v75-0002-Add-logical-slot-sync-capability-to-the-physical.patch
application/octet-stream
Filename: v75-0002-Add-logical-slot-sync-capability-to-the-physical.patch
Type: application/octet-stream
Part: 3
Patch
Format: format-patch
Series: patch v75-0002
Subject: Add logical slot sync capability to the physical standby
| File | + | − |
|---|---|---|
| doc/src/sgml/config.sgml | 25 | 2 |
| doc/src/sgml/logicaldecoding.sgml | 39 | 0 |
| doc/src/sgml/protocol.sgml | 4 | 2 |
| doc/src/sgml/system-views.sgml | 20 | 2 |
| src/backend/access/transam/xlog.c | 4 | 1 |
| src/backend/access/transam/xlogrecovery.c | 15 | 0 |
| src/backend/catalog/system_views.sql | 2 | 1 |
| src/backend/postmaster/bgworker.c | 1 | 0 |
| src/backend/postmaster/postmaster.c | 64 | 14 |
| src/backend/replication/logical/logical.c | 12 | 0 |
| src/backend/replication/logical/Makefile | 1 | 0 |
| src/backend/replication/logical/meson.build | 1 | 0 |
| src/backend/replication/logical/slotsync.c | 1467 | 0 |
| src/backend/replication/slot.c | 54 | 5 |
| src/backend/replication/slotfuncs.c | 17 | 9 |
| src/backend/replication/walreceiverfuncs.c | 16 | 0 |
| src/backend/replication/walsender.c | 12 | 7 |
| src/backend/storage/ipc/ipci.c | 2 | 0 |
| src/backend/storage/lmgr/proc.c | 11 | 2 |
| src/backend/utils/activity/pgstat_io.c | 1 | 0 |
| src/backend/utils/activity/wait_event_names.txt | 2 | 0 |
| src/backend/utils/init/miscinit.c | 7 | 2 |
| src/backend/utils/init/postinit.c | 5 | 3 |
| src/backend/utils/misc/guc_tables.c | 10 | 0 |
| src/backend/utils/misc/postgresql.conf.sample | 1 | 0 |
| src/include/catalog/pg_proc.dat | 3 | 3 |
| src/include/miscadmin.h | 1 | 0 |
| src/include/replication/logicalworker.h | 1 | 0 |
| src/include/replication/slot.h | 16 | 1 |
| src/include/replication/walreceiver.h | 1 | 0 |
| src/include/replication/walsender.h | 3 | 0 |
| src/include/replication/worker_internal.h | 12 | 0 |
| src/test/recovery/t/040_standby_failover_slots_sync.pl | 166 | 1 |
| src/test/regress/expected/rules.out | 3 | 2 |
| src/test/regress/expected/sysviews.out | 2 | 1 |
| src/tools/pgindent/typedefs.list | 2 | 0 |
From 831d676f04748221d3227b584a415a7cbb6bc53a Mon Sep 17 00:00:00 2001
From: Shveta Malik <shveta.malik@gmail.com>
Date: Thu, 1 Feb 2024 15:20:59 +0530
Subject: [PATCH v75 2/4] Add logical slot sync capability to the physical
standby
This patch implements synchronization of logical replication slots
from the primary server to the physical standby so that logical
replication can be resumed after failover.
GUC 'enable_syncslot' enables a physical standby to synchronize failover
logical replication slots from the primary server.
The logical replication slots on the primary can be synchronized to the hot
standby by enabling the failover option during slot creation and setting
'enable_syncslot' on the standby. For the synchronization to work, it is
mandatory to have a physical replication slot between the primary and the
standby, hot_standby_feedback must be enabled on the standby and a valid
dbname must be specified in primary_conninfo.
All the failover logical replication slots on the primary (assuming
configurations are appropriate) are automatically created on the physical
standbys and are synced periodically. Slot-sync worker on the standby server
ping the primary server at regular intervals to get the necessary
failover logical slots information and create/update the slots locally.
The nap time of the worker is tuned according to the activity on the primary.
The worker waits for a period of time before the next synchronization, with the
duration varying based on whether any slots were updated during the last
cycle.
The logical slots created by slot-sync worker on physical standbys are not
allowed to be dropped or consumed. Any attempt to perform logical decoding on
such slots will result in an error.
If a logical slot is invalidated on the primary, then that slot on the standby
is also invalidated.
If a logical slot on the primary is valid but is invalidated on the standby,
then that slot is dropped and recreated on the standby in next sync-cycle
provided the slot still exists on the primary server. It is okay to recreate
such slots as long as these are not consumable on the standby (which is the
case currently). This situation may occur due to the following reasons:
- The max_slot_wal_keep_size on the standby is insufficient to retain WAL
records from the restart_lsn of the slot.
- primary_slot_name is temporarily reset to null and the physical slot is
removed.
- The primary changes wal_level to a level lower than logical.
The slots synchronization status on the standby can be monitored using
'synced' column of pg_replication_slots view.
---
doc/src/sgml/config.sgml | 27 +-
doc/src/sgml/logicaldecoding.sgml | 39 +
doc/src/sgml/protocol.sgml | 6 +-
doc/src/sgml/system-views.sgml | 22 +-
src/backend/access/transam/xlog.c | 5 +-
src/backend/access/transam/xlogrecovery.c | 15 +
src/backend/catalog/system_views.sql | 3 +-
src/backend/postmaster/bgworker.c | 1 +
src/backend/postmaster/postmaster.c | 78 +-
src/backend/replication/logical/Makefile | 1 +
src/backend/replication/logical/logical.c | 12 +
src/backend/replication/logical/meson.build | 1 +
src/backend/replication/logical/slotsync.c | 1467 +++++++++++++++++
src/backend/replication/slot.c | 59 +-
src/backend/replication/slotfuncs.c | 26 +-
src/backend/replication/walreceiverfuncs.c | 16 +
src/backend/replication/walsender.c | 19 +-
src/backend/storage/ipc/ipci.c | 2 +
src/backend/storage/lmgr/proc.c | 13 +-
src/backend/utils/activity/pgstat_io.c | 1 +
.../utils/activity/wait_event_names.txt | 2 +
src/backend/utils/init/miscinit.c | 9 +-
src/backend/utils/init/postinit.c | 8 +-
src/backend/utils/misc/guc_tables.c | 10 +
src/backend/utils/misc/postgresql.conf.sample | 1 +
src/include/catalog/pg_proc.dat | 6 +-
src/include/miscadmin.h | 1 +
src/include/replication/logicalworker.h | 1 +
src/include/replication/slot.h | 17 +-
src/include/replication/walreceiver.h | 1 +
src/include/replication/walsender.h | 3 +
src/include/replication/worker_internal.h | 12 +
.../t/040_standby_failover_slots_sync.pl | 167 +-
src/test/regress/expected/rules.out | 5 +-
src/test/regress/expected/sysviews.out | 3 +-
src/tools/pgindent/typedefs.list | 2 +
36 files changed, 2003 insertions(+), 58 deletions(-)
create mode 100644 src/backend/replication/logical/slotsync.c
diff --git a/doc/src/sgml/config.sgml b/doc/src/sgml/config.sgml
index 61038472c5..75bb48b795 100644
--- a/doc/src/sgml/config.sgml
+++ b/doc/src/sgml/config.sgml
@@ -4612,8 +4612,13 @@ ANY <replaceable class="parameter">num_sync</replaceable> ( <replaceable class="
<varname>primary_conninfo</varname> string, or in a separate
<filename>~/.pgpass</filename> file on the standby server (use
<literal>replication</literal> as the database name).
- Do not specify a database name in the
- <varname>primary_conninfo</varname> string.
+ </para>
+ <para>
+ If slot synchronization is enabled (see
+ <xref linkend="logicaldecoding-replication-slots-synchronization"/>)
+ then it is also necessary to specify a valid <literal>dbname</literal>
+ in the <varname>primary_conninfo</varname> string. This will only be
+ used for slot synchronization. It is ignored for streaming.
</para>
<para>
This parameter can only be set in the <filename>postgresql.conf</filename>
@@ -4938,6 +4943,24 @@ ANY <replaceable class="parameter">num_sync</replaceable> ( <replaceable class="
</listitem>
</varlistentry>
+ <varlistentry id="guc-enable-syncslot" xreflabel="enable_syncslot">
+ <term><varname>enable_syncslot</varname> (<type>boolean</type>)
+ <indexterm>
+ <primary><varname>enable_syncslot</varname> configuration parameter</primary>
+ </indexterm>
+ </term>
+ <listitem>
+ <para>
+ It enables a physical standby to synchronize logical failover slots
+ from the primary server so that logical subscribers are not blocked
+ after failover.
+ </para>
+ <para>
+ It is disabled by default. This parameter can only be set in the
+ <filename>postgresql.conf</filename> file or on the server command line.
+ </para>
+ </listitem>
+ </varlistentry>
</variablelist>
</sect2>
diff --git a/doc/src/sgml/logicaldecoding.sgml b/doc/src/sgml/logicaldecoding.sgml
index cd152d4ced..a648227ae3 100644
--- a/doc/src/sgml/logicaldecoding.sgml
+++ b/doc/src/sgml/logicaldecoding.sgml
@@ -358,6 +358,45 @@ postgres=# select * from pg_logical_slot_get_changes('regression_slot', NULL, NU
So if a slot is no longer required it should be dropped.
</para>
</caution>
+
+ </sect2>
+
+ <sect2 id="logicaldecoding-replication-slots-synchronization">
+ <title>Replication Slot Synchronization</title>
+ <para>
+ A logical replication slot on the primary can be synchronized to the hot
+ standby by enabling the <literal>failover</literal> option during slot
+ creation and setting
+ <link linkend="guc-enable-syncslot"><varname>enable_syncslot</varname></link>
+ on the standby. For the synchronization
+ to work, it is mandatory to have a physical replication slot between the
+ primary and the standby, and
+ <link linkend="guc-hot-standby-feedback"><varname>hot_standby_feedback</varname></link>
+ must be enabled on the standby. It is also necessary to specify a valid
+ <literal>dbname</literal> in the
+ <link linkend="guc-primary-conninfo"><varname>primary_conninfo</varname></link>.
+ </para>
+
+ <para>
+ The ability to resume logical replication after failover depends upon the
+ <link linkend="view-pg-replication-slots">pg_replication_slots</link>.<structfield>synced</structfield>
+ value for the synchronized slots on the standby at the time of failover.
+ Only persistent slots that have attained synced state as true on the standby
+ before failover can be used for logical replication after failover.
+ Temporary slots will be dropped, therefore logical replication for those
+ slots cannot be resumed. For example, if the synchronized slot could not
+ become persistent on the standby due to a disabled subscription, then the
+ subscription cannot be resumed after failover even when it is enabled.
+ </para>
+
+ <para>
+ To resume logical replication after failover from the synced logical
+ slots, the subscription's 'conninfo' must be altered to point to the
+ new primary server. This is done using
+ <link linkend="sql-altersubscription-params-connection"><command>ALTER SUBSCRIPTION ... CONNECTION</command></link>.
+ It is recommended that subscriptions are first disabled before promoting
+ the standby and are enabled back after altering the connection string.
+ </para>
</sect2>
<sect2 id="logicaldecoding-explanation-output-plugins">
diff --git a/doc/src/sgml/protocol.sgml b/doc/src/sgml/protocol.sgml
index bb4fef1f51..f8ef2ad2ab 100644
--- a/doc/src/sgml/protocol.sgml
+++ b/doc/src/sgml/protocol.sgml
@@ -2065,7 +2065,8 @@ psql "dbname=postgres replication=database" -c "IDENTIFY_SYSTEM;"
<term><literal>FAILOVER [ <replaceable class="parameter">boolean</replaceable> ]</literal></term>
<listitem>
<para>
- If true, the slot is enabled to be synced to the standbys.
+ If true, the slot is enabled to be synced to the standbys
+ so that logical replication can be resumed after failover.
The default is false.
</para>
</listitem>
@@ -2165,7 +2166,8 @@ psql "dbname=postgres replication=database" -c "IDENTIFY_SYSTEM;"
<term><literal>FAILOVER [ <replaceable class="parameter">boolean</replaceable> ]</literal></term>
<listitem>
<para>
- If true, the slot is enabled to be synced to the standbys.
+ If true, the slot is enabled to be synced to the standbys
+ so that logical replication can be resumed after failover.
</para>
</listitem>
</varlistentry>
diff --git a/doc/src/sgml/system-views.sgml b/doc/src/sgml/system-views.sgml
index dd468b31ea..4ea2177b34 100644
--- a/doc/src/sgml/system-views.sgml
+++ b/doc/src/sgml/system-views.sgml
@@ -2561,10 +2561,28 @@ SELECT * FROM pg_locks pl LEFT JOIN pg_prepared_xacts ppx
<structfield>failover</structfield> <type>bool</type>
</para>
<para>
- True if this is a logical slot enabled to be synced to the standbys.
- Always false for physical slots.
+ True if this is a logical slot enabled to be synced to the standbys
+ so that logical replication can be resumed from the new primary
+ after failover. Always false for physical slots.
</para></entry>
</row>
+
+ <row>
+ <entry role="catalog_table_entry"><para role="column_definition">
+ <structfield>synced</structfield> <type>bool</type>
+ </para>
+ <para>
+ True if this is a logical slot that was synced from a primary server.
+ </para>
+ <para>
+ On a hot standby, the slots with the synced column marked as true can
+ neither be used for logical decoding nor dropped by the user. The value
+ of this column has no meaning on the primary server; the column value on
+ the primary is default false for all slots but may (if leftover from a
+ promoted standby) also be true.
+ </para></entry>
+ </row>
+
</tbody>
</tgroup>
</table>
diff --git a/src/backend/access/transam/xlog.c b/src/backend/access/transam/xlog.c
index 478377c4a2..2d66d0d84b 100644
--- a/src/backend/access/transam/xlog.c
+++ b/src/backend/access/transam/xlog.c
@@ -3596,6 +3596,9 @@ XLogGetLastRemovedSegno(void)
/*
* Return the oldest WAL segment on the given TLI that still exists in
* XLOGDIR, or 0 if none.
+ *
+ * If the given TLI is 0, return the oldest WAL segment among all the currently
+ * existing WAL segments.
