
+		 * maximum allowable value.
+		 */
+		sleep_ms = Min(sleep_ms * 2, MAX_WORKER_NAPTIME_MS);
+	}
+	else
+	{
+		/*
+		 * Some slots were updated since the last sleep, so reset the sleep
+		 * time.
+		 */
+		sleep_ms = MIN_WORKER_NAPTIME_MS;
+	}
+
+	rc = WaitLatch(MyLatch,
+				   WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
+				   sleep_ms,
+				   WAIT_EVENT_REPL_SLOTSYNC_MAIN);
+
+	if (rc & WL_LATCH_SET)
+		ResetLatch(MyLatch);
+}
+
+/*
+ * The main loop of our worker process.
+ *
+ * It connects to the primary server, fetches logical failover slots
+ * information periodically in order to create and sync the slots.
+ */
+void
+ReplSlotSyncWorkerMain(Datum main_arg)
+{
+	WalReceiverConn *wrconn = NULL;
+	char	   *dbname;
+	bool		am_cascading_standby;
+	char	   *err;
+
+	ereport(LOG, errmsg("replication slot sync worker started"));
+
+	on_shmem_exit(slotsync_worker_onexit, (Datum) 0);
+
+	SpinLockAcquire(&SlotSyncWorker->mutex);
+
+	Assert(SlotSyncWorker->pid == InvalidPid);
+
+	/*
+	 * Startup process signaled the slot sync worker to stop, so if meanwhile
+	 * postmaster ended up starting the worker again, exit.
+	 */
+	if (SlotSyncWorker->stopSignaled)
+	{
+		SpinLockRelease(&SlotSyncWorker->mutex);
+		proc_exit(0);
+	}
+
+	/* Advertise our PID so that the startup process can kill us on promotion */
+	SlotSyncWorker->pid = MyProcPid;
+
+	SpinLockRelease(&SlotSyncWorker->mutex);
+
+	/* Setup signal handling */
+	pqsignal(SIGHUP, SignalHandlerForConfigReload);
+	pqsignal(SIGINT, SignalHandlerForShutdownRequest);
+	pqsignal(SIGTERM, die);
+	BackgroundWorkerUnblockSignals();
+
+	/* Load the libpq-specific functions */
+	load_file("libpqwalreceiver", false);
+
+	dbname = validate_parameters_and_get_dbname();
+
+	/*
+	 * Connect to the database specified by user in primary_conninfo. We need
+	 * a database connection for walrcv_exec to work. Please see comments atop
+	 * libpqrcv_exec.
+	 */
+	BackgroundWorkerInitializeConnection(dbname, NULL, 0);
+
+	/*
+	 * Establish the connection to the primary server for slots
+	 * synchronization.
+	 */
+	wrconn = walrcv_connect(PrimaryConnInfo, true, false,
+							cluster_name[0] ? cluster_name : "slotsyncworker",
+							&err);
+	if (!wrconn)
+		ereport(ERROR,
+				errcode(ERRCODE_CONNECTION_FAILURE),
+				errmsg("could not connect to the primary server: %s", err));
+
+	/*
+	 * Using the specified primary server connection, check whether we are
+	 * cascading standby and validates primary_slot_name for
+	 * non-cascading-standbys.
+	 */
+	check_primary_info(wrconn, &am_cascading_standby);
+
+	/* Main wait loop */
+	for (;;)
+	{
+		bool		some_slot_updated = false;
+
+		ProcessSlotSyncInterrupts(wrconn);
+
+		if (!am_cascading_standby)
+			some_slot_updated = synchronize_slots(wrconn);
+
+		wait_for_slot_activity(some_slot_updated, am_cascading_standby);
+
+		/*
+		 * If the standby was promoted then what was previously a cascading
+		 * standby might no longer be one, so recheck each time.
+		 */
+		if (am_cascading_standby)
+			check_primary_info(wrconn, &am_cascading_standby);
+	}
+
+	/*
+	 * The slot sync worker can not get here because it will only stop when it
+	 * receives a SIGINT from the logical replication launcher, or when there
+	 * is an error.
+	 */
+	Assert(false);
+}
+
+/*
+ * Is current process the slot sync worker?
+ */
+bool
+IsLogicalSlotSyncWorker(void)
+{
+	return SlotSyncWorker->pid == MyProcPid;
+}
+
+/*
+ * Shut down the slot sync worker.
+ */
+void
+ShutDownSlotSync(void)
+{
+	SpinLockAcquire(&SlotSyncWorker->mutex);
+
+	SlotSyncWorker->stopSignaled = true;
+
+	if (SlotSyncWorker->pid == InvalidPid)
+	{
+		SpinLockRelease(&SlotSyncWorker->mutex);
+		return;
+	}
+
+	kill(SlotSyncWorker->pid, SIGINT);
+
+	SpinLockRelease(&SlotSyncWorker->mutex);
+
+	/* Wait for it to die */
+	for (;;)
+	{
+		int			rc;
+
+		/* Wait a bit, we don't expect to have to wait long */
+		rc = WaitLatch(MyLatch,
+					   WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
+					   10L, WAIT_EVENT_BGWORKER_SHUTDOWN);
+
+		if (rc & WL_LATCH_SET)
+		{
+			ResetLatch(MyLatch);
+			CHECK_FOR_INTERRUPTS();
+		}
+
+		SpinLockAcquire(&SlotSyncWorker->mutex);
+
+		/* Is it gone? */
+		if (SlotSyncWorker->pid == InvalidPid)
+			break;
+
+		SpinLockRelease(&SlotSyncWorker->mutex);
+	}
+
+	SpinLockRelease(&SlotSyncWorker->mutex);
+}
+
+/*
+ * Allocate and initialize slot sync worker shared memory
+ */
+void
+SlotSyncWorkerShmemInit(void)
+{
+	Size		size;
+	bool		found;
+
+	size = sizeof(SlotSyncWorkerCtxStruct);
+	size = MAXALIGN(size);
+
+	SlotSyncWorker = (SlotSyncWorkerCtxStruct *)
+		ShmemInitStruct("Slot Sync Worker Data", size, &found);
+
+	if (!found)
+	{
+		memset(SlotSyncWorker, 0, size);
+		SlotSyncWorker->pid = InvalidPid;
+		SpinLockInit(&SlotSyncWorker->mutex);
+	}
+}
+
+/*
+ * Register the background worker for slots synchronization provided
+ * enable_syncslot is ON.
+ */
+void
+SlotSyncWorkerRegister(void)
+{
+	BackgroundWorker bgw;
+
+	if (!enable_syncslot)
+	{
+		ereport(LOG,
+				errmsg("skipping slot synchronization"),
+				errdetail("enable_syncslot is disabled."));
+		return;
+	}
+
+	memset(&bgw, 0, sizeof(bgw));
+
+	/* We need database connection which needs shared-memory access as well */
+	bgw.bgw_flags = BGWORKER_SHMEM_ACCESS |
+		BGWORKER_BACKEND_DATABASE_CONNECTION;
+
+	/* Start as soon as a consistent state has been reached in a hot standby */
+	bgw.bgw_start_time = BgWorkerStart_ConsistentState_HotStandby;
+
+	snprintf(bgw.bgw_library_name, MAXPGPATH, "postgres");
+	snprintf(bgw.bgw_function_name, BGW_MAXLEN, "ReplSlotSyncWorkerMain");
+	snprintf(bgw.bgw_name, BGW_MAXLEN,
+			 "replication slot sync worker");
+	snprintf(bgw.bgw_type, BGW_MAXLEN,
+			 "slot sync worker");
+
+	bgw.bgw_restart_time = BGW_DEFAULT_RESTART_INTERVAL;
+	bgw.bgw_notify_pid = 0;
+	bgw.bgw_main_arg = (Datum) 0;
+
+	RegisterBackgroundWorker(&bgw);
+}
diff --git a/src/backend/replication/slot.c b/src/backend/replication/slot.c
index 696376400e..33f957b02f 100644
--- a/src/backend/replication/slot.c
+++ b/src/backend/replication/slot.c
@@ -47,6 +47,7 @@
 #include "miscadmin.h"
 #include "pgstat.h"
 #include "replication/slot.h"
+#include "replication/walsender.h"
 #include "storage/fd.h"
 #include "storage/ipc.h"
 #include "storage/proc.h"
@@ -103,7 +104,6 @@ int			max_replication_slots = 10; /* the maximum number of replication
 										 * slots */
 
