v46-0002-Add-logical-slot-sync-capability-to-the-physical.patch

application/octet-stream

Filename: v46-0002-Add-logical-slot-sync-capability-to-the-physical.patch
Type: application/octet-stream
Part: 0
Message: RE: Synchronizing slots from primary to standby

Patch

Format: format-patch
Series: patch v46-0002
Subject: Add logical slot sync capability to the physical standby
File+
doc/src/sgml/bgworker.sgml 52 12
doc/src/sgml/config.sgml 30 2
doc/src/sgml/logicaldecoding.sgml 33 0
doc/src/sgml/system-views.sgml 26 0
src/backend/access/transam/xlogrecovery.c 10 0
src/backend/catalog/system_views.sql 2 1
src/backend/postmaster/bgworker.c 4 0
src/backend/postmaster/postmaster.c 10 0
src/backend/replication/libpqwalreceiver/libpqwalreceiver.c 42 1
src/backend/replication/logical/logical.c 25 0
src/backend/replication/logical/Makefile 1 0
src/backend/replication/logical/meson.build 1 0
src/backend/replication/logical/slotsync.c 1282 0
src/backend/replication/logical/tablesync.c 1 0
src/backend/replication/logical/worker.c 14 1
src/backend/replication/slot.c 22 2
src/backend/replication/slotfuncs.c 33 4
src/backend/replication/walsender.c 3 3
src/backend/storage/ipc/ipci.c 2 0
src/backend/tcop/postgres.c 11 0
src/backend/utils/activity/wait_event_names.txt 2 0
src/backend/utils/misc/guc_tables.c 10 0
src/backend/utils/misc/postgresql.conf.sample 1 0
src/include/catalog/pg_proc.dat 7 3
src/include/commands/subscriptioncmds.h 4 0
src/include/postmaster/bgworker.h 1 0
src/include/replication/logicalworker.h 1 0
src/include/replication/slot.h 18 4
src/include/replication/walreceiver.h 19 0
src/include/replication/worker_internal.h 11 0
src/test/recovery/t/050_standby_failover_slots_sync.pl 203 0
src/test/regress/expected/rules.out 3 2
src/test/regress/expected/sysviews.out 2 1
src/tools/pgindent/typedefs.list 2 0
From 7ed6b58df1e6a71b766d202fbd1eae66e08194f8 Mon Sep 17 00:00:00 2001
From: Hou Zhijie <houzj.fnst@cn.fujitsu.com>
Date: Tue, 12 Dec 2023 16:55:06 +0800
Subject: [PATCH v46 2/2] Add logical slot sync capability to the physical
 standby

This patch implements synchronization of logical replication slots
from the primary server to the physical standby so that logical
replication can be resumed after failover. All the failover logical
replication slots on the primary (assuming configurations are
appropriate) are automatically created on the physical standbys and
are synced periodically. Slot-sync worker on the standby server
ping the primary server at regular intervals to get the necessary
failover logical slots information and create/update the slots locally.

GUC 'enable_syncslot' enables a physical standby to synchronize failover
logical replication slots from the primary server.

The nap time of the worker is tuned according to the activity on the primary.
The worker starts with nap time of 10ms and if no activity is observed on
the primary for some time, then nap time is increased to 10sec. If
activity is observed again, nap time is reduced back to 10ms.

The logical slots created by slot-sync worker on physical standbys are not
allowed to be dropped or consumed. Any attempt to perform logical decoding on
such slots will result in an error.

If a logical slot is invalidated on the primary, slot on the standby is also
invalidated.

If a logical slot on the primary is valid but is invalidated on the standby,
then that slot is dropped and recreated on the standby in next sync-cycle. It
is okay to recreate such slots as long as these are not consumable on the
standby (which is the case currently). This situation may occur due to the
following reasons:
- The max_slot_wal_keep_size on the standby is insufficient to retain WAL
  records from the restart_lsn of the slot.
- primary_slot_name is temporarily reset to null and the physical slot is
  removed.
- The primary changes wal_level to a level lower than logical.