*/
XLogSegNo
XLogGetOldestSegno(TimeLineID tli)
@@ -3619,7 +3622,7 @@ XLogGetOldestSegno(TimeLineID tli)
wal_segment_size);
/* Ignore anything that's not from the TLI of interest. */
- if (tli != file_tli)
+ if (tli != 0 && tli != file_tli)
continue;
/* If it's the oldest so far, update oldest_segno. */
diff --git a/src/backend/access/transam/xlogrecovery.c b/src/backend/access/transam/xlogrecovery.c
index 0bb472da27..87b49d524a 100644
--- a/src/backend/access/transam/xlogrecovery.c
+++ b/src/backend/access/transam/xlogrecovery.c
@@ -50,6 +50,7 @@
#include "postmaster/startup.h"
#include "replication/slot.h"
#include "replication/walreceiver.h"
+#include "replication/worker_internal.h"
#include "storage/fd.h"
#include "storage/ipc.h"
#include "storage/latch.h"
@@ -1467,6 +1468,20 @@ FinishWalRecovery(void)
*/
XLogShutdownWalRcv();
+ /*
+ * Shutdown the slot sync workers to prevent potential conflicts between
+ * user processes and slotsync workers after a promotion.
+ *
+ * We do not update the 'synced' column from true to false here, as any
+ * failed update could leave 'synced' column false for some slots. This
+ * could cause issues during slot sync after restarting the server as a
+ * standby. While updating after switching to the new timeline is an
+ * option, it does not simplify the handling for 'synced' column.
+ * Therefore, we retain the 'synced' column as true after promotion as it
+ * may provide useful information about the slot origin.
+ */
+ ShutDownSlotSync();
+
/*
* We are now done reading the xlog from stream. Turn off streaming
* recovery to force fetching the files (which would be required at end of
diff --git a/src/backend/catalog/system_views.sql b/src/backend/catalog/system_views.sql
index 6791bff9dd..04227a72d1 100644
--- a/src/backend/catalog/system_views.sql
+++ b/src/backend/catalog/system_views.sql
@@ -1024,7 +1024,8 @@ CREATE VIEW pg_replication_slots AS
L.safe_wal_size,
L.two_phase,
L.conflict_reason,
- L.failover
+ L.failover,
+ L.synced
FROM pg_get_replication_slots() AS L
LEFT JOIN pg_database D ON (L.datoid = D.oid);
diff --git a/src/backend/postmaster/bgworker.c b/src/backend/postmaster/bgworker.c
index 67f92c24db..1add449f7c 100644
--- a/src/backend/postmaster/bgworker.c
+++ b/src/backend/postmaster/bgworker.c
@@ -21,6 +21,7 @@
#include "postmaster/postmaster.h"
#include "replication/logicallauncher.h"
#include "replication/logicalworker.h"
+#include "replication/worker_internal.h"
#include "storage/dsm.h"
#include "storage/ipc.h"
#include "storage/latch.h"
diff --git a/src/backend/postmaster/postmaster.c b/src/backend/postmaster/postmaster.c
index feb471dd1d..adfaf75cf9 100644
--- a/src/backend/postmaster/postmaster.c
+++ b/src/backend/postmaster/postmaster.c
@@ -116,6 +116,7 @@
#include "postmaster/walsummarizer.h"
#include "replication/logicallauncher.h"
#include "replication/walsender.h"
+#include "replication/worker_internal.h"
#include "storage/fd.h"
#include "storage/ipc.h"
#include "storage/pg_shmem.h"
@@ -167,11 +168,11 @@
* they will never become live backends. dead_end children are not assigned a
* PMChildSlot. dead_end children have bkend_type NORMAL.
*
- * "Special" children such as the startup, bgwriter and autovacuum launcher
- * tasks are not in this list. They are tracked via StartupPID and other
- * pid_t variables below. (Thus, there can't be more than one of any given
- * "special" child process type. We use BackendList entries for any child
- * process there can be more than one of.)
+ * "Special" children such as the startup, bgwriter, autovacuum launcher and
+ * slot sync worker tasks are not in this list. They are tracked via StartupPID
+ * and other pid_t variables below. (Thus, there can't be more than one of any
+ * given "special" child process type. We use BackendList entries for any
+ * child process there can be more than one of.)
*/
typedef struct bkend
{
@@ -254,7 +255,8 @@ static pid_t StartupPID = 0,
WalSummarizerPID = 0,
AutoVacPID = 0,
PgArchPID = 0,
- SysLoggerPID = 0;
+ SysLoggerPID = 0,
+ SlotSyncWorkerPID = 0;
/* Startup process's status */
typedef enum
@@ -458,6 +460,10 @@ static void InitPostmasterDeathWatchHandle(void);
(pmState == PM_RECOVERY || pmState == PM_HOT_STANDBY))) && \
PgArchCanRestart())
+#define SlotSyncWorkerAllowed() \
+ (enable_syncslot && pmState == PM_HOT_STANDBY && \
+ SlotSyncWorkerCanRestart())
+
#ifdef EXEC_BACKEND
#ifdef WIN32
@@ -1830,6 +1836,10 @@ ServerLoop(void)
if (PgArchPID == 0 && PgArchStartupAllowed())
PgArchPID = StartArchiver();
+ /* If we need to start a slot sync worker, try to do that now */
+ if (SlotSyncWorkerPID == 0 && SlotSyncWorkerAllowed())
+ SlotSyncWorkerPID = StartSlotSyncWorker();
+
/* If we need to signal the autovacuum launcher, do so now */
if (avlauncher_needs_signal)
{
@@ -2677,6 +2687,8 @@ process_pm_reload_request(void)
signal_child(PgArchPID, SIGHUP);
if (SysLoggerPID != 0)
signal_child(SysLoggerPID, SIGHUP);
+ if (SlotSyncWorkerPID != 0)
+ signal_child(SlotSyncWorkerPID, SIGHUP);
/* Reload authentication config files too */
if (!load_hba())
@@ -3034,6 +3046,8 @@ process_pm_child_exit(void)
AutoVacPID = StartAutoVacLauncher();
if (PgArchStartupAllowed() && PgArchPID == 0)
PgArchPID = StartArchiver();
+ if (SlotSyncWorkerAllowed() && SlotSyncWorkerPID == 0)
+ SlotSyncWorkerPID = StartSlotSyncWorker();
/* workers may be scheduled to start now */
maybe_start_bgworkers();
@@ -3204,6 +3218,22 @@ process_pm_child_exit(void)
continue;
}
+ /*
+ * Was it the slot sync worker? Normal exit or FATAL exit can be
+ * ignored (FATAL can be caused by libpqwalreceiver on receiving
+ * shutdown request by the startup process during promotion); we'll
+ * start a new one at the next iteration of the postmaster's main
+ * loop, if necessary. Any other exit condition is treated as a crash.
+ */
+ if (pid == SlotSyncWorkerPID)
+ {
+ SlotSyncWorkerPID = 0;
+ if (!EXIT_STATUS_0(exitstatus) && !EXIT_STATUS_1(exitstatus))
+ HandleChildCrash(pid, exitstatus,
+ _("slot sync worker process"));
+ continue;
+ }
+
/* Was it one of our background workers? */
if (CleanupBackgroundWorker(pid, exitstatus))
{
@@ -3570,6 +3600,12 @@ HandleChildCrash(int pid, int exitstatus, const char *procname)
else if (PgArchPID != 0 && take_action)
sigquit_child(PgArchPID);
+ /* Take care of the slot sync worker too */
+ if (pid == SlotSyncWorkerPID)
+ SlotSyncWorkerPID = 0;
+ else if (SlotSyncWorkerPID != 0 && take_action)
+ sigquit_child(SlotSyncWorkerPID);
+
/* We do NOT restart the syslogger */
if (Shutdown != ImmediateShutdown)
@@ -3710,6 +3746,8 @@ PostmasterStateMachine(void)
signal_child(WalReceiverPID, SIGTERM);
if (WalSummarizerPID != 0)
signal_child(WalSummarizerPID, SIGTERM);
+ if (SlotSyncWorkerPID != 0)
+ signal_child(SlotSyncWorkerPID, SIGTERM);
/* checkpointer, archiver, stats, and syslogger may continue for now */
/* Now transition to PM_WAIT_BACKENDS state to wait for them to die */
@@ -3725,13 +3763,13 @@ PostmasterStateMachine(void)
/*
* PM_WAIT_BACKENDS state ends when we have no regular backends
* (including autovac workers), no bgworkers (including unconnected
- * ones), and no walwriter, autovac launcher or bgwriter. If we are
- * doing crash recovery or an immediate shutdown then we expect the
- * checkpointer to exit as well, otherwise not. The stats and
- * syslogger processes are disregarded since they are not connected to
- * shared memory; we also disregard dead_end children here. Walsenders
- * and archiver are also disregarded, they will be terminated later
- * after writing the checkpoint record.
+ * ones), and no walwriter, autovac launcher, bgwriter or slot sync
+ * worker. If we are doing crash recovery or an immediate shutdown
+ * then we expect the checkpointer to exit as well, otherwise not. The
+ * stats and syslogger processes are disregarded since they are not
+ * connected to shared memory; we also disregard dead_end children
+ * here. Walsenders and archiver are also disregarded, they will be
+ * terminated later after writing the checkpoint record.
*/
if (CountChildren(BACKEND_TYPE_ALL - BACKEND_TYPE_WALSND) == 0 &&
StartupPID == 0 &&
@@ -3741,7 +3779,8 @@ PostmasterStateMachine(void)
(CheckpointerPID == 0 ||
(!FatalError && Shutdown < ImmediateShutdown)) &&
WalWriterPID == 0 &&
- AutoVacPID == 0)
+ AutoVacPID == 0 &&
+ SlotSyncWorkerPID == 0)
{
if (Shutdown >= ImmediateShutdown || FatalError)
{
@@ -3839,6 +3878,7 @@ PostmasterStateMachine(void)
Assert(CheckpointerPID == 0);
Assert(WalWriterPID == 0);
Assert(AutoVacPID == 0);
+ Assert(SlotSyncWorkerPID == 0);
/* syslogger is not considered here */
pmState = PM_NO_CHILDREN;
}
@@ -4062,6 +4102,8 @@ TerminateChildren(int signal)
signal_child(AutoVacPID, signal);
if (PgArchPID != 0)
signal_child(PgArchPID, signal);
+ if (SlotSyncWorkerPID != 0)
+ signal_child(SlotSyncWorkerPID, signal);
}
/*
@@ -4874,6 +4916,7 @@ SubPostmasterMain(int argc, char *argv[])
*/
if (strcmp(argv[1], "--forkbackend") == 0 ||
strcmp(argv[1], "--forkavlauncher") == 0 ||
+ strcmp(argv[1], "--forkssworker") == 0 ||
strcmp(argv[1], "--forkavworker") == 0 ||
strcmp(argv[1], "--forkaux") == 0 ||
strcmp(argv[1], "--forkbgworker") == 0)
@@ -4977,6 +5020,13 @@ SubPostmasterMain(int argc, char *argv[])
AutoVacWorkerMain(argc - 2, argv + 2); /* does not return */
}
+ if (strcmp(argv[1], "--forkssworker") == 0)
+ {
+ /* Restore basic shared memory pointers */
+ InitShmemAccess(UsedShmemSegAddr);
+
+ ReplSlotSyncWorkerMain(argc - 2, argv + 2); /* does not return */
+ }
if (strcmp(argv[1], "--forkbgworker") == 0)
{
/* do this as early as possible; in particular, before InitProcess() */
diff --git a/src/backend/replication/logical/Makefile b/src/backend/replication/logical/Makefile
index 2dc25e37bb..ba03eeff1c 100644
--- a/src/backend/replication/logical/Makefile
+++ b/src/backend/replication/logical/Makefile
@@ -25,6 +25,7 @@ OBJS = \
proto.o \
relation.o \
reorderbuffer.o \
+ slotsync.o \
snapbuild.o \
tablesync.o \
worker.o
diff --git a/src/backend/replication/logical/logical.c b/src/backend/replication/logical/logical.c
index ca09c683f1..5aefb10ecb 100644
--- a/src/backend/replication/logical/logical.c
+++ b/src/backend/replication/logical/logical.c
@@ -524,6 +524,18 @@ CreateDecodingContext(XLogRecPtr start_lsn,
errmsg("replication slot \"%s\" was not created in this database",
NameStr(slot->data.name))));
+ /*
+ * Do not allow consumption of a "synchronized" slot until the standby
+ * gets promoted.
+ */
+ if (RecoveryInProgress() && slot->data.synced)
+ ereport(ERROR,
+ errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+ errmsg("cannot use replication slot \"%s\" for logical"
+ " decoding", NameStr(slot->data.name)),
+ errdetail("This slot is being synced from the primary server."),
+ errhint("Specify another replication slot."));
+
/*
* Check if slot has been invalidated due to max_slot_wal_keep_size. Avoid
* "cannot get changes" wording in this errmsg because that'd be
diff --git a/src/backend/replication/logical/meson.build b/src/backend/replication/logical/meson.build
index 1050eb2c09..3dec36a6de 100644
--- a/src/backend/replication/logical/meson.build
+++ b/src/backend/replication/logical/meson.build
@@ -11,6 +11,7 @@ backend_sources += files(
'proto.c',
'relation.c',
'reorderbuffer.c',
+ 'slotsync.c',
'snapbuild.c',
'tablesync.c',
'worker.c',
diff --git a/src/backend/replication/logical/slotsync.c b/src/backend/replication/logical/slotsync.c
new file mode 100644
index 0000000000..8e1146a332
--- /dev/null
+++ b/src/backend/replication/logical/slotsync.c
@@ -0,0 +1,1467 @@
+/*-------------------------------------------------------------------------
+ * slotsync.c
+ * PostgreSQL worker for synchronizing slots to a standby server from the
+ * primary server.
+ *
+ * Copyright (c) 2024, PostgreSQL Global Development Group
+ *
+ * IDENTIFICATION
+ * src/backend/replication/logical/slotsync.c
+ *
+ * This file contains the code for slot sync worker on a physical standby
+ * to fetch logical failover slots information from the primary server,
+ * create the slots on the standby and synchronize them periodically.
+ *
+ * While creating the slot on physical standby, if the local restart_lsn and/or
+ * local catalog_xmin is ahead of those on the remote then the worker cannot
+ * create the local slot in sync with the primary server because that would
+ * mean moving the local slot backwards and the standby might not have WALs
+ * retained for old LSN. In this case, the worker will mark the slot as
+ * RS_TEMPORARY. Once the primary server catches up, the worker will mark the
+ * slot as RS_PERSISTENT (which means sync-ready) and will perform the sync
+ * periodically.
+ *
+ * The worker also takes care of dropping the slots which were created by it
+ * and are currently not needed to be synchronized.
+ *
+ * It waits for a period of time before the next synchronization, with the
+ * duration varying based on whether any slots were updated during the last
+ * cycle. Refer to the comments above wait_for_slot_activity() for more details.
+ *
+ * Slot synchronization is currently not supported on the cascading standby.