 static void ReplicationSlotShmemExit(int code, Datum arg);
-static void ReplicationSlotDropAcquired(void);
 static void ReplicationSlotDropPtr(ReplicationSlot *slot);
 
 /* internal persistency functions */
@@ -250,11 +250,12 @@ ReplicationSlotValidateName(const char *name, int elevel)
  *     user will only get commit prepared.
  * failover: If enabled, allows the slot to be synced to physical standbys so
  *     that logical replication can be resumed after failover.
+ * synced: True if the slot is created by a slotsync worker.
  */
 void
 ReplicationSlotCreate(const char *name, bool db_specific,
 					  ReplicationSlotPersistency persistency,
-					  bool two_phase, bool failover)
+					  bool two_phase, bool failover, bool synced)
 {
 	ReplicationSlot *slot = NULL;
 	int			i;
@@ -315,6 +316,7 @@ ReplicationSlotCreate(const char *name, bool db_specific,
 	slot->data.two_phase = two_phase;
 	slot->data.two_phase_at = InvalidXLogRecPtr;
 	slot->data.failover = failover;
+	slot->data.synced = synced;
 
 	/* and then data only present in shared memory */
 	slot->just_dirtied = false;
@@ -680,6 +682,16 @@ ReplicationSlotDrop(const char *name, bool nowait)
 
 	ReplicationSlotAcquire(name, nowait);
 
+	/*
+	 * Do not allow users to drop the slots which are currently being synced
+	 * from the primary to the standby.
+	 */
+	if (RecoveryInProgress() && MyReplicationSlot->data.synced)
+		ereport(ERROR,
+				errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+				errmsg("cannot drop replication slot \"%s\"", name),
+				errdetail("This slot is being synced from the primary server."));
+
 	ReplicationSlotDropAcquired();
 }
 
@@ -699,6 +711,16 @@ ReplicationSlotAlter(const char *name, bool failover)
 				errmsg("cannot use %s with a physical replication slot",
 					   "ALTER_REPLICATION_SLOT"));
 