The slots synchronization status on the standby can be monitored using
'sync_state' column of pg_replication_slots view. The values are:
'n': none for user slots,
'i': sync initiated for the slot but slot is not ready yet for periodic syncs,
'r': ready for periodic syncs.
---
 doc/src/sgml/bgworker.sgml                    |   64 +-
 doc/src/sgml/config.sgml                      |   32 +-
 doc/src/sgml/logicaldecoding.sgml             |   33 +
 doc/src/sgml/system-views.sgml                |   26 +
 src/backend/access/transam/xlogrecovery.c     |   10 +
 src/backend/catalog/system_views.sql          |    3 +-
 src/backend/postmaster/bgworker.c             |    4 +
 src/backend/postmaster/postmaster.c           |   10 +
 .../libpqwalreceiver/libpqwalreceiver.c       |   43 +-
 src/backend/replication/logical/Makefile      |    1 +
 src/backend/replication/logical/logical.c     |   25 +
 src/backend/replication/logical/meson.build   |    1 +
 src/backend/replication/logical/slotsync.c    | 1282 +++++++++++++++++
 src/backend/replication/logical/tablesync.c   |    1 +
 src/backend/replication/logical/worker.c      |   15 +-
 src/backend/replication/slot.c                |   24 +-
 src/backend/replication/slotfuncs.c           |   37 +-
 src/backend/replication/walsender.c           |    6 +-
 src/backend/storage/ipc/ipci.c                |    2 +
 src/backend/tcop/postgres.c                   |   11 +
 .../utils/activity/wait_event_names.txt       |    2 +
 src/backend/utils/misc/guc_tables.c           |   10 +
 src/backend/utils/misc/postgresql.conf.sample |    1 +
 src/include/catalog/pg_proc.dat               |   10 +-
 src/include/commands/subscriptioncmds.h       |    4 +
 src/include/postmaster/bgworker.h             |    1 +
 src/include/replication/logicalworker.h       |    1 +
 src/include/replication/slot.h                |   22 +-
 src/include/replication/walreceiver.h         |   19 +
 src/include/replication/worker_internal.h     |   11 +
 .../t/050_standby_failover_slots_sync.pl      |  203 +++
 src/test/regress/expected/rules.out           |    5 +-
 src/test/regress/expected/sysviews.out        |    3 +-
 src/tools/pgindent/typedefs.list              |    2 +
 34 files changed, 1888 insertions(+), 36 deletions(-)
 create mode 100644 src/backend/replication/logical/slotsync.c

diff --git a/doc/src/sgml/bgworker.sgml b/doc/src/sgml/bgworker.sgml
index 2c393385a9..ecde4fa61f 100644
--- a/doc/src/sgml/bgworker.sgml
+++ b/doc/src/sgml/bgworker.sgml
@@ -114,18 +114,58 @@ typedef struct BackgroundWorker
 