+ *---------------------------------------------------------------------------
+ */
+
+#include "postgres.h"
+
+#include <time.h>
+
+#include "access/genam.h"
+#include "access/table.h"
+#include "access/xlog_internal.h"
+#include "access/xlogrecovery.h"
+#include "catalog/pg_database.h"
+#include "commands/dbcommands.h"
+#include "libpq/pqsignal.h"
+#include "pgstat.h"
+#include "postmaster/bgworker.h"
+#include "postmaster/fork_process.h"
+#include "postmaster/interrupt.h"
+#include "postmaster/postmaster.h"
+#include "replication/logical.h"
+#include "replication/logicallauncher.h"
+#include "replication/logicalworker.h"
+#include "replication/walreceiver.h"
+#include "replication/worker_internal.h"
+#include "storage/ipc.h"
+#include "storage/lmgr.h"
+#include "storage/procarray.h"
+#include "tcop/tcopprot.h"
+#include "utils/builtins.h"
+#include "utils/fmgroids.h"
+#include "utils/guc_hooks.h"
+#include "utils/pg_lsn.h"
+#include "utils/ps_status.h"
+#include "utils/timeout.h"
+#include "utils/varlena.h"
+
+/*
+ * Structure to hold information fetched from the primary server about a logical
+ * replication slot.
+ */
+typedef struct RemoteSlot
+{
+ char *name;
+ char *plugin;
+ char *database;
+ bool two_phase;
+ bool failover;
+ XLogRecPtr restart_lsn;
+ XLogRecPtr confirmed_lsn;
+ TransactionId catalog_xmin;
+
+ /* RS_INVAL_NONE if valid, or the reason of invalidation */
+ ReplicationSlotInvalidationCause invalidated;
+} RemoteSlot;
+
+/*
+ * Struct for sharing information between startup process and slot
+ * sync worker.
+ *
+ * Slot sync worker's pid is needed by the startup process in order to
+ * shut it down during promotion. Startup process shuts down the slot
+ * sync worker and also sets stopSignaled=true to handle the race condition
+ * when postmaster has not noticed the promotion yet and thus may end up
+ * restarting slot sync worker. If stopSignaled is set, the worker will
+ * exit in such a case.
+ *
+ * The last_start_time is needed by postmaster to start the slot sync
+ * worker once per SLOTSYNC_RESTART_INTERVAL_SEC. In cases where a
+ * immediate restart is expected (e.g., slot sync GUCs change), slot
+ * sync worker will reset last_start_time before exiting, so that postmaster
+ * can start the worker without waiting for SLOTSYNC_RESTART_INTERVAL_SEC.
+ */
+typedef struct SlotSyncWorkerCtxStruct
+{
+ pid_t pid;
+ bool stopSignaled;
+ time_t last_start_time;
+ slock_t mutex;
+} SlotSyncWorkerCtxStruct;
+
+SlotSyncWorkerCtxStruct *SlotSyncWorker = NULL;
+
+/* GUC variable */
+bool enable_syncslot = false;
+
+/*
+ * The sleep time (ms) between slot-sync cycles varies dynamically
+ * (within a MIN/MAX range) according to slot activity. See
+ * wait_for_slot_activity() for details.
+ */
+#define MIN_WORKER_NAPTIME_MS 200
+#define MAX_WORKER_NAPTIME_MS 30000 /* 30s */
+static long sleep_ms = MIN_WORKER_NAPTIME_MS;
+
+/* The restart interval for slot sync work used by postmaster */
+#define SLOTSYNC_RESTART_INTERVAL_SEC 10
+
+/* Flag to tell if we are in a slot sync worker process */
+static bool am_slotsync_worker = false;
+
+static void ProcessSlotSyncInterrupts(WalReceiverConn *wrconn, bool restart);
+
+#ifdef EXEC_BACKEND
+static pid_t slotsyncworker_forkexec(void);
+#endif
+NON_EXEC_STATIC void ReplSlotSyncWorkerMain(int argc, char *argv[]) pg_attribute_noreturn();
+
+/*
+ * If necessary, update local slot metadata based on the data from the remote
+ * slot.
+ *
+ * If no update was needed (the data of the remote slot is the same as the
+ * local slot) return false, otherwise true.
+ */
+static bool
+local_slot_update(RemoteSlot *remote_slot, Oid remote_dbid)
+{
+ ReplicationSlot *slot = MyReplicationSlot;
+ NameData plugin_name;
+
+ Assert(slot->data.invalidated == RS_INVAL_NONE);
+
+ if (strcmp(remote_slot->plugin, NameStr(slot->data.plugin)) == 0 &&
+ remote_dbid == slot->data.database &&
+ remote_slot->restart_lsn == slot->data.restart_lsn &&
+ remote_slot->catalog_xmin == slot->data.catalog_xmin &&
+ remote_slot->two_phase == slot->data.two_phase &&
+ remote_slot->failover == slot->data.failover &&
+ remote_slot->confirmed_lsn == slot->data.confirmed_flush)
+ return false;
+
+ /* Avoid expensive operations while holding a spinlock. */
+ namestrcpy(&plugin_name, remote_slot->plugin);
+
+ SpinLockAcquire(&slot->mutex);
+ slot->data.plugin = plugin_name;
+ slot->data.database = remote_dbid;
+ slot->data.two_phase = remote_slot->two_phase;
+ slot->data.failover = remote_slot->failover;
+ slot->data.restart_lsn = remote_slot->restart_lsn;
+ slot->data.confirmed_flush = remote_slot->confirmed_lsn;
+ slot->data.catalog_xmin = remote_slot->catalog_xmin;
+ slot->effective_catalog_xmin = remote_slot->catalog_xmin;
+ SpinLockRelease(&slot->mutex);
+
+ if (remote_slot->catalog_xmin != slot->data.catalog_xmin)
+ ReplicationSlotsComputeRequiredXmin(false);
+
+ if (remote_slot->restart_lsn != slot->data.restart_lsn)
+ ReplicationSlotsComputeRequiredLSN();
+
+ return true;
+}
+
+/*
+ * Get list of local logical slots which are synchronized from
+ * the primary server.
+ */
+static List *
+get_local_synced_slots(void)
+{
+ List *local_slots = NIL;
+
+ LWLockAcquire(ReplicationSlotControlLock, LW_SHARED);
+
+ for (int i = 0; i < max_replication_slots; i++)
+ {
+ ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i];
+
+ /* Check if it is a synchronized slot */
+ if (s->in_use && s->data.synced)
+ {
+ Assert(SlotIsLogical(s));
+ local_slots = lappend(local_slots, s);
+ }
+ }
+
+ LWLockRelease(ReplicationSlotControlLock);
+
+ return local_slots;
+}
+
+/*
+ * Helper function to check if local_slot is present in remote_slots list.
+ *
+ * It also checks if the slot on the standby server was invalidated while the
+ * corresponding remote slot in the list remained valid. If found so, it sets
+ * the locally_invalidated flag to true.
+ */
+static bool
+check_sync_slot_on_remote(ReplicationSlot *local_slot, List *remote_slots,
+ bool *locally_invalidated)
+{
+ foreach_ptr(RemoteSlot, remote_slot, remote_slots)
+ {
+ if (strcmp(remote_slot->name, NameStr(local_slot->data.name)) == 0)
+ {
+ /*
+ * If remote slot is not invalidated but local slot is marked as
+ * invalidated, then set the bool.
+ */
+ SpinLockAcquire(&local_slot->mutex);
+ *locally_invalidated =
+ (remote_slot->invalidated == RS_INVAL_NONE) &&
+ (local_slot->data.invalidated != RS_INVAL_NONE);
+ SpinLockRelease(&local_slot->mutex);
+
+ return true;
+ }
+ }
+
+ return false;
+}
+
+/*
+ * Drop obsolete slots
+ *
+ * Drop the slots that no longer need to be synced i.e. these either do not
+ * exist on the primary or are no longer enabled for failover.
+ *
+ * Additionally, it drops slots that are valid on the primary but got
+ * invalidated on the standby. This situation may occur due to the following
+ * reasons:
+ * - The max_slot_wal_keep_size on the standby is insufficient to retain WAL
+ * records from the restart_lsn of the slot.
+ * - primary_slot_name is temporarily reset to null and the physical slot is
+ * removed.
+ * - The primary changes wal_level to a level lower than logical.
+ *
+ * The assumption is that these dropped slots will get recreated in next
+ * sync-cycle and it is okay to drop and recreate such slots as long as these
+ * are not consumable on the standby (which is the case currently).
+ */
+static void
+drop_obsolete_slots(List *remote_slot_list)
+{
+ List *local_slots = get_local_synced_slots();
+
+ foreach_ptr(ReplicationSlot, local_slot, local_slots)
+ {
+ bool remote_exists = false;
+ bool locally_invalidated = false;
+
+ remote_exists = check_sync_slot_on_remote(local_slot, remote_slot_list,
+ &locally_invalidated);
+
+ /*
+ * Drop the local slot either if it is not in the remote slots list or
+ * is invalidated while remote slot is still valid.
+ */
+ if (!remote_exists || locally_invalidated)
+ {
+ bool synced_slot;
+
+ /*
+ * Use shared lock to prevent a conflict with
+ * ReplicationSlotsDropDBSlots(), trying to drop the same slot
+ * during a drop-database operation.
+ */
+ LockSharedObject(DatabaseRelationId, local_slot->data.database,
+ 0, AccessShareLock);
+
+ /*
+ * There is a possibility of parallel database drop and
+ * re-creation of new slot by user in the small window between
+ * getting the slot to drop and locking the db. This new
+ * user-created slot may end up using the same shared memory as
+ * that of 'local_slot'. Thus check if local_slot is still the
+ * synced one before performing actual drop.
+ */
+ SpinLockAcquire(&local_slot->mutex);
+ synced_slot = local_slot->in_use && local_slot->data.synced;
+ SpinLockRelease(&local_slot->mutex);
+ if (synced_slot)
+ {
+ ReplicationSlotAcquire(NameStr(local_slot->data.name), true);
+ ReplicationSlotDropAcquired();
+ }
+
+ UnlockSharedObject(DatabaseRelationId, local_slot->data.database,
+ 0, AccessShareLock);
+
+ ereport(LOG,
+ errmsg("dropped replication slot \"%s\" of dbid %d",
+ NameStr(local_slot->data.name),
+ local_slot->data.database));
+ }
+ }
+}
+
+/*
+ * Reserve WAL for the currently active slot using the specified WAL location
+ * (restart_lsn).
+ *
+ * If the given WAL location has been removed, reserve WAL using the oldest
+ * existing WAL segment.
+ */
+static void
+reserve_wal_for_slot(XLogRecPtr restart_lsn)
+{
+ XLogSegNo oldest_segno;
+ XLogSegNo segno;
+ ReplicationSlot *slot = MyReplicationSlot;
+
+ Assert(slot != NULL);
+ Assert(XLogRecPtrIsInvalid(slot->data.restart_lsn));
+
+ while (true)
+ {
+ SpinLockAcquire(&slot->mutex);
+ slot->data.restart_lsn = restart_lsn;
+ SpinLockRelease(&slot->mutex);
+
+ /* Prevent WAL removal as fast as possible */
+ ReplicationSlotsComputeRequiredLSN();
+
+ XLByteToSeg(slot->data.restart_lsn, segno, wal_segment_size);
+
+ /*
+ * Find the oldest existing WAL segment file.
+ *
+ * Normally, we can determine it by using the last removed segment
+ * number. However, if no WAL segment files have been removed by a
+ * checkpoint since startup, we need to search for the oldest segment
+ * file currently existing in XLOGDIR.
+ */
+ oldest_segno = XLogGetLastRemovedSegno() + 1;
+
+ if (oldest_segno == 1)
+ oldest_segno = XLogGetOldestSegno(0);
+
+ /*
+ * If all required WAL is still there, great, otherwise retry. The
+ * slot should prevent further removal of WAL, unless there's a
+ * concurrent ReplicationSlotsComputeRequiredLSN() after we've written
+ * the new restart_lsn above, so normally we should never need to loop
+ * more than twice.
+ */
+ if (segno >= oldest_segno)
+ break;
+
+ /* Retry using the location of the oldest wal segment */
+ XLogSegNoOffsetToRecPtr(oldest_segno, 0, wal_segment_size, restart_lsn);
+ }
+}
+
+/*
+ * Update the LSNs and persist the slot for further syncs if the remote
+ * restart_lsn and catalog_xmin have caught up with the local ones, otherwise
+ * do nothing.
+ *
+ * Return true if the slot is marked as RS_PERSISTENT (sync-ready), otherwise
+ * false.
+ */
+static bool
+update_and_persist_slot(RemoteSlot *remote_slot, Oid remote_dbid)
+{
+ ReplicationSlot *slot = MyReplicationSlot;
+
+ /*
+ * Check if the primary server has caught up. Refer to the comment atop
+ * the file for details on this check.
+ *
+ * We also need to check if remote_slot's confirmed_lsn becomes valid. It
+ * is possible to get null values for confirmed_lsn and catalog_xmin if on
+ * the primary server the slot is just created with a valid restart_lsn
+ * and slot-sync worker has fetched the slot before the primary server
+ * could set valid confirmed_lsn and catalog_xmin.
+ */
+ if (remote_slot->restart_lsn < slot->data.restart_lsn ||
+ XLogRecPtrIsInvalid(remote_slot->confirmed_lsn) ||
+ TransactionIdPrecedes(remote_slot->catalog_xmin,
+ slot->data.catalog_xmin))
+ {
+ /*
+ * The remote slot didn't catch up to locally reserved position.
+ *
+ * We do not drop the slot because the restart_lsn can be ahead of the
+ * current location when recreating the slot in the next cycle. It may
+ * take more time to create such a slot. Therefore, we keep this slot
+ * and attempt the wait and synchronization in the next cycle.
+ */
+ return false;
+ }
+
+ /* First time slot update, the function must return true */
+ if (!local_slot_update(remote_slot, remote_dbid))
+ elog(ERROR, "failed to update slot");
+
+ ReplicationSlotPersist();
+
+ ereport(LOG,
+ errmsg("newly created slot \"%s\" is sync-ready now",
+ remote_slot->name));
+
+ return true;
+}
+
+/*
+ * Synchronize single slot to given position.
+ *
+ * This creates a new slot if there is no existing one and updates the
+ * metadata of the slot as per the data received from the primary server.
+ *
+ * The slot is created as a temporary slot and stays in the same state until the
+ * the remote_slot catches up with locally reserved position and local slot is
+ * updated. The slot is then persisted and is considered as sync-ready for
+ * periodic syncs.
+ *
+ * Returns TRUE if the local slot is updated.
+ */
+static bool
+synchronize_one_slot(RemoteSlot *remote_slot, Oid remote_dbid)
+{
+ ReplicationSlot *slot;
+ bool slot_updated = false;
+ XLogRecPtr latestFlushPtr;
+
+ /*
+ * Make sure that concerned WAL is received and flushed before syncing
+ * slot to target lsn received from the primary server.