+	/*
+	 * Do not allow users to alter the slots which are currently being synced
+	 * from the primary to the standby.
+	 */
+	if (RecoveryInProgress() && MyReplicationSlot->data.synced)
+		ereport(ERROR,
+				errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+				errmsg("cannot alter replication slot \"%s\"", name),
+				errdetail("This slot is being synced from the primary server."));
+
 	SpinLockAcquire(&MyReplicationSlot->mutex);
 	MyReplicationSlot->data.failover = failover;
 	SpinLockRelease(&MyReplicationSlot->mutex);
@@ -711,7 +733,7 @@ ReplicationSlotAlter(const char *name, bool failover)
 /*
  * Permanently drop the currently acquired replication slot.
  */
-static void
+void
 ReplicationSlotDropAcquired(void)
 {
 	ReplicationSlot *slot = MyReplicationSlot;
@@ -867,8 +889,8 @@ ReplicationSlotMarkDirty(void)
 }
 
 /*
- * Convert a slot that's marked as RS_EPHEMERAL to a RS_PERSISTENT slot,
- * guaranteeing it will be there after an eventual crash.
+ * Convert a slot that's marked as RS_EPHEMERAL or RS_TEMPORARY to a
+ * RS_PERSISTENT slot, guaranteeing it will be there after an eventual crash.
  */
 void
 ReplicationSlotPersist(void)
diff --git a/src/backend/replication/slotfuncs.c b/src/backend/replication/slotfuncs.c
index c93dba855b..843ae8cd68 100644
--- a/src/backend/replication/slotfuncs.c
+++ b/src/backend/replication/slotfuncs.c
@@ -43,7 +43,7 @@ create_physical_replication_slot(char *name, bool immediately_reserve,
 	/* acquire replication slot, this will check for conflicting names */
 	ReplicationSlotCreate(name, false,
 						  temporary ? RS_TEMPORARY : RS_PERSISTENT, false,
-						  false);
+						  false, false /* synced */ );
 
 	if (immediately_reserve)
 	{
@@ -136,7 +136,7 @@ create_logical_replication_slot(char *name, char *plugin,
 	 */
 	ReplicationSlotCreate(name, true,
 						  temporary ? RS_TEMPORARY : RS_EPHEMERAL, two_phase,
-						  failover);
+						  failover, false /* synced */ );
 
 	/*
 	 * Create logical decoding context to find start point or, if we don't
@@ -237,7 +237,7 @@ pg_drop_replication_slot(PG_FUNCTION_ARGS)
 Datum
 pg_get_replication_slots(PG_FUNCTION_ARGS)
 {
-#define PG_GET_REPLICATION_SLOTS_COLS 16
+#define PG_GET_REPLICATION_SLOTS_COLS 17
 	ReturnSetInfo *rsinfo = (ReturnSetInfo *) fcinfo->resultinfo;
 	XLogRecPtr	currlsn;
 	int			slotno;
@@ -418,21 +418,23 @@ pg_get_replication_slots(PG_FUNCTION_ARGS)
 					break;
 
 				case RS_INVAL_WAL_REMOVED:
-					values[i++] = CStringGetTextDatum("wal_removed");
+					values[i++] = CStringGetTextDatum(SLOT_INVAL_WAL_REMOVED_TEXT);
 					break;
 
 				case RS_INVAL_HORIZON:
-					values[i++] = CStringGetTextDatum("rows_removed");
+					values[i++] = CStringGetTextDatum(SLOT_INVAL_HORIZON_TEXT);
 					break;
 
 				case RS_INVAL_WAL_LEVEL:
-					values[i++] = CStringGetTextDatum("wal_level_insufficient");
+					values[i++] = CStringGetTextDatum(SLOT_INVAL_WAL_LEVEL_TEXT);
 					break;
 			}
 		}
 
 		values[i++] = BoolGetDatum(slot_contents.data.failover);
 
+		values[i++] = BoolGetDatum(slot_contents.data.synced);
+
 		Assert(i == PG_GET_REPLICATION_SLOTS_COLS);
 
 		tuplestore_putvalues(rsinfo->setResult, rsinfo->setDesc,
diff --git a/src/backend/replication/walreceiverfuncs.c b/src/backend/replication/walreceiverfuncs.c
index 73a7d8f96c..d420a833cd 100644
--- a/src/backend/replication/walreceiverfuncs.c
+++ b/src/backend/replication/walreceiverfuncs.c
@@ -345,6 +345,22 @@ GetWalRcvFlushRecPtr(XLogRecPtr *latestChunkStart, TimeLineID *receiveTLI)
 	return recptr;
 }
 