   <para>
    <structfield>bgw_start_time</structfield> is the server state during which
-   <command>postgres</command> should start the process; it can be one of
-   <literal>BgWorkerStart_PostmasterStart</literal> (start as soon as
-   <command>postgres</command> itself has finished its own initialization; processes
-   requesting this are not eligible for database connections),
-   <literal>BgWorkerStart_ConsistentState</literal> (start as soon as a consistent state
-   has been reached in a hot standby, allowing processes to connect to
-   databases and run read-only queries), and
-   <literal>BgWorkerStart_RecoveryFinished</literal> (start as soon as the system has
-   entered normal read-write state).  Note the last two values are equivalent
-   in a server that's not a hot standby.  Note that this setting only indicates
-   when the processes are to be started; they do not stop when a different state
-   is reached.
+   <command>postgres</command> should start the process. Note that this setting
+   only indicates when the processes are to be started; they do not stop when
+   a different state is reached. Possible values are:
+
+   <variablelist>
+    <varlistentry>
+     <term><literal>BgWorkerStart_PostmasterStart</literal></term>
+     <listitem>
+      <para>
+       <indexterm><primary>BgWorkerStart_PostmasterStart</primary></indexterm>
+       Start as soon as postgres itself has finished its own initialization;
+       processes requesting this are not eligible for database connections.
+      </para>
+     </listitem>
+    </varlistentry>
+
+    <varlistentry>
+     <term><literal>BgWorkerStart_ConsistentState</literal></term>
+     <listitem>
+      <para>
+       <indexterm><primary>BgWorkerStart_ConsistentState</primary></indexterm>
+       Start as soon as a consistent state has been reached in a hot-standby,
+       allowing processes to connect to databases and run read-only queries.
+      </para>
+     </listitem>
+    </varlistentry>
+
+    <varlistentry>
+     <term><literal>BgWorkerStart_RecoveryFinished</literal></term>
+     <listitem>
+      <para>
+       <indexterm><primary>BgWorkerStart_RecoveryFinished</primary></indexterm>
+       Start as soon as the system has entered normal read-write state. Note
+       that the <literal>BgWorkerStart_ConsistentState</literal> and
+      <literal>BgWorkerStart_RecoveryFinished</literal> are equivalent
+       in a server that's not a hot standby.
+      </para>
+     </listitem>
+    </varlistentry>
+
+    <varlistentry>
+     <term><literal>BgWorkerStart_ConsistentState_HotStandby</literal></term>
+     <listitem>
+      <para>
+       <indexterm><primary>BgWorkerStart_ConsistentState_HotStandby</primary></indexterm>
+       Same meaning as <literal>BgWorkerStart_ConsistentState</literal> but
+       it is more strict in terms of the server i.e. start the worker only
+       if it is hot-standby.
+      </para>
+     </listitem>
+    </varlistentry>
+   </variablelist>
   </para>
 
   <para>
diff --git a/doc/src/sgml/config.sgml b/doc/src/sgml/config.sgml
index 7993fe3cdd..e14953e4dd 100644
--- a/doc/src/sgml/config.sgml
+++ b/doc/src/sgml/config.sgml
@@ -4373,6 +4373,12 @@ restore_command = 'copy "C:\\server\\archivedir\\%f" "%p"'  # Windows
         meant to switch to a physical standby after the standby is promoted,
         the physical replication slot for the standby should be listed here.
        </para>
+       <para>
+        The standbys corresponding to the physical replication slots in
+        <varname>standby_slot_names</varname> must configure
+        <varname>enable_syncslot</varname> = true so they can receive
+        failover logical slots changes from the primary.
+       </para>
       </listitem>
      </varlistentry>
 
@@ -4568,8 +4574,12 @@ ANY <replaceable class="parameter">num_sync</replaceable> ( <replaceable class="
           <varname>primary_conninfo</varname> string, or in a separate
           <filename>~/.pgpass</filename> file on the standby server (use
           <literal>replication</literal> as the database name).
-          Do not specify a database name in the
-          <varname>primary_conninfo</varname> string.
+         </para>
+         <para>
+          If slot synchronization is enabled then it is also necessary to
+          specify <literal>dbname</literal> in the
+          <varname>primary_conninfo</varname> string. This will only be used for
+          slot synchronization. It is ignored for streaming.
          </para>
          <para>
           This parameter can only be set in the <filename>postgresql.conf</filename>
@@ -4894,6 +4904,24 @@ ANY <replaceable class="parameter">num_sync</replaceable> ( <replaceable class="
       </listitem>
      </varlistentry>
 
+     <varlistentry id="guc-enable-syncslot" xreflabel="enable_syncslot">
+      <term><varname>enable_syncslot</varname> (<type>boolean</type>)
+      <indexterm>
+       <primary><varname>enable_syncslot</varname> configuration parameter</primary>
+      </indexterm>
+      </term>
+      <listitem>
+       <para>
+        It enables a physical standby to synchronize logical failover slots
+        from the primary server so that logical subscribers are not blocked
+        after failover.
+       </para>
+       <para>
+        It is disabled by default. This parameter can only be set in the
+        <filename>postgresql.conf</filename> file or on the server command line.
+       </para>
+      </listitem>
+     </varlistentry>
      </variablelist>
     </sect2>
 
diff --git a/doc/src/sgml/logicaldecoding.sgml b/doc/src/sgml/logicaldecoding.sgml
index cd152d4ced..43537e00b2 100644
--- a/doc/src/sgml/logicaldecoding.sgml
+++ b/doc/src/sgml/logicaldecoding.sgml
@@ -346,6 +346,39 @@ postgres=# select * from pg_logical_slot_get_changes('regression_slot', NULL, NU
      <function>pg_log_standby_snapshot</function> function on the primary.
     </para>
 