+ *
+ * This check will never pass if on the primary server, user has
+ * configured standby_slot_names GUC correctly, otherwise this can hit
+ * frequently.
+ */
+ latestFlushPtr = GetStandbyFlushRecPtr(NULL);
+ if (remote_slot->confirmed_lsn > latestFlushPtr)
+ {
+ ereport(LOG,
+ errmsg("skipping slot synchronization as the received slot sync"
+ " LSN %X/%X for slot \"%s\" is ahead of the standby position %X/%X",
+ LSN_FORMAT_ARGS(remote_slot->confirmed_lsn),
+ remote_slot->name,
+ LSN_FORMAT_ARGS(latestFlushPtr)));
+
+ return false;
+ }
+
+ /* Search for the named slot */
+ if ((slot = SearchNamedReplicationSlot(remote_slot->name, true)))
+ {
+ bool synced;
+
+ SpinLockAcquire(&slot->mutex);
+ synced = slot->data.synced;
+ SpinLockRelease(&slot->mutex);
+
+ /* User-created slot with the same name exists, raise ERROR. */
+ if (!synced)
+ ereport(ERROR,
+ errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+ errmsg("exiting from slot synchronization because same"
+ " name slot \"%s\" already exists on the standby",
+ remote_slot->name));
+
+ /*
+ * Slot created by the slot sync worker exists, sync it.
+ *
+ * It is important to acquire the slot here before checking
+ * invalidation. If we don't acquire the slot first, there could be a
+ * race condition that the local slot could be invalidated just after
+ * checking the 'invalidated' flag here and we could end up
+ * overwriting 'invalidated' flag to remote_slot's value. See
+ * InvalidatePossiblyObsoleteSlot() where it invalidates slot directly
+ * if the slot is not acquired by other processes.
+ */
+ ReplicationSlotAcquire(remote_slot->name, true);
+
+ Assert(slot == MyReplicationSlot);
+
+ /*
+ * Copy the invalidation cause from remote only if local slot is not
+ * invalidated locally, we don't want to overwrite existing one.
+ */
+ if (slot->data.invalidated == RS_INVAL_NONE)
+ {
+ SpinLockAcquire(&slot->mutex);
+ slot->data.invalidated = remote_slot->invalidated;
+ SpinLockRelease(&slot->mutex);
+
+ /* Make sure the invalidated state persists across server restart */
+ ReplicationSlotMarkDirty();
+ ReplicationSlotSave();
+ slot_updated = true;
+ }
+
+ /* Skip the sync of an invalidated slot */
+ if (slot->data.invalidated != RS_INVAL_NONE)
+ {
+ ReplicationSlotRelease();
+ return slot_updated;
+ }
+
+ /* Slot not ready yet, let's attempt to make it sync-ready now. */
+ if (slot->data.persistency == RS_TEMPORARY)
+ {
+ slot_updated = update_and_persist_slot(remote_slot, remote_dbid);
+ }
+
+ /* Slot ready for sync, so sync it. */
+ else
+ {
+ /*
+ * Sanity check: As long as the invalidations are handled
+ * appropriately as above, this should never happen.
+ */
+ if (remote_slot->restart_lsn < slot->data.restart_lsn)
+ elog(ERROR,
+ "cannot synchronize local slot \"%s\" LSN(%X/%X)"
+ " to remote slot's LSN(%X/%X) as synchronization"
+ " would move it backwards", remote_slot->name,
+ LSN_FORMAT_ARGS(slot->data.restart_lsn),
+ LSN_FORMAT_ARGS(remote_slot->restart_lsn));
+
+ /* Make sure the slot changes persist across server restart */
+ if (local_slot_update(remote_slot, remote_dbid))
+ {
+ slot_updated = true;
+ ReplicationSlotMarkDirty();
+ ReplicationSlotSave();
+ }
+ }
+ }
+ /* Otherwise create the slot first. */
+ else
+ {
+ NameData plugin_name;
+ TransactionId xmin_horizon = InvalidTransactionId;
+
+ /* Skip creating the local slot if remote_slot is invalidated already */
+ if (remote_slot->invalidated != RS_INVAL_NONE)
+ return false;
+
+ ReplicationSlotCreate(remote_slot->name, true, RS_TEMPORARY,
+ remote_slot->two_phase,
+ remote_slot->failover,
+ true);
+
+ /* For shorter lines. */
+ slot = MyReplicationSlot;
+
+ /* Avoid expensive operations while holding a spinlock. */
+ namestrcpy(&plugin_name, remote_slot->plugin);
+
+ SpinLockAcquire(&slot->mutex);
+ slot->data.database = remote_dbid;
+ slot->data.plugin = plugin_name;
+ SpinLockRelease(&slot->mutex);
+
+ reserve_wal_for_slot(remote_slot->restart_lsn);
+
+ LWLockAcquire(ProcArrayLock, LW_EXCLUSIVE);
+ xmin_horizon = GetOldestSafeDecodingTransactionId(true);
+ SpinLockAcquire(&slot->mutex);
+ slot->effective_catalog_xmin = xmin_horizon;
+ slot->data.catalog_xmin = xmin_horizon;
+ SpinLockRelease(&slot->mutex);
+ ReplicationSlotsComputeRequiredXmin(true);
+ LWLockRelease(ProcArrayLock);
+
+ (void) update_and_persist_slot(remote_slot, remote_dbid);
+ slot_updated = true;
+ }
+
+ ReplicationSlotRelease();
+
+ return slot_updated;
+}
+
+/*
+ * Maps the pg_replication_slots.conflict_reason text value to
+ * ReplicationSlotInvalidationCause enum value
+ */
+static ReplicationSlotInvalidationCause
+get_slot_invalidation_cause(char *conflict_reason)
+{
+ Assert(conflict_reason);
+
+ if (strcmp(conflict_reason, SLOT_INVAL_WAL_REMOVED_TEXT) == 0)
+ return RS_INVAL_WAL_REMOVED;
+ else if (strcmp(conflict_reason, SLOT_INVAL_HORIZON_TEXT) == 0)
+ return RS_INVAL_HORIZON;
+ else if (strcmp(conflict_reason, SLOT_INVAL_WAL_LEVEL_TEXT) == 0)
+ return RS_INVAL_WAL_LEVEL;
+ else
+ Assert(0);
+
+ /* Keep compiler quiet */
+ return RS_INVAL_NONE;
+}
+
+/*
+ * Synchronize slots.
+ *
+ * Gets the failover logical slots info from the primary server and updates
+ * the slots locally. Creates the slots if not present on the standby.
+ *
+ * Returns TRUE if any of the slots gets updated in this sync-cycle.
+ */
+static bool
+synchronize_slots(WalReceiverConn *wrconn)
+{
+#define SLOTSYNC_COLUMN_COUNT 9
+ Oid slotRow[SLOTSYNC_COLUMN_COUNT] = {TEXTOID, TEXTOID, LSNOID,
+ LSNOID, XIDOID, BOOLOID, BOOLOID, TEXTOID, TEXTOID};
+
+ WalRcvExecResult *res;
+ TupleTableSlot *tupslot;
+ StringInfoData s;
+ List *remote_slot_list = NIL;
+ bool some_slot_updated = false;
+ XLogRecPtr latestWalEnd;
+
+ /*
+ * The primary_slot_name is not set yet or WALs not received yet.
+ * Synchronization is not possible if the walreceiver is not started.
+ */
+ latestWalEnd = GetWalRcvLatestWalEnd();
+ SpinLockAcquire(&WalRcv->mutex);
+ if ((WalRcv->slotname[0] == '\0') ||
+ XLogRecPtrIsInvalid(latestWalEnd))
+ {
+ SpinLockRelease(&WalRcv->mutex);
+ return false;
+ }
+ SpinLockRelease(&WalRcv->mutex);
+
+ /* The syscache access in walrcv_exec() needs a transaction env. */
+ StartTransactionCommand();
+
+ initStringInfo(&s);
+
+ /* Construct query to fetch slots with failover enabled. */
+ appendStringInfo(&s,
+ "SELECT slot_name, plugin, confirmed_flush_lsn,"
+ " restart_lsn, catalog_xmin, two_phase, failover,"
+ " database, conflict_reason"
+ " FROM pg_catalog.pg_replication_slots"
+ " WHERE failover and NOT temporary");
+
+ /* Execute the query */
+ res = walrcv_exec(wrconn, s.data, SLOTSYNC_COLUMN_COUNT, slotRow);
+ pfree(s.data);
+
+ if (res->status != WALRCV_OK_TUPLES)
+ ereport(ERROR,
+ errmsg("could not fetch failover logical slots info from the primary server: %s",
+ res->err));
+
+ /* Construct the remote_slot tuple and synchronize each slot locally */
+ tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
+ while (tuplestore_gettupleslot(res->tuplestore, true, false, tupslot))
+ {
+ bool isnull;
+ RemoteSlot *remote_slot = palloc0(sizeof(RemoteSlot));
+ Datum d;
+ int col = 0;
+
+ remote_slot->name = TextDatumGetCString(slot_getattr(tupslot, ++col,
+ &isnull));
+ Assert(!isnull);
+
+ remote_slot->plugin = TextDatumGetCString(slot_getattr(tupslot, ++col,
+ &isnull));
+ Assert(!isnull);
+
+ /*
+ * It is possible to get null values for LSN and Xmin if slot is
+ * invalidated on the primary server, so handle accordingly.
+ */
+ d = slot_getattr(tupslot, ++col, &isnull);
+ remote_slot->confirmed_lsn = isnull ? InvalidXLogRecPtr :
+ DatumGetLSN(d);
+
+ d = slot_getattr(tupslot, ++col, &isnull);
+ remote_slot->restart_lsn = isnull ? InvalidXLogRecPtr : DatumGetLSN(d);
+
+ d = slot_getattr(tupslot, ++col, &isnull);
+ remote_slot->catalog_xmin = isnull ? InvalidTransactionId :
+ DatumGetTransactionId(d);
+
+ remote_slot->two_phase = DatumGetBool(slot_getattr(tupslot, ++col,
+ &isnull));
+ Assert(!isnull);
+
+ remote_slot->failover = DatumGetBool(slot_getattr(tupslot, ++col,
+ &isnull));
+ Assert(!isnull);
+
+ remote_slot->database = TextDatumGetCString(slot_getattr(tupslot,
+ ++col, &isnull));
+ Assert(!isnull);
+
+ d = slot_getattr(tupslot, ++col, &isnull);
+ remote_slot->invalidated = isnull ? RS_INVAL_NONE :
+ get_slot_invalidation_cause(TextDatumGetCString(d));
+
+ /* Sanity check */
+ Assert(col == SLOTSYNC_COLUMN_COUNT);
+
+ /* Create list of remote slots */
+ remote_slot_list = lappend(remote_slot_list, remote_slot);
+
+ ExecClearTuple(tupslot);
+ }
+
+ /* Drop local slots that no longer need to be synced. */
+ drop_obsolete_slots(remote_slot_list);
+
+ /* Now sync the slots locally */
+ foreach_ptr(RemoteSlot, remote_slot, remote_slot_list)
+ {
+ Oid remote_dbid = get_database_oid(remote_slot->database, false);
+
+ /*
+ * Use shared lock to prevent a conflict with
+ * ReplicationSlotsDropDBSlots(), trying to drop the same slot during
+ * a drop-database operation.
+ */
+ LockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock);
+
+ some_slot_updated |= synchronize_one_slot(remote_slot, remote_dbid);
+
+ UnlockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock);
+ }
+
+ /* We are done, free remote_slot_list elements */
+ list_free_deep(remote_slot_list);
+
+ walrcv_clear_result(res);
+
+ CommitTransactionCommand();
+
+ return some_slot_updated;
+}
+
+/*
+ * Checks the primary server info.
+ *
+ * Using the specified primary server connection, check whether we are a
+ * cascading standby. It also validates primary_slot_name for non-cascading
+ * standbys.
+ */
+static void
+check_primary_info(WalReceiverConn *wrconn, bool *am_cascading_standby,
+ bool *primary_slot_invalid)
+{
+#define PRIMARY_INFO_OUTPUT_COL_COUNT 2
+ WalRcvExecResult *res;
+ Oid slotRow[PRIMARY_INFO_OUTPUT_COL_COUNT] = {BOOLOID, BOOLOID};
+ StringInfoData cmd;
+ bool isnull;
+ TupleTableSlot *tupslot;
+ bool valid;
+ bool remote_in_recovery;
+
+ /* The syscache access in walrcv_exec() needs a transaction env. */
+ StartTransactionCommand();
+
+ Assert(am_cascading_standby != NULL);
+ Assert(primary_slot_invalid != NULL);
+
+ *am_cascading_standby = false; /* overwritten later if cascading */
+ *primary_slot_invalid = false; /* overwritten later if invalid */
+
+ initStringInfo(&cmd);
+ appendStringInfo(&cmd,
+ "SELECT pg_is_in_recovery(), count(*) = 1"
+ " FROM pg_catalog.pg_replication_slots"
+ " WHERE slot_type='physical' AND slot_name=%s",
+ quote_literal_cstr(PrimarySlotName));
+
+ res = walrcv_exec(wrconn, cmd.data, PRIMARY_INFO_OUTPUT_COL_COUNT, slotRow);
+ pfree(cmd.data);
+
+ if (res->status != WALRCV_OK_TUPLES)
+ ereport(ERROR,
+ errmsg("could not fetch primary_slot_name \"%s\" info from the primary server: %s",
+ PrimarySlotName, res->err),
+ errhint("Check if \"primary_slot_name\" is configured correctly."));
+
+ tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
+ if (!tuplestore_gettupleslot(res->tuplestore, true, false, tupslot))
+ elog(ERROR,
+ "failed to fetch tuple for the primary server slot specified by \"primary_slot_name\"");
+
+ remote_in_recovery = DatumGetBool(slot_getattr(tupslot, 1, &isnull));
+ Assert(!isnull);
+
+ if (remote_in_recovery)
+ {
+ /* No need to check further, just set am_cascading_standby to true */
+ *am_cascading_standby = true;
+ }
+ else
+ {
+ /*
+ * We are not cascading standby, thus good to proceed with
+ * primary_slot_name validity check now.
+ */
+ valid = DatumGetBool(slot_getattr(tupslot, 2, &isnull));
+ Assert(!isnull);
+
+ if (!valid)
+ {
+ *primary_slot_invalid = true;
+ ereport(LOG,
+ errcode(ERRCODE_INVALID_PARAMETER_VALUE),
+ errmsg("bad configuration for slot synchronization"),
+ /* translator: second %s is a GUC variable name */
+ errdetail("The primary server slot \"%s\" specified by \"%s\" is not valid.",
+ PrimarySlotName, "primary_slot_name"));
+ }
+ }
+
+ ExecClearTuple(tupslot);
+ walrcv_clear_result(res);
+ CommitTransactionCommand();
+}
+
+/*
+ * Returns true if all necessary GUCs for slot synchronization are set
+ * appropriately, otherwise returns false.