+/*
+ * Returns the latest reported end of WAL on the sender
+ */
+XLogRecPtr
+GetWalRcvLatestWalEnd()
+{
+	WalRcvData *walrcv = WalRcv;
+	XLogRecPtr	recptr;
+
+	SpinLockAcquire(&walrcv->mutex);
+	recptr = walrcv->latestWalEnd;
+	SpinLockRelease(&walrcv->mutex);
+
+	return recptr;
+}
+
 /*
  * Returns the last+1 byte position that walreceiver has written.
  * This returns a recently written value without taking a lock.
diff --git a/src/backend/replication/walsender.c b/src/backend/replication/walsender.c
index 77c8baa32a..c81a7a8344 100644
--- a/src/backend/replication/walsender.c
+++ b/src/backend/replication/walsender.c
@@ -1224,7 +1224,7 @@ CreateReplicationSlot(CreateReplicationSlotCmd *cmd)
 	{
 		ReplicationSlotCreate(cmd->slotname, false,
 							  cmd->temporary ? RS_TEMPORARY : RS_PERSISTENT,
-							  false, false);
+							  false, false, false /* synced */ );
 
 		if (reserve_wal)
 		{
@@ -1255,7 +1255,7 @@ CreateReplicationSlot(CreateReplicationSlotCmd *cmd)
 		 */
 		ReplicationSlotCreate(cmd->slotname, true,
 							  cmd->temporary ? RS_TEMPORARY : RS_EPHEMERAL,
-							  two_phase, failover);
+							  two_phase, failover, false /* synced */ );
 
 		/*
 		 * Do options check early so that we can bail before calling the
diff --git a/src/backend/storage/ipc/ipci.c b/src/backend/storage/ipc/ipci.c
index e5119ed55d..04fed1007e 100644
--- a/src/backend/storage/ipc/ipci.c
+++ b/src/backend/storage/ipc/ipci.c
@@ -38,6 +38,7 @@
 #include "replication/slot.h"
 #include "replication/walreceiver.h"
 #include "replication/walsender.h"
+#include "replication/worker_internal.h"
 #include "storage/bufmgr.h"
 #include "storage/dsm.h"
 #include "storage/ipc.h"
@@ -342,6 +343,7 @@ CreateOrAttachShmemStructs(void)
 	WalSummarizerShmemInit();
 	PgArchShmemInit();
 	ApplyLauncherShmemInit();
+	SlotSyncWorkerShmemInit();
 
 	/*
 	 * Set up other modules that need some shared memory space
diff --git a/src/backend/tcop/postgres.c b/src/backend/tcop/postgres.c
index 1eaaf3c6c5..19b08c1b5f 100644
--- a/src/backend/tcop/postgres.c
+++ b/src/backend/tcop/postgres.c
@@ -3286,6 +3286,17 @@ ProcessInterrupts(void)
 			 */
 			proc_exit(1);
 		}
+		else if (IsLogicalSlotSyncWorker())
+		{
+			elog(DEBUG1,
+				 "replication slot sync worker is shutting down due to administrator command");
+
+			/*
+			 * Slot sync worker can be stopped at any time. Use exit status 1
+			 * so the background worker is restarted.
+			 */
+			proc_exit(1);
+		}
 		else if (IsBackgroundWorker)
 			ereport(FATAL,
 					(errcode(ERRCODE_ADMIN_SHUTDOWN),
diff --git a/src/backend/utils/activity/wait_event_names.txt b/src/backend/utils/activity/wait_event_names.txt
index f625473ad4..0879bab57e 100644
--- a/src/backend/utils/activity/wait_event_names.txt
+++ b/src/backend/utils/activity/wait_event_names.txt
@@ -53,6 +53,8 @@ LOGICAL_APPLY_MAIN	"Waiting in main loop of logical replication apply process."
 LOGICAL_LAUNCHER_MAIN	"Waiting in main loop of logical replication launcher process."
 LOGICAL_PARALLEL_APPLY_MAIN	"Waiting in main loop of logical replication parallel apply process."
 RECOVERY_WAL_STREAM	"Waiting in main loop of startup process for WAL to arrive, during streaming recovery."
+REPL_SLOTSYNC_MAIN	"Waiting in main loop of slot sync worker."
+REPL_SLOTSYNC_PRIMARY_CATCHUP	"Waiting for the primary to catch-up, in slot sync worker."
 SYSLOGGER_MAIN	"Waiting in main loop of syslogger process."
 WAL_RECEIVER_MAIN	"Waiting in main loop of WAL receiver process."
 WAL_SENDER_MAIN	"Waiting in main loop of WAL sender process."
diff --git a/src/backend/utils/misc/guc_tables.c b/src/backend/utils/misc/guc_tables.c
index e53ebc6dc2..0f5ec63de1 100644
--- a/src/backend/utils/misc/guc_tables.c
+++ b/src/backend/utils/misc/guc_tables.c
@@ -68,6 +68,7 @@
 #include "replication/logicallauncher.h"
 #include "replication/slot.h"
 #include "replication/syncrep.h"
+#include "replication/worker_internal.h"
 #include "storage/bufmgr.h"
 #include "storage/large_object.h"
 #include "storage/pg_shmem.h"
@@ -2044,6 +2045,15 @@ struct config_bool ConfigureNamesBool[] =
 		NULL, NULL, NULL
 	},
 