+    <para>
+     A logical replication slot on the primary can be synchronized to the hot
+     standby by enabling the failover option during slot creation and setting
+     <varname>enable_syncslot</varname> on the standby. For the synchronization
+     to work, it is mandatory to have a physical replication slot between the
+     primary and the standby. It's highly recommended that the said physical
+     replication slot is listed in <varname>standby_slot_names</varname> on
+     the primary to prevent the subscriber from consuming changes faster than
+     the hot standby. Additionally, <varname>hot_standby_feedback</varname>
+     must be enabled on the standby for the slots synchronization to work.
+    </para>
+
+    <para>
+     By enabling synchronization of slots, logical replication can be resumed
+     after failover depending upon the
+     <link linkend="view-pg-replication-slots">pg_replication_slots</link>.<structfield>sync_state</structfield>
+     for the synchronized slots on the standby at the time of failover.
+     Only slots that were in ready sync_state ('r') on the standby before
+     failover can be used for logical replication after failover.
+     However, the slots which were in initiated sync_state ('i') and
+     not sync-ready ('r') at the time of failover will be dropped and
+     logical replication for such slots can not be resumed after failover.
+     This applies to the case where a logical subscription is disabled
+     before failover and is enabled after failover. If the synchronized
+     slot due to disabled subscription could not be made sync-ready ('r')
+     on standby, then the subscription can not be resumed after failover
+     even when enabled.
+     If the primary is idle, then the synchronized slots on the standby may
+     take a noticeable time to reach the ready ('r') sync_state. This can
+     be sped up by calling the
+     <function>pg_log_standby_snapshot</function> function on the primary.
+    </para>
+
     <caution>
      <para>
       Replication slots persist across crashes and know nothing about the state
diff --git a/doc/src/sgml/system-views.sgml b/doc/src/sgml/system-views.sgml
index 1dc695fd3a..c906f2186e 100644
--- a/doc/src/sgml/system-views.sgml
+++ b/doc/src/sgml/system-views.sgml
@@ -2543,6 +2543,32 @@ SELECT * FROM pg_locks pl LEFT JOIN pg_prepared_xacts ppx
        after failover. Always false for physical slots.
       </para></entry>
      </row>
+
+     <row>
+      <entry role="catalog_table_entry"><para role="column_definition">
+       <structfield>sync_state</structfield> <type>char</type>
+      </para>
+      <para>
+      Defines slot synchronization state. This is meaningful on the physical
+      standby which has configured <varname>enable_syncslot</varname> = true
+      </para>
+      <para>
+       State code:
+       <literal>n</literal> = none for user created slots,
+       <literal>i</literal> = sync initiated for the slot but slot is not ready
+        yet for periodic syncs,
+       <literal>r</literal> = ready for periodic syncs.
+      </para>
+      <para>
+      The hot standby can have any of these sync_state for the slots but on a
+      hot standby, the slots with state 'r' and 'i' can neither be used for
+      logical decoding nor dropped by the user. The primary server will have
+      sync_state as 'n' for all the slots. But if the standby is promoted to
+      become the new primary server, sync_state can be seen 'r' as well. On
+      this new primary server, slots with sync_state as 'r' and 'n' will
+      behave the same.
+      </para></entry>
+     </row>
     </tbody>
    </tgroup>
   </table>
diff --git a/src/backend/access/transam/xlogrecovery.c b/src/backend/access/transam/xlogrecovery.c
index a2c8fa3981..c867cfbc63 100644
--- a/src/backend/access/transam/xlogrecovery.c
+++ b/src/backend/access/transam/xlogrecovery.c
@@ -50,6 +50,7 @@
 #include "postmaster/startup.h"
 #include "replication/slot.h"
 #include "replication/walreceiver.h"
+#include "replication/worker_internal.h"
 #include "storage/fd.h"
 #include "storage/ipc.h"
 #include "storage/latch.h"
@@ -1435,6 +1436,15 @@ FinishWalRecovery(void)
 	 */
 	XLogShutdownWalRcv();
 