+ *
+ * If all checks pass, extracts the dbname from the primary_conninfo GUC and
+ * and return it in output dbname arg.
+ */
+static bool
+validate_parameters_and_get_dbname(char **dbname)
+{
+ /*
+ * A physical replication slot(primary_slot_name) is required on the
+ * primary to ensure that the rows needed by the standby are not removed
+ * after restarting, so that the synchronized slot on the standby will not
+ * be invalidated.
+ */
+ if (PrimarySlotName == NULL || *PrimarySlotName == '\0')
+ {
+ ereport(LOG,
+ /* translator: %s is a GUC variable name */
+ errcode(ERRCODE_INVALID_PARAMETER_VALUE),
+ errmsg("bad configuration for slot synchronization"),
+ errhint("\"%s\" must be defined.", "primary_slot_name"));
+ return false;
+ }
+
+ /*
+ * hot_standby_feedback must be enabled to cooperate with the physical
+ * replication slot, which allows informing the primary about the xmin and
+ * catalog_xmin values on the standby.
+ */
+ if (!hot_standby_feedback)
+ {
+ ereport(LOG,
+ /* translator: %s is a GUC variable name */
+ errcode(ERRCODE_INVALID_PARAMETER_VALUE),
+ errmsg("bad configuration for slot synchronization"),
+ errhint("\"%s\" must be enabled.", "hot_standby_feedback"));
+ return false;
+ }
+
+ /*
+ * Logical decoding requires wal_level >= logical and we currently only
+ * synchronize logical slots.
+ */
+ if (wal_level < WAL_LEVEL_LOGICAL)
+ {
+ ereport(LOG,
+ errcode(ERRCODE_INVALID_PARAMETER_VALUE),
+ errmsg("bad configuration for slot synchronization"),
+ errhint("\"wal_level\" must be >= logical."));
+ return false;
+ }
+
+ /*
+ * The primary_conninfo is required to make connection to primary for
+ * getting slots information.
+ */
+ if (PrimaryConnInfo == NULL || *PrimaryConnInfo == '\0')
+ {
+ ereport(LOG,
+ /* translator: %s is a GUC variable name */
+ errcode(ERRCODE_INVALID_PARAMETER_VALUE),
+ errmsg("bad configuration for slot synchronization"),
+ errhint("\"%s\" must be defined.", "primary_conninfo"));
+ return false;
+ }
+
+ /*
+ * The slot sync worker needs a database connection for walrcv_exec to
+ * work.
+ */
+ *dbname = walrcv_get_dbname_from_conninfo(PrimaryConnInfo);
+ if (*dbname == NULL)
+ {
+ ereport(LOG,
+
+ /*
+ * translator: 'dbname' is a specific option; %s is a GUC variable
+ * name
+ */
+ errcode(ERRCODE_INVALID_PARAMETER_VALUE),
+ errmsg("bad configuration for slot synchronization"),
+ errhint("'dbname' must be specified in \"%s\".", "primary_conninfo"));
+ return false;
+ }
+
+ return true;
+}
+
+/*
+ * Check that all necessary GUCs for slot synchronization are set
+ * appropriately. If not, sleep for MAX_WORKER_NAPTIME_MS and check again.
+ * The idea is to become no-op until we get valid GUCs values.
+ *
+ * If all checks pass, extracts the dbname from the primary_conninfo GUC and
+ * returns it.
+ */
+static char *
+wait_for_valid_params_and_get_dbname(void)
+{
+ char *dbname;
+ int rc;
+
+ /* Sanity check. */
+ Assert(enable_syncslot);
+
+ for (;;)
+ {
+ if (validate_parameters_and_get_dbname(&dbname))
+ break;
+
+ ereport(LOG, errmsg("skipping slot synchronization"));
+
+ ProcessSlotSyncInterrupts(NULL, false);
+
+ rc = WaitLatch(MyLatch,
+ WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
+ MAX_WORKER_NAPTIME_MS,
+ WAIT_EVENT_REPL_SLOTSYNC_MAIN);
+
+ if (rc & WL_LATCH_SET)
+ ResetLatch(MyLatch);
+ }
+
+ return dbname;
+}
+
+/*
+ * Re-read the config file.
+ *
+ * If any of the slot sync GUCs have changed, exit the worker and
+ * let it get restarted by the postmaster. The worker to be exited for
+ * restart purpose only if the caller passed restart as true.
+ */
+static void
+slotsync_reread_config(bool restart)
+{
+ char *old_primary_conninfo = pstrdup(PrimaryConnInfo);
+ char *old_primary_slotname = pstrdup(PrimarySlotName);
+ bool old_enable_syncslot = enable_syncslot;
+ bool old_hot_standby_feedback = hot_standby_feedback;
+ bool conninfo_changed;
+ bool primary_slotname_changed;
+
+ Assert(enable_syncslot);
+
+ ConfigReloadPending = false;
+ ProcessConfigFile(PGC_SIGHUP);
+
+ conninfo_changed = strcmp(old_primary_conninfo, PrimaryConnInfo) != 0;
+ primary_slotname_changed = strcmp(old_primary_slotname, PrimarySlotName) != 0;
+ pfree(old_primary_conninfo);
+ pfree(old_primary_slotname);
+
+ if (old_enable_syncslot != enable_syncslot)
+ {
+ ereport(LOG,
+ /* translator: %s is a GUC variable name */
+ errmsg("slot sync worker will shutdown because %s is disabled", "enable_syncslot"));
+ proc_exit(0);
+ }
+
+ /* The caller instructed to skip restart */
+ if (!restart)
+ return;
+
+ if (conninfo_changed ||
+ primary_slotname_changed ||
+ (old_hot_standby_feedback != hot_standby_feedback))
+ {
+ ereport(LOG,
+ errmsg("slot sync worker will restart because of a parameter change"));
+
+ /*
+ * Reset the last-start time for this worker so that the postmaster
+ * can restart it without waiting for SLOTSYNC_RESTART_INTERVAL_SEC.
+ */
+ SlotSyncWorker->last_start_time = 0;
+
+ proc_exit(0);
+ }
+
+}
+
+/*
+ * Interrupt handler for main loop of slot sync worker.
+ */
+static void
+ProcessSlotSyncInterrupts(WalReceiverConn *wrconn, bool restart)
+{
+ CHECK_FOR_INTERRUPTS();
+
+ if (ShutdownRequestPending)
+ {
+ if (wrconn)
+ walrcv_disconnect(wrconn);
+ ereport(LOG,
+ errmsg("replication slot sync worker is shutting down on receiving SIGINT"));
+ proc_exit(0);
+ }
+
+ if (ConfigReloadPending)
+ slotsync_reread_config(restart);
+}
+
+/*
+ * Cleanup function for slotsync worker.
+ *
+ * Called on slotsync worker exit.
+ */
+static void
+slotsync_worker_onexit(int code, Datum arg)
+{
+ SpinLockAcquire(&SlotSyncWorker->mutex);
+ SlotSyncWorker->pid = InvalidPid;
+ SpinLockRelease(&SlotSyncWorker->mutex);
+}
+
+/*
+ * Sleep for long enough that we believe it's likely that the slots on primary
+ * get updated.
+ *
+ * If there is no slot activity the wait time between sync-cycles will double
+ * (to a maximum of 30s). If there is some slot activity the wait time between
+ * sync-cycles is reset to the minimum (200ms).
+ */
+static void
+wait_for_slot_activity(bool some_slot_updated, bool recheck_primary_info)
+{
+ int rc;
+
+ if (recheck_primary_info)
+ {
+ /*
+ * If we are on the cascading standby or primary_slot_name configured
+ * is not valid, then we will skip the sync and take a longer nap
+ * before we can do check_primary_info() again.
+ */
+ sleep_ms = MAX_WORKER_NAPTIME_MS;
+ }
+ else if (!some_slot_updated)
+ {
+ /*
+ * No slots were updated, so double the sleep time, but not beyond the
+ * maximum allowable value.
+ */
+ sleep_ms = Min(sleep_ms * 2, MAX_WORKER_NAPTIME_MS);
+ }
+ else
+ {
+ /*
+ * Some slots were updated since the last sleep, so reset the sleep
+ * time.
+ */
+ sleep_ms = MIN_WORKER_NAPTIME_MS;
+ }
+
+ rc = WaitLatch(MyLatch,
+ WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
+ sleep_ms,
+ WAIT_EVENT_REPL_SLOTSYNC_MAIN);
+
+ if (rc & WL_LATCH_SET)
+ ResetLatch(MyLatch);
+}
+
+/*
+ * The main loop of our worker process.
+ *
+ * It connects to the primary server, fetches logical failover slots
+ * information periodically in order to create and sync the slots.
+ */
+NON_EXEC_STATIC void
+ReplSlotSyncWorkerMain(int argc, char *argv[])
+{
+ WalReceiverConn *wrconn = NULL;
+ char *dbname;
+ bool am_cascading_standby;
+ bool primary_slot_invalid;
+ char *err;
+ sigjmp_buf local_sigjmp_buf;
+ StringInfoData app_name;
+
+ am_slotsync_worker = true;
+
+ MyBackendType = B_SLOTSYNC_WORKER;
+
+ init_ps_display(NULL);
+
+ SetProcessingMode(InitProcessing);
+
+ /*
+ * Create a per-backend PGPROC struct in shared memory. We must do this
+ * before we access any shared memory.
+ */
+ InitProcess();
+
+ /*
+ * Early initialization.
+ */
+ BaseInit();
+
+ Assert(SlotSyncWorker != NULL);
+
+ SpinLockAcquire(&SlotSyncWorker->mutex);
+ Assert(SlotSyncWorker->pid == InvalidPid);
+
+ /*
+ * Startup process signaled the slot sync worker to stop, so if meanwhile
+ * postmaster ended up starting the worker again, exit.
+ */
+ if (SlotSyncWorker->stopSignaled)
+ {
+ SpinLockRelease(&SlotSyncWorker->mutex);
+ proc_exit(0);
+ }
+
+ /* Advertise our PID so that the startup process can kill us on promotion */
+ SlotSyncWorker->pid = MyProcPid;
+ SpinLockRelease(&SlotSyncWorker->mutex);
+
+ ereport(LOG, errmsg("replication slot sync worker started"));
+
+ on_shmem_exit(slotsync_worker_onexit, (Datum) 0);
+
+ /* Setup signal handling */
+ pqsignal(SIGHUP, SignalHandlerForConfigReload);
+ pqsignal(SIGINT, SignalHandlerForShutdownRequest);
+ pqsignal(SIGTERM, die);
+ pqsignal(SIGFPE, FloatExceptionHandler);
+ pqsignal(SIGUSR1, procsignal_sigusr1_handler);
+ pqsignal(SIGUSR2, SIG_IGN);
+ pqsignal(SIGPIPE, SIG_IGN);
+ pqsignal(SIGCHLD, SIG_DFL);
+
+ /*
+ * Establishes SIGALRM handler and initialize timeout module. It is needed
+ * by InitPostgres to register different timeouts.
+ */
+ InitializeTimeouts();
+
+ /* Load the libpq-specific functions */
+ load_file("libpqwalreceiver", false);
+
+ /*
+ * If an exception is encountered, processing resumes here.
+ *
+ * We just need to clean up, report the error, and go away.
+ *
+ * If we do not have this handling here, then since this worker process
+ * operates at the bottom of the exception stack, ERRORs turn into FATALs.
+ * Therefore, we create our own exception handler to catch ERRORs.
+ */
+ if (sigsetjmp(local_sigjmp_buf, 1) != 0)
+ {
+ /* since not using PG_TRY, must reset error stack by hand */
+ error_context_stack = NULL;
+
+ /* Prevents interrupts while cleaning up */
+ HOLD_INTERRUPTS();
+
+ /* Report the error to the server log */
+ EmitErrorReport();
+
+ /*
+ * We can now go away. Note that because we called InitProcess, a
+ * callback was registered to do ProcKill, which will clean up
+ * necessary state.
+ */
+ proc_exit(0);
+ }
+
+ /* We can now handle ereport(ERROR) */
+ PG_exception_stack = &local_sigjmp_buf;
+
+ /*
+ * Unblock signals (they were blocked when the postmaster forked us)
+ */
+ sigprocmask(SIG_SETMASK, &UnBlockSig, NULL);
+
+ dbname = wait_for_valid_params_and_get_dbname();
+
+ /*
+ * Connect to the database specified by user in primary_conninfo. We need
+ * a database connection for walrcv_exec to work. Please see comments atop
+ * libpqrcv_exec.
+ */
+ InitPostgres(dbname, InvalidOid, NULL, InvalidOid, 0, NULL);
+
+ SetProcessingMode(NormalProcessing);
+
+ initStringInfo(&app_name);
+ if (cluster_name[0])
+ appendStringInfo(&app_name, "%s_%s", cluster_name, "slotsyncworker");
+ else
+ appendStringInfo(&app_name, "%s", "slotsyncworker");
+
+ /*
+ * Establish the connection to the primary server for slots
+ * synchronization.
+ */
+ wrconn = walrcv_connect(PrimaryConnInfo, false, false, false,
+ app_name.data,
+ &err);
+ pfree(app_name.data);
+
+ if (!wrconn)
+ ereport(ERROR,
+ errcode(ERRCODE_CONNECTION_FAILURE),
+ errmsg("could not connect to the primary server: %s", err));
+
+ /*
+ * Using the specified primary server connection, check whether we are
+ * cascading standby and validates primary_slot_name for
+ * non-cascading-standbys.
+ */
+ check_primary_info(wrconn, &am_cascading_standby, &primary_slot_invalid);
+
+ /* Main wait loop */
+ for (;;)
+ {
+ bool some_slot_updated = false;
+ bool recheck_primary_info = am_cascading_standby || primary_slot_invalid;
+
+ ProcessSlotSyncInterrupts(wrconn, true);
+
+ if (!recheck_primary_info)
+ some_slot_updated = synchronize_slots(wrconn);
+ else if (primary_slot_invalid)
+ ereport(LOG, errmsg("skipping slot synchronization"));
+
+ wait_for_slot_activity(some_slot_updated, recheck_primary_info);
+
+ /*
+ * If the standby was promoted then what was previously a cascading
+ * standby might no longer be one, so recheck each time.
+ */
+ if (recheck_primary_info)
+ check_primary_info(wrconn, &am_cascading_standby, &primary_slot_invalid);
+ }
+
+ /*
+ * The slot sync worker can not get here because it will only stop when it
+ * receives a SIGINT from the startup process, or when there is an error.
+ */
+ Assert(false);
+}
+
+/*
+ * Is current process the slot sync worker?