+	{
+		{"enable_syncslot", PGC_POSTMASTER, REPLICATION_STANDBY,
+			gettext_noop("Enables a physical standby to synchronize logical failover slots from the primary server."),
+		},
+		&enable_syncslot,
+		false,
+		NULL, NULL, NULL
+	},
+
 	/* End-of-list marker */
 	{
 		{NULL, 0, 0, NULL, NULL}, NULL, false, NULL, NULL, NULL
diff --git a/src/backend/utils/misc/postgresql.conf.sample b/src/backend/utils/misc/postgresql.conf.sample
index 835b0e9ba8..6830f7d16b 100644
--- a/src/backend/utils/misc/postgresql.conf.sample
+++ b/src/backend/utils/misc/postgresql.conf.sample
@@ -361,6 +361,7 @@
 #wal_retrieve_retry_interval = 5s	# time to wait before retrying to
 					# retrieve WAL after a failed attempt
 #recovery_min_apply_delay = 0		# minimum delay for applying changes during recovery
+#enable_syncslot = off			# enables slot synchronization on the physical standby from the primary
 
 # - Subscribers -
 
diff --git a/src/include/catalog/pg_proc.dat b/src/include/catalog/pg_proc.dat
index b9e747d72f..6dc234f9f7 100644
--- a/src/include/catalog/pg_proc.dat
+++ b/src/include/catalog/pg_proc.dat
@@ -11115,9 +11115,9 @@
   proname => 'pg_get_replication_slots', prorows => '10', proisstrict => 'f',
   proretset => 't', provolatile => 's', prorettype => 'record',
   proargtypes => '',
-  proallargtypes => '{name,name,text,oid,bool,bool,int4,xid,xid,pg_lsn,pg_lsn,text,int8,bool,text,bool}',
-  proargmodes => '{o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o}',
-  proargnames => '{slot_name,plugin,slot_type,datoid,temporary,active,active_pid,xmin,catalog_xmin,restart_lsn,confirmed_flush_lsn,wal_status,safe_wal_size,two_phase,conflict_reason,failover}',
+  proallargtypes => '{name,name,text,oid,bool,bool,int4,xid,xid,pg_lsn,pg_lsn,text,int8,bool,text,bool,bool}',
+  proargmodes => '{o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o}',
+  proargnames => '{slot_name,plugin,slot_type,datoid,temporary,active,active_pid,xmin,catalog_xmin,restart_lsn,confirmed_flush_lsn,wal_status,safe_wal_size,two_phase,conflict_reason,failover,synced}',
   prosrc => 'pg_get_replication_slots' },
 { oid => '3786', descr => 'set up a logical replication slot',
   proname => 'pg_create_logical_replication_slot', provolatile => 'v',
diff --git a/src/include/postmaster/bgworker.h b/src/include/postmaster/bgworker.h
index 22fc49ec27..7092fc72c6 100644
--- a/src/include/postmaster/bgworker.h
+++ b/src/include/postmaster/bgworker.h
@@ -79,6 +79,7 @@ typedef enum
 	BgWorkerStart_PostmasterStart,
 	BgWorkerStart_ConsistentState,
 	BgWorkerStart_RecoveryFinished,
+	BgWorkerStart_ConsistentState_HotStandby,
 } BgWorkerStartTime;
 
 #define BGW_DEFAULT_RESTART_INTERVAL	60
diff --git a/src/include/replication/logicalworker.h b/src/include/replication/logicalworker.h
index a18d79d1b2..bbe04226db 100644
--- a/src/include/replication/logicalworker.h
+++ b/src/include/replication/logicalworker.h
@@ -22,6 +22,7 @@ extern void TablesyncWorkerMain(Datum main_arg);
 
 extern bool IsLogicalWorker(void);
 extern bool IsLogicalParallelApplyWorker(void);
+extern bool IsLogicalSlotSyncWorker(void);
 
 extern void HandleParallelApplyMessageInterrupt(void);
 extern void HandleParallelApplyMessages(void);
diff --git a/src/include/replication/slot.h b/src/include/replication/slot.h
index 585ccbb504..f81bef9e42 100644
--- a/src/include/replication/slot.h
+++ b/src/include/replication/slot.h
@@ -52,6 +52,14 @@ typedef enum ReplicationSlotInvalidationCause
 	RS_INVAL_WAL_LEVEL,
 } ReplicationSlotInvalidationCause;
 
+/*
+ * The possible values for 'conflict_reason' returned in
+ * pg_get_replication_slots.
+ */
+#define SLOT_INVAL_WAL_REMOVED_TEXT "wal_removed"
+#define SLOT_INVAL_HORIZON_TEXT     "rows_removed"
+#define SLOT_INVAL_WAL_LEVEL_TEXT   "wal_level_insufficient"
+
 /*
  * On-Disk data of a replication slot, preserved across restarts.
  */
@@ -112,6 +120,11 @@ typedef struct ReplicationSlotPersistentData
 	/* plugin name */
 	NameData	plugin;
 