+	/*
+	 * Shutdown the slot sync workers to prevent potential conflicts between
+	 * user processes and slotsync workers after a promotion. Additionally,
+	 * drop any slots that have initiated but not yet completed the sync
+	 * process.
+	 */
+	ShutDownSlotSync();
+	slotsync_drop_initiated_slots();
+
 	/*
 	 * We are now done reading the xlog from stream. Turn off streaming
 	 * recovery to force fetching the files (which would be required at end of
diff --git a/src/backend/catalog/system_views.sql b/src/backend/catalog/system_views.sql
index 63038f87f7..c4b3e8a807 100644
--- a/src/backend/catalog/system_views.sql
+++ b/src/backend/catalog/system_views.sql
@@ -1024,7 +1024,8 @@ CREATE VIEW pg_replication_slots AS
             L.safe_wal_size,
             L.two_phase,
             L.conflicting,
-            L.failover
+            L.failover,
+            L.sync_state
     FROM pg_get_replication_slots() AS L
             LEFT JOIN pg_database D ON (L.datoid = D.oid);
 
diff --git a/src/backend/postmaster/bgworker.c b/src/backend/postmaster/bgworker.c
index 3c99cf6047..7f74f53ad1 100644
--- a/src/backend/postmaster/bgworker.c
+++ b/src/backend/postmaster/bgworker.c
@@ -21,6 +21,7 @@
 #include "postmaster/postmaster.h"
 #include "replication/logicallauncher.h"
 #include "replication/logicalworker.h"
+#include "replication/worker_internal.h"
 #include "storage/dsm.h"
 #include "storage/ipc.h"
 #include "storage/latch.h"
@@ -129,6 +130,9 @@ static const struct
 	{
 		"ApplyWorkerMain", ApplyWorkerMain
 	},
+	{
+		"ReplSlotSyncWorkerMain", ReplSlotSyncWorkerMain
+	},
 	{
 		"ParallelApplyWorkerMain", ParallelApplyWorkerMain
 	},
diff --git a/src/backend/postmaster/postmaster.c b/src/backend/postmaster/postmaster.c
index 651b85ea74..9b74a49663 100644
--- a/src/backend/postmaster/postmaster.c
+++ b/src/backend/postmaster/postmaster.c
@@ -115,6 +115,7 @@
 #include "postmaster/syslogger.h"
 #include "replication/logicallauncher.h"
 #include "replication/walsender.h"
+#include "replication/worker_internal.h"
 #include "storage/fd.h"
 #include "storage/ipc.h"
 #include "storage/pg_shmem.h"
@@ -1003,6 +1004,12 @@ PostmasterMain(int argc, char *argv[])
 	 */
 	ApplyLauncherRegister();
 
+	/*
+	 * Register the slot sync worker here to kick start slot-sync operation
+	 * sooner on the physical standby.
+	 */
+	SlotSyncWorkerRegister();
+
 	/*
 	 * process any libraries that should be preloaded at postmaster start
 	 */
@@ -5740,6 +5747,9 @@ bgworker_should_start_now(BgWorkerStartTime start_time)
 		case PM_HOT_STANDBY:
 			if (start_time == BgWorkerStart_ConsistentState)
 				return true;
+			if (start_time == BgWorkerStart_ConsistentState_HotStandby &&
+					 pmState != PM_RUN)
+				return true;
 			/* fall through */
 
 		case PM_RECOVERY:
diff --git a/src/backend/replication/libpqwalreceiver/libpqwalreceiver.c b/src/backend/replication/libpqwalreceiver/libpqwalreceiver.c
index ff65fdb4d9..a3c2290147 100644
--- a/src/backend/replication/libpqwalreceiver/libpqwalreceiver.c
+++ b/src/backend/replication/libpqwalreceiver/libpqwalreceiver.c
@@ -34,6 +34,7 @@
 #include "utils/memutils.h"
 #include "utils/pg_lsn.h"
 #include "utils/tuplestore.h"
+#include "utils/varlena.h"
 