+ */
+bool
+IsLogicalSlotSyncWorker(void)
+{
+ return am_slotsync_worker;
+}
+
+/*
+ * Shut down the slot sync worker.
+ */
+void
+ShutDownSlotSync(void)
+{
+ SpinLockAcquire(&SlotSyncWorker->mutex);
+
+ SlotSyncWorker->stopSignaled = true;
+
+ if (SlotSyncWorker->pid == InvalidPid)
+ {
+ SpinLockRelease(&SlotSyncWorker->mutex);
+ return;
+ }
+ SpinLockRelease(&SlotSyncWorker->mutex);
+
+ kill(SlotSyncWorker->pid, SIGINT);
+
+ /* Wait for it to die */
+ for (;;)
+ {
+ int rc;
+
+ /* Wait a bit, we don't expect to have to wait long */
+ rc = WaitLatch(MyLatch,
+ WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
+ 10L, WAIT_EVENT_REPL_SLOTSYNC_SHUTDOWN);
+
+ if (rc & WL_LATCH_SET)
+ {
+ ResetLatch(MyLatch);
+ CHECK_FOR_INTERRUPTS();
+ }
+
+ SpinLockAcquire(&SlotSyncWorker->mutex);
+
+ /* Is it gone? */
+ if (SlotSyncWorker->pid == InvalidPid)
+ break;
+
+ SpinLockRelease(&SlotSyncWorker->mutex);
+ }
+
+ SpinLockRelease(&SlotSyncWorker->mutex);
+}
+
+/*
+ * Allocate and initialize slot sync worker shared memory
+ */
+void
+SlotSyncWorkerShmemInit(void)
+{
+ Size size;
+ bool found;
+
+ size = sizeof(SlotSyncWorkerCtxStruct);
+ size = MAXALIGN(size);
+
+ SlotSyncWorker = (SlotSyncWorkerCtxStruct *)
+ ShmemInitStruct("Slot Sync Worker Data", size, &found);
+
+ if (!found)
+ {
+ memset(SlotSyncWorker, 0, size);
+ SlotSyncWorker->pid = InvalidPid;
+ SpinLockInit(&SlotSyncWorker->mutex);
+ }
+}
+
+#ifdef EXEC_BACKEND
+/*
+ * The forkexec routine for the slot sync worker process.
+ *
+ * Format up the arglist, then fork and exec.
+ */
+static pid_t
+slotsyncworker_forkexec(void)
+{
+ char *av[10];
+ int ac = 0;
+
+ av[ac++] = "postgres";
+ av[ac++] = "--forkssworker";
+ av[ac++] = NULL; /* filled in by postmaster_forkexec */
+ av[ac] = NULL;
+
+ Assert(ac < lengthof(av));
+
+ return postmaster_forkexec(ac, av);
+}
+#endif
+
+/*
+ * SlotSyncWorkerCanRestart
+ *
+ * Returns true if the worker is allowed to restart if enough time has
+ * passed (SLOTSYNC_RESTART_INTERVAL_SEC) since it was launched last.
+ * Otherwise returns false.
+ *
+ * This is a safety valve to protect against continuous respawn attempts if the
+ * worker is dying immediately at launch. Note that since we will retry to
+ * launch the worker from the postmaster main loop, we will get another
+ * chance later.
+ */
+bool
+SlotSyncWorkerCanRestart(void)
+{
+ time_t curtime = time(NULL);
+
+ /* Return false if too soon since last start. */
+ if ((unsigned int) (curtime - SlotSyncWorker->last_start_time) <
+ (unsigned int) SLOTSYNC_RESTART_INTERVAL_SEC)
+ return false;
+
+ SlotSyncWorker->last_start_time = curtime;
+
+ return true;
+}
+
+/*
+ * Main entry point for slot sync worker process, to be called from the
+ * postmaster.
+ */
+int
+StartSlotSyncWorker(void)
+{
+ pid_t pid;
+
+#ifdef EXEC_BACKEND
+ switch ((pid = slotsyncworker_forkexec()))
+ {
+#else
+ switch ((pid = fork_process()))
+ {
+ case 0:
+ /* in postmaster child ... */
+ InitPostmasterChild();
+
+ /* Close the postmaster's sockets */
+ ClosePostmasterPorts(false);
+
+ ReplSlotSyncWorkerMain(0, NULL);
+ break;
+#endif
+ case -1:
+ ereport(LOG,
+ (errmsg("could not fork slot sync worker process: %m")));
+ return 0;
+
+ default:
+ return (int) pid;
+ }
+
+ /* shouldn't get here */
+ return 0;
+}
diff --git a/src/backend/replication/slot.c b/src/backend/replication/slot.c
index 110cb59783..605dfb0426 100644
--- a/src/backend/replication/slot.c
+++ b/src/backend/replication/slot.c
@@ -46,7 +46,9 @@
#include "common/string.h"
#include "miscadmin.h"
#include "pgstat.h"
+#include "replication/logicalworker.h"
#include "replication/slot.h"
+#include "replication/walsender.h"
#include "storage/fd.h"
#include "storage/ipc.h"
#include "storage/proc.h"
@@ -103,7 +105,6 @@ int max_replication_slots = 10; /* the maximum number of replication
* slots */
static void ReplicationSlotShmemExit(int code, Datum arg);
-static void ReplicationSlotDropAcquired(void);
static void ReplicationSlotDropPtr(ReplicationSlot *slot);
/* internal persistency functions */
@@ -250,11 +251,12 @@ ReplicationSlotValidateName(const char *name, int elevel)
* user will only get commit prepared.
* failover: If enabled, allows the slot to be synced to standbys so
* that logical replication can be resumed after failover.
+ * synced: True if the slot is created by a slotsync worker.
*/
void
ReplicationSlotCreate(const char *name, bool db_specific,
ReplicationSlotPersistency persistency,
- bool two_phase, bool failover)
+ bool two_phase, bool failover, bool synced)
{
ReplicationSlot *slot = NULL;
int i;
@@ -263,6 +265,19 @@ ReplicationSlotCreate(const char *name, bool db_specific,
ReplicationSlotValidateName(name, ERROR);
+ /*
+ * Do not allow users to create the slots with failover enabled on the
+ * standby as we do not support sync to the cascading standby.
+ *
+ * Slot sync worker can still create slots with failover enabled, as it
+ * needs to maintain this value in sync with the remote slots.
+ */
+ if (failover && RecoveryInProgress() && !IsLogicalSlotSyncWorker())
+ ereport(ERROR,
+ errcode(ERRCODE_FEATURE_NOT_SUPPORTED),
+ errmsg("cannot enable failover for a replication slot"
+ " created on the standby"));
+
/*
* If some other backend ran this code concurrently with us, we'd likely
* both allocate the same slot, and that would be bad. We'd also be at
@@ -315,6 +330,7 @@ ReplicationSlotCreate(const char *name, bool db_specific,
slot->data.two_phase = two_phase;
slot->data.two_phase_at = InvalidXLogRecPtr;
slot->data.failover = failover;
+ slot->data.synced = synced;
/* and then data only present in shared memory */
slot->just_dirtied = false;
@@ -677,6 +693,16 @@ ReplicationSlotDrop(const char *name, bool nowait)
ReplicationSlotAcquire(name, nowait);
+ /*
+ * Do not allow users to drop the slots which are currently being synced
+ * from the primary to the standby.
+ */
+ if (RecoveryInProgress() && MyReplicationSlot->data.synced)
+ ereport(ERROR,
+ errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+ errmsg("cannot drop replication slot \"%s\"", name),
+ errdetail("This slot is being synced from the primary server."));
+
ReplicationSlotDropAcquired();
}
@@ -696,6 +722,29 @@ ReplicationSlotAlter(const char *name, bool failover)
errmsg("cannot use %s with a physical replication slot",
"ALTER_REPLICATION_SLOT"));
+ if (RecoveryInProgress())
+ {
+ /*
+ * Do not allow users to alter the slots which are currently being
+ * synced from the primary to the standby.
+ */
+ if (MyReplicationSlot->data.synced)
+ ereport(ERROR,
+ errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+ errmsg("cannot alter replication slot \"%s\"", name),
+ errdetail("This slot is being synced from the primary server."));
+
+ /*
+ * Do not allow users to alter slots to enable failover on the standby
+ * as we do not support sync to the cascading standby.
+ */
+ if (failover)
+ ereport(ERROR,
+ errcode(ERRCODE_FEATURE_NOT_SUPPORTED),
+ errmsg("cannot enable failover for a replication slot"
+ " on the standby"));
+ }
+
SpinLockAcquire(&MyReplicationSlot->mutex);
MyReplicationSlot->data.failover = failover;
SpinLockRelease(&MyReplicationSlot->mutex);
@@ -708,7 +757,7 @@ ReplicationSlotAlter(const char *name, bool failover)
/*
* Permanently drop the currently acquired replication slot.
*/
-static void
+void
ReplicationSlotDropAcquired(void)
{
ReplicationSlot *slot = MyReplicationSlot;
@@ -864,8 +913,8 @@ ReplicationSlotMarkDirty(void)
}
/*
- * Convert a slot that's marked as RS_EPHEMERAL to a RS_PERSISTENT slot,
- * guaranteeing it will be there after an eventual crash.
+ * Convert a slot that's marked as RS_EPHEMERAL or RS_TEMPORARY to a
+ * RS_PERSISTENT slot, guaranteeing it will be there after an eventual crash.
*/
void
ReplicationSlotPersist(void)
diff --git a/src/backend/replication/slotfuncs.c b/src/backend/replication/slotfuncs.c
index eb685089b3..9913396152 100644
--- a/src/backend/replication/slotfuncs.c
+++ b/src/backend/replication/slotfuncs.c
@@ -43,7 +43,7 @@ create_physical_replication_slot(char *name, bool immediately_reserve,
/* acquire replication slot, this will check for conflicting names */
ReplicationSlotCreate(name, false,
temporary ? RS_TEMPORARY : RS_PERSISTENT, false,
- false);
+ false, false);
if (immediately_reserve)
{
@@ -136,7 +136,7 @@ create_logical_replication_slot(char *name, char *plugin,
*/
ReplicationSlotCreate(name, true,
temporary ? RS_TEMPORARY : RS_EPHEMERAL, two_phase,
- failover);
+ failover, false);
/*
* Create logical decoding context to find start point or, if we don't
@@ -237,7 +237,7 @@ pg_drop_replication_slot(PG_FUNCTION_ARGS)
Datum
pg_get_replication_slots(PG_FUNCTION_ARGS)
{
-#define PG_GET_REPLICATION_SLOTS_COLS 16
+#define PG_GET_REPLICATION_SLOTS_COLS 17
ReturnSetInfo *rsinfo = (ReturnSetInfo *) fcinfo->resultinfo;
XLogRecPtr currlsn;
int slotno;
@@ -418,21 +418,23 @@ pg_get_replication_slots(PG_FUNCTION_ARGS)
break;
case RS_INVAL_WAL_REMOVED:
- values[i++] = CStringGetTextDatum("wal_removed");
+ values[i++] = CStringGetTextDatum(SLOT_INVAL_WAL_REMOVED_TEXT);
break;
case RS_INVAL_HORIZON:
- values[i++] = CStringGetTextDatum("rows_removed");
+ values[i++] = CStringGetTextDatum(SLOT_INVAL_HORIZON_TEXT);
break;
case RS_INVAL_WAL_LEVEL:
- values[i++] = CStringGetTextDatum("wal_level_insufficient");
+ values[i++] = CStringGetTextDatum(SLOT_INVAL_WAL_LEVEL_TEXT);
break;
}
}
values[i++] = BoolGetDatum(slot_contents.data.failover);
+ values[i++] = BoolGetDatum(slot_contents.data.synced);
+
Assert(i == PG_GET_REPLICATION_SLOTS_COLS);
tuplestore_putvalues(rsinfo->setResult, rsinfo->setDesc,
@@ -700,7 +702,6 @@ copy_replication_slot(FunctionCallInfo fcinfo, bool logical_slot)
XLogRecPtr src_restart_lsn;
bool src_islogical;
bool temporary;
- bool failover;
char *plugin;
Datum values[2];
bool nulls[2];
@@ -756,7 +757,6 @@ copy_replication_slot(FunctionCallInfo fcinfo, bool logical_slot)
src_islogical = SlotIsLogical(&first_slot_contents);
src_restart_lsn = first_slot_contents.data.restart_lsn;
temporary = (first_slot_contents.data.persistency == RS_TEMPORARY);
- failover = first_slot_contents.data.failover;
plugin = logical_slot ? NameStr(first_slot_contents.data.plugin) : NULL;
/* Check type of replication slot */
@@ -791,12 +791,20 @@ copy_replication_slot(FunctionCallInfo fcinfo, bool logical_slot)
* We must not try to read WAL, since we haven't reserved it yet --
* hence pass find_startpoint false. confirmed_flush will be set
* below, by copying from the source slot.
+ *
+ * To avoid potential issues with the slotsync worker when the
+ * restart_lsn of a replication slot goes backwards, we set the
+ * failover option to false here. This situation occurs when a slot on
+ * the primary server is dropped and immediately replaced with a new
+ * slot of the same name, created by copying from another existing
+ * slot. However, the slotsync worker will only observe the
+ * restart_lsn of the same slot going backwards.
*/
create_logical_replication_slot(NameStr(*dst_name),
plugin,
temporary,
false,
- failover,
+ false,
src_restart_lsn,
false);
}
diff --git a/src/backend/replication/walreceiverfuncs.c b/src/backend/replication/walreceiverfuncs.c
index 73a7d8f96c..d420a833cd 100644
--- a/src/backend/replication/walreceiverfuncs.c
+++ b/src/backend/replication/walreceiverfuncs.c
@@ -345,6 +345,22 @@ GetWalRcvFlushRecPtr(XLogRecPtr *latestChunkStart, TimeLineID *receiveTLI)
return recptr;
}
+/*
+ * Returns the latest reported end of WAL on the sender
+ */
+XLogRecPtr
+GetWalRcvLatestWalEnd()
+{
+ WalRcvData *walrcv = WalRcv;
+ XLogRecPtr recptr;
+
+ SpinLockAcquire(&walrcv->mutex);
+ recptr = walrcv->latestWalEnd;
+ SpinLockRelease(&walrcv->mutex);
+
+ return recptr;
+}
+
/*
* Returns the last+1 byte position that walreceiver has written.