+	/*
+	 * Was this slot synchronized from the primary server?
+	 */
+	char		synced;
+
 	/*
 	 * Is this a failover slot (sync candidate for physical standbys)? Only
 	 * relevant for logical slots on the primary server.
@@ -224,9 +237,11 @@ extern void ReplicationSlotsShmemInit(void);
 /* management of individual slots */
 extern void ReplicationSlotCreate(const char *name, bool db_specific,
 								  ReplicationSlotPersistency persistency,
-								  bool two_phase, bool failover);
+								  bool two_phase, bool failover,
+								  bool synced);
 extern void ReplicationSlotPersist(void);
 extern void ReplicationSlotDrop(const char *name, bool nowait);
+extern void ReplicationSlotDropAcquired(void);
 extern void ReplicationSlotAlter(const char *name, bool failover);
 
 extern void ReplicationSlotAcquire(const char *name, bool nowait);
diff --git a/src/include/replication/walreceiver.h b/src/include/replication/walreceiver.h
index f566a99ba1..5e942cb4fc 100644
--- a/src/include/replication/walreceiver.h
+++ b/src/include/replication/walreceiver.h
@@ -279,6 +279,21 @@ typedef void (*walrcv_get_senderinfo_fn) (WalReceiverConn *conn,
 typedef char *(*walrcv_identify_system_fn) (WalReceiverConn *conn,
 											TimeLineID *primary_tli);
 
+/*
+ * walrcv_get_dbinfo_for_failover_slots_fn
+ *
+ * Run LIST_DBID_FOR_FAILOVER_SLOTS on primary server to get the
+ * list of unique DBIDs for failover logical slots
+ */
+typedef List *(*walrcv_get_dbinfo_for_failover_slots_fn) (WalReceiverConn *conn);
+
+/*
+ * walrcv_get_dbname_from_conninfo_fn
+ *
+ * Returns the dbid from the primary_conninfo
+ */
+typedef char *(*walrcv_get_dbname_from_conninfo_fn) (const char *conninfo);
+
 /*
  * walrcv_server_version_fn
  *
@@ -403,6 +418,7 @@ typedef struct WalReceiverFunctionsType
 	walrcv_get_conninfo_fn walrcv_get_conninfo;
 	walrcv_get_senderinfo_fn walrcv_get_senderinfo;
 	walrcv_identify_system_fn walrcv_identify_system;
+	walrcv_get_dbname_from_conninfo_fn walrcv_get_dbname_from_conninfo;
 	walrcv_server_version_fn walrcv_server_version;
 	walrcv_readtimelinehistoryfile_fn walrcv_readtimelinehistoryfile;
 	walrcv_startstreaming_fn walrcv_startstreaming;
@@ -428,6 +444,8 @@ extern PGDLLIMPORT WalReceiverFunctionsType *WalReceiverFunctions;
 	WalReceiverFunctions->walrcv_get_senderinfo(conn, sender_host, sender_port)
 #define walrcv_identify_system(conn, primary_tli) \
 	WalReceiverFunctions->walrcv_identify_system(conn, primary_tli)
+#define walrcv_get_dbname_from_conninfo(conninfo) \
+	WalReceiverFunctions->walrcv_get_dbname_from_conninfo(conninfo)
 #define walrcv_server_version(conn) \
 	WalReceiverFunctions->walrcv_server_version(conn)
 #define walrcv_readtimelinehistoryfile(conn, tli, filename, content, size) \
@@ -485,6 +503,7 @@ extern void RequestXLogStreaming(TimeLineID tli, XLogRecPtr recptr,
 								 bool create_temp_slot);
 extern XLogRecPtr GetWalRcvFlushRecPtr(XLogRecPtr *latestChunkStart, TimeLineID *receiveTLI);
 extern XLogRecPtr GetWalRcvWriteRecPtr(void);
+extern XLogRecPtr GetWalRcvLatestWalEnd(void);
 extern int	GetReplicationApplyDelay(void);
 extern int	GetReplicationTransferLatency(void);
 
diff --git a/src/include/replication/worker_internal.h b/src/include/replication/worker_internal.h
index 515aefd519..2167720971 100644
--- a/src/include/replication/worker_internal.h
+++ b/src/include/replication/worker_internal.h
@@ -237,6 +237,11 @@ extern PGDLLIMPORT bool in_remote_transaction;
 
 extern PGDLLIMPORT bool InitializingApplyWorker;
 
+/* Slot sync worker objects */
+extern PGDLLIMPORT char *PrimaryConnInfo;
+extern PGDLLIMPORT char *PrimarySlotName;
+extern PGDLLIMPORT bool enable_syncslot;
+
 extern void logicalrep_worker_attach(int slot);
 extern LogicalRepWorker *logicalrep_worker_find(Oid subid, Oid relid,
 												bool only_running);
@@ -325,6 +330,11 @@ extern void pa_decr_and_wait_stream_block(void);
 extern void pa_xact_finish(ParallelApplyWorkerInfo *winfo,
 						   XLogRecPtr remote_lsn);
 
+extern void ReplSlotSyncWorkerMain(Datum main_arg);
+extern void SlotSyncWorkerRegister(void);
+extern void ShutDownSlotSync(void);
+extern void SlotSyncWorkerShmemInit(void);
+
 #define isParallelApplyWorker(worker) ((worker)->in_use && \
 									   (worker)->type == WORKERTYPE_PARALLEL_APPLY)
 #define isTablesyncWorker(worker) ((worker)->in_use && \
diff --git a/src/test/recovery/t/050_standby_failover_slots_sync.pl b/src/test/recovery/t/050_standby_failover_slots_sync.pl
index 646293c39e..c17abfb40b 100644
--- a/src/test/recovery/t/050_standby_failover_slots_sync.pl
+++ b/src/test/recovery/t/050_standby_failover_slots_sync.pl
@@ -84,6 +84,170 @@ is( $publisher->safe_psql(
 	"t",
 	'logical slot has failover true on the publisher');
 