* This returns a recently written value without taking a lock.
diff --git a/src/backend/replication/walsender.c b/src/backend/replication/walsender.c
index 77c8baa32a..15f045fe1f 100644
--- a/src/backend/replication/walsender.c
+++ b/src/backend/replication/walsender.c
@@ -72,6 +72,7 @@
#include "postmaster/interrupt.h"
#include "replication/decode.h"
#include "replication/logical.h"
+#include "replication/logicalworker.h"
#include "replication/slot.h"
#include "replication/snapbuild.h"
#include "replication/syncrep.h"
@@ -243,7 +244,6 @@ static void WalSndShutdown(void) pg_attribute_noreturn();
static void XLogSendPhysical(void);
static void XLogSendLogical(void);
static void WalSndDone(WalSndSendDataCallback send_data);
-static XLogRecPtr GetStandbyFlushRecPtr(TimeLineID *tli);
static void IdentifySystem(void);
static void UploadManifest(void);
static bool HandleUploadManifestPacket(StringInfo buf, off_t *offset,
@@ -1224,7 +1224,7 @@ CreateReplicationSlot(CreateReplicationSlotCmd *cmd)
{
ReplicationSlotCreate(cmd->slotname, false,
cmd->temporary ? RS_TEMPORARY : RS_PERSISTENT,
- false, false);
+ false, false, false);
if (reserve_wal)
{
@@ -1255,7 +1255,7 @@ CreateReplicationSlot(CreateReplicationSlotCmd *cmd)
*/
ReplicationSlotCreate(cmd->slotname, true,
cmd->temporary ? RS_TEMPORARY : RS_EPHEMERAL,
- two_phase, failover);
+ two_phase, failover, false);
/*
* Do options check early so that we can bail before calling the
@@ -3375,14 +3375,17 @@ WalSndDone(WalSndSendDataCallback send_data)
}
/*
- * Returns the latest point in WAL that has been safely flushed to disk, and
- * can be sent to the standby. This should only be called when in recovery,
- * ie. we're streaming to a cascaded standby.
+ * Returns the latest point in WAL that has been safely flushed to disk.
+ * This should only be called when in recovery.
+ *
+ * This is called either by cascading walsender to find WAL postion to
+ * be sent to a cascaded standby or by a slot sync worker to validate
+ * remote slot's lsn before syncing it locally.
*
* As a side-effect, *tli is updated to the TLI of the last
* replayed WAL record.
*/
-static XLogRecPtr
+XLogRecPtr
GetStandbyFlushRecPtr(TimeLineID *tli)
{
XLogRecPtr replayPtr;
@@ -3391,6 +3394,8 @@ GetStandbyFlushRecPtr(TimeLineID *tli)
TimeLineID receiveTLI;
XLogRecPtr result;
+ Assert(am_cascading_walsender || IsLogicalSlotSyncWorker());
+
/*
* We can safely send what's already been replayed. Also, if walreceiver
* is streaming WAL from the same timeline, we can send anything that it
diff --git a/src/backend/storage/ipc/ipci.c b/src/backend/storage/ipc/ipci.c
index 7084e18861..925ac6c942 100644
--- a/src/backend/storage/ipc/ipci.c
+++ b/src/backend/storage/ipc/ipci.c
@@ -38,6 +38,7 @@
#include "replication/slot.h"
#include "replication/walreceiver.h"
#include "replication/walsender.h"
+#include "replication/worker_internal.h"
#include "storage/bufmgr.h"
#include "storage/dsm.h"
#include "storage/dsm_registry.h"
@@ -347,6 +348,7 @@ CreateOrAttachShmemStructs(void)
WalSummarizerShmemInit();
PgArchShmemInit();
ApplyLauncherShmemInit();
+ SlotSyncWorkerShmemInit();
/*
* Set up other modules that need some shared memory space
diff --git a/src/backend/storage/lmgr/proc.c b/src/backend/storage/lmgr/proc.c
index e5977548fe..3ff0f449e0 100644
--- a/src/backend/storage/lmgr/proc.c
+++ b/src/backend/storage/lmgr/proc.c
@@ -39,6 +39,7 @@
#include "miscadmin.h"
#include "pgstat.h"
#include "postmaster/autovacuum.h"
+#include "replication/logicalworker.h"
#include "replication/slot.h"
#include "replication/syncrep.h"
#include "replication/walsender.h"
@@ -364,8 +365,12 @@ InitProcess(void)
* child; this is so that the postmaster can detect it if we exit without
* cleaning up. (XXX autovac launcher currently doesn't participate in
* this; it probably should.)
+ *
+ * Slot sync worker also does not participate in it, see comments atop
+ * 'struct bkend' in postmaster.c.
*/
- if (IsUnderPostmaster && !IsAutoVacuumLauncherProcess())
+ if (IsUnderPostmaster && !IsAutoVacuumLauncherProcess() &&
+ !IsLogicalSlotSyncWorker())
MarkPostmasterChildActive();
/*
@@ -934,8 +939,12 @@ ProcKill(int code, Datum arg)
* This process is no longer present in shared memory in any meaningful
* way, so tell the postmaster we've cleaned up acceptably well. (XXX
* autovac launcher should be included here someday)
+ *
+ * Slot sync worker is also not a postmaster child, so skip this shared
+ * memory related processing here.
*/
- if (IsUnderPostmaster && !IsAutoVacuumLauncherProcess())
+ if (IsUnderPostmaster && !IsAutoVacuumLauncherProcess() &&
+ !IsLogicalSlotSyncWorker())
MarkPostmasterChildInactive();
/* wake autovac launcher if needed -- see comments in FreeWorkerInfo */
diff --git a/src/backend/utils/activity/pgstat_io.c b/src/backend/utils/activity/pgstat_io.c
index 43c393d6fe..9d6e067382 100644
--- a/src/backend/utils/activity/pgstat_io.c
+++ b/src/backend/utils/activity/pgstat_io.c
@@ -338,6 +338,7 @@ pgstat_tracks_io_bktype(BackendType bktype)
case B_BG_WORKER:
case B_BG_WRITER:
case B_CHECKPOINTER:
+ case B_SLOTSYNC_WORKER:
case B_STANDALONE_BACKEND:
case B_STARTUP:
case B_WAL_SENDER:
diff --git a/src/backend/utils/activity/wait_event_names.txt b/src/backend/utils/activity/wait_event_names.txt
index cd22dca702..d703222fab 100644
--- a/src/backend/utils/activity/wait_event_names.txt
+++ b/src/backend/utils/activity/wait_event_names.txt
@@ -53,6 +53,8 @@ LOGICAL_APPLY_MAIN "Waiting in main loop of logical replication apply process."
LOGICAL_LAUNCHER_MAIN "Waiting in main loop of logical replication launcher process."
LOGICAL_PARALLEL_APPLY_MAIN "Waiting in main loop of logical replication parallel apply process."
RECOVERY_WAL_STREAM "Waiting in main loop of startup process for WAL to arrive, during streaming recovery."
+REPL_SLOTSYNC_MAIN "Waiting in main loop of slot sync worker."
+REPL_SLOTSYNC_SHUTDOWN "Waiting for slot sync worker to shut down."
SYSLOGGER_MAIN "Waiting in main loop of syslogger process."
WAL_RECEIVER_MAIN "Waiting in main loop of WAL receiver process."
WAL_SENDER_MAIN "Waiting in main loop of WAL sender process."
diff --git a/src/backend/utils/init/miscinit.c b/src/backend/utils/init/miscinit.c
index 23f77a59e5..309aa33a62 100644
--- a/src/backend/utils/init/miscinit.c
+++ b/src/backend/utils/init/miscinit.c
@@ -40,6 +40,7 @@
#include "postmaster/interrupt.h"
#include "postmaster/pgarch.h"
#include "postmaster/postmaster.h"
+#include "replication/logicalworker.h"
#include "storage/fd.h"
#include "storage/ipc.h"
#include "storage/latch.h"
@@ -293,6 +294,9 @@ GetBackendTypeDesc(BackendType backendType)
case B_LOGGER:
backendDesc = "logger";
break;
+ case B_SLOTSYNC_WORKER:
+ backendDesc = "slotsyncworker";
+ break;
case B_STANDALONE_BACKEND:
backendDesc = "standalone backend";
break;
@@ -835,9 +839,10 @@ InitializeSessionUserIdStandalone(void)
{
/*
* This function should only be called in single-user mode, in autovacuum
- * workers, and in background workers.
+ * workers, in slot sync worker and in background workers.
*/
- Assert(!IsUnderPostmaster || IsAutoVacuumWorkerProcess() || IsBackgroundWorker);
+ Assert(!IsUnderPostmaster || IsAutoVacuumWorkerProcess() ||
+ IsLogicalSlotSyncWorker() || IsBackgroundWorker);
/* call only once */
Assert(!OidIsValid(AuthenticatedUserId));
diff --git a/src/backend/utils/init/postinit.c b/src/backend/utils/init/postinit.c
index 1ad3367159..392b2d938c 100644
--- a/src/backend/utils/init/postinit.c
+++ b/src/backend/utils/init/postinit.c
@@ -42,6 +42,7 @@
#include "pgstat.h"
#include "postmaster/autovacuum.h"
#include "postmaster/postmaster.h"
+#include "replication/logicalworker.h"
#include "replication/slot.h"
#include "replication/walsender.h"
#include "storage/bufmgr.h"
@@ -874,10 +875,11 @@ InitPostgres(const char *in_dbname, Oid dboid,
* Perform client authentication if necessary, then figure out our
* postgres user ID, and see if we are a superuser.
*
- * In standalone mode and in autovacuum worker processes, we use a fixed
- * ID, otherwise we figure it out from the authenticated user name.
+ * In standalone mode, autovacuum worker processes and slot sync worker
+ * process, we use a fixed ID, otherwise we figure it out from the
+ * authenticated user name.
*/
- if (bootstrap || IsAutoVacuumWorkerProcess())
+ if (bootstrap || IsAutoVacuumWorkerProcess() || IsLogicalSlotSyncWorker())
{
InitializeSessionUserIdStandalone();
am_superuser = true;
diff --git a/src/backend/utils/misc/guc_tables.c b/src/backend/utils/misc/guc_tables.c
index 7fe58518d7..3af11b2b80 100644
--- a/src/backend/utils/misc/guc_tables.c
+++ b/src/backend/utils/misc/guc_tables.c
@@ -68,6 +68,7 @@
#include "replication/logicallauncher.h"
#include "replication/slot.h"
#include "replication/syncrep.h"
+#include "replication/worker_internal.h"
#include "storage/bufmgr.h"
#include "storage/large_object.h"
#include "storage/pg_shmem.h"
@@ -2054,6 +2055,15 @@ struct config_bool ConfigureNamesBool[] =
NULL, NULL, NULL
},
+ {
+ {"enable_syncslot", PGC_SIGHUP, REPLICATION_STANDBY,
+ gettext_noop("Enables a physical standby to synchronize logical failover slots from the primary server."),
+ },
+ &enable_syncslot,
+ false,
+ NULL, NULL, NULL
+ },
+
/* End-of-list marker */
{
{NULL, 0, 0, NULL, NULL}, NULL, false, NULL, NULL, NULL
diff --git a/src/backend/utils/misc/postgresql.conf.sample b/src/backend/utils/misc/postgresql.conf.sample
index da10b43dac..3868694d3f 100644
--- a/src/backend/utils/misc/postgresql.conf.sample
+++ b/src/backend/utils/misc/postgresql.conf.sample
@@ -361,6 +361,7 @@
#wal_retrieve_retry_interval = 5s # time to wait before retrying to
# retrieve WAL after a failed attempt
#recovery_min_apply_delay = 0 # minimum delay for applying changes during recovery
+#enable_syncslot = off # enables slot synchronization on the physical standby from the primary
# - Subscribers -
diff --git a/src/include/catalog/pg_proc.dat b/src/include/catalog/pg_proc.dat
index 29af4ce65d..994e33f59b 100644
--- a/src/include/catalog/pg_proc.dat
+++ b/src/include/catalog/pg_proc.dat
@@ -11127,9 +11127,9 @@
proname => 'pg_get_replication_slots', prorows => '10', proisstrict => 'f',
proretset => 't', provolatile => 's', prorettype => 'record',
proargtypes => '',
- proallargtypes => '{name,name,text,oid,bool,bool,int4,xid,xid,pg_lsn,pg_lsn,text,int8,bool,text,bool}',
- proargmodes => '{o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o}',
- proargnames => '{slot_name,plugin,slot_type,datoid,temporary,active,active_pid,xmin,catalog_xmin,restart_lsn,confirmed_flush_lsn,wal_status,safe_wal_size,two_phase,conflict_reason,failover}',
+ proallargtypes => '{name,name,text,oid,bool,bool,int4,xid,xid,pg_lsn,pg_lsn,text,int8,bool,text,bool,bool}',
+ proargmodes => '{o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o}',
+ proargnames => '{slot_name,plugin,slot_type,datoid,temporary,active,active_pid,xmin,catalog_xmin,restart_lsn,confirmed_flush_lsn,wal_status,safe_wal_size,two_phase,conflict_reason,failover,synced}',
prosrc => 'pg_get_replication_slots' },
{ oid => '3786', descr => 'set up a logical replication slot',
proname => 'pg_create_logical_replication_slot', provolatile => 'v',
diff --git a/src/include/miscadmin.h b/src/include/miscadmin.h
index 0b01c1f093..65819cb7a7 100644
--- a/src/include/miscadmin.h
+++ b/src/include/miscadmin.h
@@ -332,6 +332,7 @@ typedef enum BackendType
B_BG_WRITER,
B_CHECKPOINTER,
B_LOGGER,
+ B_SLOTSYNC_WORKER,
B_STANDALONE_BACKEND,
B_STARTUP,
B_WAL_RECEIVER,
diff --git a/src/include/replication/logicalworker.h b/src/include/replication/logicalworker.h
index a18d79d1b2..bbe04226db 100644
--- a/src/include/replication/logicalworker.h
+++ b/src/include/replication/logicalworker.h
@@ -22,6 +22,7 @@ extern void TablesyncWorkerMain(Datum main_arg);
extern bool IsLogicalWorker(void);
extern bool IsLogicalParallelApplyWorker(void);
+extern bool IsLogicalSlotSyncWorker(void);
extern void HandleParallelApplyMessageInterrupt(void);
extern void HandleParallelApplyMessages(void);
diff --git a/src/include/replication/slot.h b/src/include/replication/slot.h
index da4c776492..1f4446aa3a 100644
--- a/src/include/replication/slot.h
+++ b/src/include/replication/slot.h
@@ -52,6 +52,14 @@ typedef enum ReplicationSlotInvalidationCause
RS_INVAL_WAL_LEVEL,
} ReplicationSlotInvalidationCause;
+/*
+ * The possible values for 'conflict_reason' returned in
+ * pg_get_replication_slots.
+ */
+#define SLOT_INVAL_WAL_REMOVED_TEXT "wal_removed"
+#define SLOT_INVAL_HORIZON_TEXT "rows_removed"
+#define SLOT_INVAL_WAL_LEVEL_TEXT "wal_level_insufficient"
+
/*
* On-Disk data of a replication slot, preserved across restarts.