-$subscriber1->safe_psql('postgres', "DROP SUBSCRIPTION regress_mysub1");
+$subscriber1->safe_psql('postgres', "ALTER SUBSCRIPTION regress_mysub1 ENABLE");
+
+##################################################
+# Test logical failover slots on the standby
+# Configure standby1 to replicate and synchronize logical slots configured
+# for failover on the primary
+#
+#              failover slot lsub1_slot->| ----> subscriber1 (connected via logical replication)
+# primary --->                           |
+#              physical slot sb1_slot--->| ----> standby1 (connected via streaming replication)
+#                                        |                 lsub1_slot(synced_slot)
+##################################################
+
+my $primary = $publisher;
+my $backup_name = 'backup';
+$primary->backup($backup_name);
+
+# Create a standby
+my $standby1 = PostgreSQL::Test::Cluster->new('standby1');
+$standby1->init_from_backup(
+	$primary, $backup_name,
+	has_streaming => 1,
+	has_restoring => 1);
+
+my $connstr_1 = $primary->connstr;
+$standby1->append_conf(
+	'postgresql.conf', qq(
+enable_syncslot = true
+hot_standby_feedback = on
+primary_slot_name = 'sb1_slot'
+primary_conninfo = '$connstr_1 dbname=postgres'
+));
+
+$primary->psql('postgres',
+	q{SELECT pg_create_physical_replication_slot('sb1_slot');});
+
+my $standby1_conninfo = $standby1->connstr . ' dbname=postgres';
+my $offset = -s $standby1->logfile;
+
+# Start the standby so that slot syncing can begin
+$standby1->start;
+
+# Generate a log to trigger the walsender to send messages to the walreceiver
+# which will update WalRcv->latestWalEnd to a valid number.
+$primary->safe_psql('postgres', "SELECT pg_log_standby_snapshot();");
+
+# Wait for the standby to finish sync
+$standby1->wait_for_log(
+	qr/LOG: ( [A-Z0-9]+:)? newly locally created slot \"lsub1_slot\" is sync-ready now/,
+	$offset);
+
+# Confirm that the logical failover slot is created on the standby and is
+# flagged as 'synced'
+is($standby1->safe_psql('postgres',
+	q{SELECT failover, synced FROM pg_replication_slots WHERE slot_name = 'lsub1_slot';}),
+	"t|t",
+	'logical slot has failover as true and synced as true on standby');
+
+##################################################
+# Test to confirm that restart_lsn and confirmed_flush_lsn of the logical slot
+# on the primary is synced to the standby
+##################################################
+
+# Insert data on the primary
+$primary->safe_psql(
+	'postgres', qq[
+	CREATE TABLE tab_int (a int PRIMARY KEY);
+	INSERT INTO tab_int SELECT generate_series(1, 10);
+]);
+
+# Subscribe to the new table data and wait for it to arrive
+$subscriber1->safe_psql(
+	'postgres', qq[
+	CREATE TABLE tab_int (a int PRIMARY KEY);
+	ALTER SUBSCRIPTION regress_mysub1 REFRESH PUBLICATION;
+]);
+
+$subscriber1->wait_for_subscription_sync;
+
+# Do not allow any further advancement of the restart_lsn and
+# confirmed_flush_lsn for the lsub1_slot.
+$subscriber1->safe_psql('postgres', "ALTER SUBSCRIPTION regress_mysub1 DISABLE");
+
+# Wait for the replication slot to become inactive on the publisher
+$primary->poll_query_until(
+	'postgres',
+	"SELECT COUNT(*) FROM pg_catalog.pg_replication_slots WHERE slot_name = 'lsub1_slot' AND active='f'",
+	1);
+
+# Get the restart_lsn for the logical slot lsub1_slot on the primary
+my $primary_restart_lsn = $primary->safe_psql('postgres',
+	"SELECT restart_lsn from pg_replication_slots WHERE slot_name = 'lsub1_slot';");
+
+# Get the confirmed_flush_lsn for the logical slot lsub1_slot on the primary
+my $primary_flush_lsn = $primary->safe_psql('postgres',
+	"SELECT confirmed_flush_lsn from pg_replication_slots WHERE slot_name = 'lsub1_slot';");
+
+# Confirm that restart_lsn and of confirmed_flush_lsn lsub1_slot slot are synced
+# to the standby
+ok( $standby1->poll_query_until(
+		'postgres',
+		"SELECT '$primary_restart_lsn' = restart_lsn AND '$primary_flush_lsn' = confirmed_flush_lsn from pg_replication_slots WHERE slot_name = 'lsub1_slot';"),
+	'restart_lsn and confirmed_flush_lsn of slot lsub1_slot synced to standby');
+
+##################################################
+# Test that a synchronized slot can not be decoded, altered or dropped by the user
+##################################################
+
+# Disable hot_standby_feedback temporarily to stop slot sync worker otherwise
+# the concerned testing scenarios here may be interrupted by different error:
+# 'ERROR:  replication slot is active for PID ..'
+$standby1->safe_psql('postgres', 'ALTER SYSTEM SET hot_standby_feedback = off;');
+$standby1->restart;
+
+# Attempting to perform logical decoding on a synced slot should result in an error
+my ($result, $stdout, $stderr) = $standby1->psql('postgres',
+	"select * from pg_logical_slot_get_changes('lsub1_slot',NULL,NULL);");
+ok($stderr =~ /ERROR:  cannot use replication slot "lsub1_slot" for logical decoding/,
+	"logical decoding is not allowed on synced slot");
+
+# Attempting to alter a synced slot should result in an error
+($result, $stdout, $stderr) = $standby1->psql(
+    'postgres',
+    qq[ALTER_REPLICATION_SLOT lsub1_slot (failover);],
+    replication => 'database');
+ok($stderr =~ /ERROR:  cannot alter replication slot "lsub1_slot"/,
+	"synced slot on standby cannot be altered");
+
+# Attempting to drop a synced slot should result in an error
+($result, $stdout, $stderr) = $standby1->psql('postgres',
+	"SELECT pg_drop_replication_slot('lsub1_slot');");
+ok($stderr =~ /ERROR:  cannot drop replication slot "lsub1_slot"/,
+	"synced slot on standby cannot be dropped");
+
+# Enable hot_standby_feedback and restart standby
+$standby1->safe_psql('postgres', 'ALTER SYSTEM SET hot_standby_feedback = on;');
+$standby1->restart;
+
+##################################################
+# Promote the standby1 to primary. Confirm that:
+# a) the slot 'lsub1_slot' is retained on the new primary
+# b) logical replication for regress_mysub1 is resumed successfully after failover
+##################################################
+$standby1->promote;
+
+# Update subscription with the new primary's connection info
+$subscriber1->safe_psql('postgres',
+	"ALTER SUBSCRIPTION regress_mysub1 CONNECTION '$standby1_conninfo';
+	 ALTER SUBSCRIPTION regress_mysub1 ENABLE; ");
+
+# Confirm the synced slot 'lsub1_slot' is retained on the new primary
+is($standby1->safe_psql('postgres',
+	q{SELECT slot_name FROM pg_replication_slots WHERE slot_name = 'lsub1_slot';}),
+	'lsub1_slot',
+	'synced slot retained on the new primary');
+
+# Insert data on the new primary
+$standby1->safe_psql('postgres',
+	"INSERT INTO tab_int SELECT generate_series(11, 20);");
+$standby1->wait_for_catchup('regress_mysub1');
+
+# Confirm that data in tab_int replicated on the subscriber
+is( $subscriber1->safe_psql('postgres', q{SELECT count(*) FROM tab_int;}),
+	"20",
+	'data replicated from the new primary');
 
 done_testing();
diff --git a/src/test/regress/expected/rules.out b/src/test/regress/expected/rules.out
index 57884d3fec..cb43ba1c3f 100644
--- a/src/test/regress/expected/rules.out
+++ b/src/test/regress/expected/rules.out
@@ -1474,8 +1474,9 @@ pg_replication_slots| SELECT l.slot_name,
     l.safe_wal_size,
     l.two_phase,
     l.conflict_reason,
-    l.failover
-   FROM (pg_get_replication_slots() l(slot_name, plugin, slot_type, datoid, temporary, active, active_pid, xmin, catalog_xmin, restart_lsn, confirmed_flush_lsn, wal_status, safe_wal_size, two_phase, conflict_reason, failover)
+    l.failover,
+    l.synced
+   FROM (pg_get_replication_slots() l(slot_name, plugin, slot_type, datoid, temporary, active, active_pid, xmin, catalog_xmin, restart_lsn, confirmed_flush_lsn, wal_status, safe_wal_size, two_phase, conflict_reason, failover, synced)
      LEFT JOIN pg_database d ON ((l.datoid = d.oid)));
 pg_roles| SELECT pg_authid.rolname,
     pg_authid.rolsuper,
diff --git a/src/test/regress/expected/sysviews.out b/src/test/regress/expected/sysviews.out
index 271313ebf8..aac83755de 100644
--- a/src/test/regress/expected/sysviews.out
+++ b/src/test/regress/expected/sysviews.out
@@ -132,8 +132,9 @@ select name, setting from pg_settings where name like 'enable%';
  enable_self_join_removal       | on
  enable_seqscan                 | on
  enable_sort                    | on
+ enable_syncslot                | off
  enable_tidscan                 | on
-(22 rows)
+(23 rows)
 
 -- There are always wait event descriptions for various types.
 select type, count(*) > 0 as ok FROM pg_wait_events
diff --git a/src/tools/pgindent/typedefs.list b/src/tools/pgindent/typedefs.list
index 7782c12d2e..10a73ba633 100644
--- a/src/tools/pgindent/typedefs.list
+++ b/src/tools/pgindent/typedefs.list
@@ -2321,6 +2321,7 @@ RelocationBufferInfo
 RelptrFreePageBtree
 RelptrFreePageManager
 RelptrFreePageSpanLeader
+RemoteSlot
 RenameStmt
 ReopenPtrType
 ReorderBuffer
@@ -2581,6 +2582,7 @@ SlabBlock
 SlabContext
 SlabSlot
 SlotNumber
+SlotSyncWorkerCtxStruct
 SlruCtl
 SlruCtlData
 SlruErrorCause
-- 
2.34.1