*/
@@ -112,6 +120,11 @@ typedef struct ReplicationSlotPersistentData
/* plugin name */
NameData plugin;
+ /*
+ * Was this slot synchronized from the primary server?
+ */
+ char synced;
+
/*
* Is this a failover slot (sync candidate for standbys)? Only relevant
* for logical slots on the primary server.
@@ -224,9 +237,11 @@ extern void ReplicationSlotsShmemInit(void);
/* management of individual slots */
extern void ReplicationSlotCreate(const char *name, bool db_specific,
ReplicationSlotPersistency persistency,
- bool two_phase, bool failover);
+ bool two_phase, bool failover,
+ bool synced);
extern void ReplicationSlotPersist(void);
extern void ReplicationSlotDrop(const char *name, bool nowait);
+extern void ReplicationSlotDropAcquired(void);
extern void ReplicationSlotAlter(const char *name, bool failover);
extern void ReplicationSlotAcquire(const char *name, bool nowait);
diff --git a/src/include/replication/walreceiver.h b/src/include/replication/walreceiver.h
index cb4086782d..1b563a16cd 100644
--- a/src/include/replication/walreceiver.h
+++ b/src/include/replication/walreceiver.h
@@ -496,6 +496,7 @@ extern void RequestXLogStreaming(TimeLineID tli, XLogRecPtr recptr,
bool create_temp_slot);
extern XLogRecPtr GetWalRcvFlushRecPtr(XLogRecPtr *latestChunkStart, TimeLineID *receiveTLI);
extern XLogRecPtr GetWalRcvWriteRecPtr(void);
+extern XLogRecPtr GetWalRcvLatestWalEnd(void);
extern int GetReplicationApplyDelay(void);
extern int GetReplicationTransferLatency(void);
diff --git a/src/include/replication/walsender.h b/src/include/replication/walsender.h
index 1b58d50b3b..276d8913aa 100644
--- a/src/include/replication/walsender.h
+++ b/src/include/replication/walsender.h
@@ -12,6 +12,8 @@
#ifndef _WALSENDER_H
#define _WALSENDER_H
+#include "access/xlogdefs.h"
+
/*
* What to do with a snapshot in create replication slot command.
*/
@@ -45,6 +47,7 @@ extern void WalSndInitStopping(void);
extern void WalSndWaitStopping(void);
extern void HandleWalSndInitStopping(void);
extern void WalSndRqstFileReload(void);
+extern XLogRecPtr GetStandbyFlushRecPtr(TimeLineID *tli);
/*
* Remember that we want to wakeup walsenders later
diff --git a/src/include/replication/worker_internal.h b/src/include/replication/worker_internal.h
index 515aefd519..a04815969b 100644
--- a/src/include/replication/worker_internal.h
+++ b/src/include/replication/worker_internal.h
@@ -237,6 +237,11 @@ extern PGDLLIMPORT bool in_remote_transaction;
extern PGDLLIMPORT bool InitializingApplyWorker;
+/* Slot sync worker objects */
+extern PGDLLIMPORT char *PrimaryConnInfo;
+extern PGDLLIMPORT char *PrimarySlotName;
+extern PGDLLIMPORT bool enable_syncslot;
+
extern void logicalrep_worker_attach(int slot);
extern LogicalRepWorker *logicalrep_worker_find(Oid subid, Oid relid,
bool only_running);
@@ -324,6 +329,13 @@ extern void pa_decr_and_wait_stream_block(void);
extern void pa_xact_finish(ParallelApplyWorkerInfo *winfo,
XLogRecPtr remote_lsn);
+#ifdef EXEC_BACKEND
+extern void ReplSlotSyncWorkerMain(int argc, char *argv[]) pg_attribute_noreturn();
+#endif
+extern int StartSlotSyncWorker(void);
+extern bool SlotSyncWorkerCanRestart(void);
+extern void ShutDownSlotSync(void);
+extern void SlotSyncWorkerShmemInit(void);
#define isParallelApplyWorker(worker) ((worker)->in_use && \
(worker)->type == WORKERTYPE_PARALLEL_APPLY)
diff --git a/src/test/recovery/t/040_standby_failover_slots_sync.pl b/src/test/recovery/t/040_standby_failover_slots_sync.pl
index bc58ff4cab..2a017b4286 100644
--- a/src/test/recovery/t/040_standby_failover_slots_sync.pl
+++ b/src/test/recovery/t/040_standby_failover_slots_sync.pl
@@ -18,7 +18,8 @@ $publisher->init(allows_streaming => 'logical');
$publisher->start;
$publisher->safe_psql('postgres',
- "CREATE PUBLICATION regress_mypub FOR ALL TABLES;");
+ "CREATE PUBLICATION regress_mypub FOR ALL TABLES;"
+);
my $publisher_connstr = $publisher->connstr . ' dbname=postgres';
@@ -97,4 +98,168 @@ my ($result, $stdout, $stderr) = $subscriber1->psql('postgres',
ok( $stderr =~ /ERROR: cannot set failover for enabled subscription/,
"altering failover is not allowed for enabled subscription");
+##################################################
+# Test logical failover slots on the standby
+# Configure standby1 to replicate and synchronize logical slots configured
+# for failover on the primary
+#
+# failover slot lsub1_slot->| ----> subscriber1 (connected via logical replication)
+# primary ---> |
+# physical slot sb1_slot--->| ----> standby1 (connected via streaming replication)
+# | lsub1_slot(synced_slot)
+##################################################
+
+my $primary = $publisher;
+my $backup_name = 'backup';
+$primary->backup($backup_name);
+
+# Create a standby
+my $standby1 = PostgreSQL::Test::Cluster->new('standby1');
+$standby1->init_from_backup(
+ $primary, $backup_name,
+ has_streaming => 1,
+ has_restoring => 1);
+
+my $connstr_1 = $primary->connstr;
+$standby1->append_conf(
+ 'postgresql.conf', qq(
+enable_syncslot = true
+hot_standby_feedback = on
+primary_slot_name = 'sb1_slot'
+primary_conninfo = '$connstr_1 dbname=postgres'
+));
+
+$primary->psql('postgres',
+ q{SELECT pg_create_physical_replication_slot('sb1_slot');});
+
+my $standby1_conninfo = $standby1->connstr . ' dbname=postgres';
+my $offset = -s $standby1->logfile;
+
+# Start the standby so that slot syncing can begin
+$standby1->start;
+
+# Generate a log to trigger the walsender to send messages to the walreceiver
+# which will update WalRcv->latestWalEnd to a valid number.
+$primary->safe_psql('postgres', "SELECT pg_log_standby_snapshot();");
+
+# Wait for the standby to finish sync
+$standby1->wait_for_log(
+ qr/LOG: ( [A-Z0-9]+:)? newly created slot \"lsub1_slot\" is sync-ready now/,
+ $offset);
+
+# Confirm that the logical failover slot is created on the standby and is
+# flagged as 'synced'
+is($standby1->safe_psql('postgres',
+ q{SELECT synced FROM pg_replication_slots WHERE slot_name = 'lsub1_slot';}),
+ "t",
+ 'logical slot has synced as true on standby');
+
+##################################################
+# Test to confirm that restart_lsn and confirmed_flush_lsn of the logical slot
+# on the primary is synced to the standby
+##################################################
+
+# Insert data on the primary
+$primary->safe_psql(
+ 'postgres', qq[
+ CREATE TABLE tab_int (a int PRIMARY KEY);
+ INSERT INTO tab_int SELECT generate_series(1, 10);
+]);
+
+# Subscribe to the new table data and wait for it to arrive
+$subscriber1->safe_psql(
+ 'postgres', qq[
+ CREATE TABLE tab_int (a int PRIMARY KEY);
+ ALTER SUBSCRIPTION regress_mysub1 REFRESH PUBLICATION;
+]);
+
+$subscriber1->wait_for_subscription_sync;
+
+# Do not allow any further advancement of the restart_lsn and
+# confirmed_flush_lsn for the lsub1_slot.
+$subscriber1->safe_psql('postgres', "ALTER SUBSCRIPTION regress_mysub1 DISABLE");
+
+# Wait for the replication slot to become inactive on the publisher
+$primary->poll_query_until(
+ 'postgres',
+ "SELECT COUNT(*) FROM pg_catalog.pg_replication_slots WHERE slot_name = 'lsub1_slot' AND active='f'",
+ 1);
+
+# Get the restart_lsn for the logical slot lsub1_slot on the primary
+my $primary_restart_lsn = $primary->safe_psql('postgres',
+ "SELECT restart_lsn from pg_replication_slots WHERE slot_name = 'lsub1_slot';");
+
+# Get the confirmed_flush_lsn for the logical slot lsub1_slot on the primary
+my $primary_flush_lsn = $primary->safe_psql('postgres',
+ "SELECT confirmed_flush_lsn from pg_replication_slots WHERE slot_name = 'lsub1_slot';");
+
+# Confirm that restart_lsn and of confirmed_flush_lsn lsub1_slot slot are synced
+# to the standby
+ok( $standby1->poll_query_until(
+ 'postgres',
+ "SELECT '$primary_restart_lsn' = restart_lsn AND '$primary_flush_lsn' = confirmed_flush_lsn from pg_replication_slots WHERE slot_name = 'lsub1_slot';"),
+ 'restart_lsn and confirmed_flush_lsn of slot lsub1_slot synced to standby');
+
+##################################################
+# Test that a synchronized slot can not be decoded, altered or dropped by the user
+##################################################
+
+# Disable hot_standby_feedback temporarily to stop slot sync worker otherwise
+# the concerned testing scenarios here may be interrupted by different error:
+# 'ERROR: replication slot is active for PID ..'
+$standby1->safe_psql('postgres', 'ALTER SYSTEM SET hot_standby_feedback = off;');
+$standby1->restart;
+
+# Attempting to perform logical decoding on a synced slot should result in an error
+($result, $stdout, $stderr) = $standby1->psql('postgres',
+ "select * from pg_logical_slot_get_changes('lsub1_slot',NULL,NULL);");
+ok($stderr =~ /ERROR: cannot use replication slot "lsub1_slot" for logical decoding/,
+ "logical decoding is not allowed on synced slot");
+
+# Attempting to alter a synced slot should result in an error
+($result, $stdout, $stderr) = $standby1->psql(
+ 'postgres',
+ qq[ALTER_REPLICATION_SLOT lsub1_slot (failover);],
+ replication => 'database');
+ok($stderr =~ /ERROR: cannot alter replication slot "lsub1_slot"/,
+ "synced slot on standby cannot be altered");
+
+# Attempting to drop a synced slot should result in an error
+($result, $stdout, $stderr) = $standby1->psql('postgres',
+ "SELECT pg_drop_replication_slot('lsub1_slot');");
+ok($stderr =~ /ERROR: cannot drop replication slot "lsub1_slot"/,
+ "synced slot on standby cannot be dropped");
+
+# Enable hot_standby_feedback and restart standby
+$standby1->safe_psql('postgres', 'ALTER SYSTEM SET hot_standby_feedback = on;');
+$standby1->restart;
+
+##################################################
+# Promote the standby1 to primary. Confirm that:
+# a) the slot 'lsub1_slot' is retained on the new primary
+# b) logical replication for regress_mysub1 is resumed successfully after failover
+##################################################
+$standby1->promote;
+
+# Update subscription with the new primary's connection info
+$subscriber1->safe_psql('postgres',
+ "ALTER SUBSCRIPTION regress_mysub1 CONNECTION '$standby1_conninfo';
+ ALTER SUBSCRIPTION regress_mysub1 ENABLE; ");
+
+# Confirm the synced slot 'lsub1_slot' is retained on the new primary
+is($standby1->safe_psql('postgres',
+ q{SELECT slot_name FROM pg_replication_slots WHERE slot_name = 'lsub1_slot';}),
+ 'lsub1_slot',
+ 'synced slot retained on the new primary');
+
+# Insert data on the new primary
+$standby1->safe_psql('postgres',
+ "INSERT INTO tab_int SELECT generate_series(11, 20);");
+$standby1->wait_for_catchup('regress_mysub1');
+
+# Confirm that data in tab_int replicated on the subscriber
+is( $subscriber1->safe_psql('postgres', q{SELECT count(*) FROM tab_int;}),
+ "20",
+ 'data replicated from the new primary');
+
done_testing();
diff --git a/src/test/regress/expected/rules.out b/src/test/regress/expected/rules.out
index abc944e8b8..b7488d760e 100644
--- a/src/test/regress/expected/rules.out
+++ b/src/test/regress/expected/rules.out
@@ -1474,8 +1474,9 @@ pg_replication_slots| SELECT l.slot_name,
l.safe_wal_size,
l.two_phase,
l.conflict_reason,
- l.failover
- FROM (pg_get_replication_slots() l(slot_name, plugin, slot_type, datoid, temporary, active, active_pid, xmin, catalog_xmin, restart_lsn, confirmed_flush_lsn, wal_status, safe_wal_size, two_phase, conflict_reason, failover)
+ l.failover,
+ l.synced
+ FROM (pg_get_replication_slots() l(slot_name, plugin, slot_type, datoid, temporary, active, active_pid, xmin, catalog_xmin, restart_lsn, confirmed_flush_lsn, wal_status, safe_wal_size, two_phase, conflict_reason, failover, synced)
LEFT JOIN pg_database d ON ((l.datoid = d.oid)));
pg_roles| SELECT pg_authid.rolname,
pg_authid.rolsuper,
diff --git a/src/test/regress/expected/sysviews.out b/src/test/regress/expected/sysviews.out
index 9be7aca2b8..fae059d389 100644
--- a/src/test/regress/expected/sysviews.out
+++ b/src/test/regress/expected/sysviews.out
@@ -133,8 +133,9 @@ select name, setting from pg_settings where name like 'enable%';
enable_self_join_removal | on
enable_seqscan | on
enable_sort | on
+ enable_syncslot | off
enable_tidscan | on
-(23 rows)
+(24 rows)
-- There are always wait event descriptions for various types.
select type, count(*) > 0 as ok FROM pg_wait_events
diff --git a/src/tools/pgindent/typedefs.list b/src/tools/pgindent/typedefs.list
index 91433d439b..a35e399f0c 100644
--- a/src/tools/pgindent/typedefs.list
+++ b/src/tools/pgindent/typedefs.list
@@ -2325,6 +2325,7 @@ RelocationBufferInfo
RelptrFreePageBtree
RelptrFreePageManager
RelptrFreePageSpanLeader
+RemoteSlot
RenameStmt
ReopenPtrType
ReorderBuffer
@@ -2584,6 +2585,7 @@ SlabBlock
SlabContext
SlabSlot
SlotNumber
+SlotSyncWorkerCtxStruct
SlruCtl
SlruCtlData
SlruErrorCause
--
2.34.1