 PG_MODULE_MAGIC;
 
@@ -58,6 +59,7 @@ static void libpqrcv_get_senderinfo(WalReceiverConn *conn,
 									char **sender_host, int *sender_port);
 static char *libpqrcv_identify_system(WalReceiverConn *conn,
 									  TimeLineID *primary_tli);
+static char *libpqrcv_get_dbname_from_conninfo(const char *conninfo);
 static int	libpqrcv_server_version(WalReceiverConn *conn);
 static void libpqrcv_readtimelinehistoryfile(WalReceiverConn *conn,
 											 TimeLineID tli, char **filename,
@@ -100,6 +102,7 @@ static WalReceiverFunctionsType PQWalReceiverFunctions = {
 	.walrcv_send = libpqrcv_send,
 	.walrcv_create_slot = libpqrcv_create_slot,
 	.walrcv_alter_slot = libpqrcv_alter_slot,
+	.walrcv_get_dbname_from_conninfo = libpqrcv_get_dbname_from_conninfo,
 	.walrcv_get_backend_pid = libpqrcv_get_backend_pid,
 	.walrcv_exec = libpqrcv_exec,
 	.walrcv_disconnect = libpqrcv_disconnect
@@ -418,6 +421,44 @@ libpqrcv_server_version(WalReceiverConn *conn)
 	return PQserverVersion(conn->streamConn);
 }
 
+/*
+ * Get database name from the primary server's conninfo.
+ *
+ * If dbname is not found in connInfo, return NULL value.
+ */
+static char *
+libpqrcv_get_dbname_from_conninfo(const char *connInfo)
+{
+	PQconninfoOption *opts;
+	char	   *dbname = NULL;
+	char	   *err = NULL;
+
+	opts = PQconninfoParse(connInfo, &err);
+	if (opts == NULL)
+	{
+		/* The error string is malloc'd, so we must free it explicitly */
+		char	   *errcopy = err ? pstrdup(err) : "out of memory";
+
+		PQfreemem(err);
+		ereport(ERROR,
+				(errcode(ERRCODE_SYNTAX_ERROR),
+				 errmsg("invalid connection string syntax: %s", errcopy)));
+	}
+
+	for (PQconninfoOption *opt = opts; opt->keyword != NULL; ++opt)
+	{
+		/*
+		 * If multiple dbnames are specified, then the last one will be
+		 * returned
+		 */
+		if (strcmp(opt->keyword, "dbname") == 0 && opt->val &&
+			opt->val[0] != '\0')
+			dbname = pstrdup(opt->val);
+	}
+
+	return dbname;
+}
+
 /*
  * Start streaming WAL data from given streaming options.
  *
@@ -997,7 +1038,7 @@ libpqrcv_create_slot(WalReceiverConn *conn, const char *slotname,
  */
 static void
 libpqrcv_alter_slot(WalReceiverConn *conn, const char *slotname,
-					bool failover)
+					 bool failover)
 {
 	StringInfoData cmd;
 	PGresult   *res;
diff --git a/src/backend/replication/logical/Makefile b/src/backend/replication/logical/Makefile
index 2dc25e37bb..ba03eeff1c 100644
--- a/src/backend/replication/logical/Makefile
+++ b/src/backend/replication/logical/Makefile
@@ -25,6 +25,7 @@ OBJS = \
 	proto.o \
 	relation.o \
 	reorderbuffer.o \
+	slotsync.o \
 	snapbuild.o \
 	tablesync.o \
 	worker.o
diff --git a/src/backend/replication/logical/logical.c b/src/backend/replication/logical/logical.c
index 8288da5277..c21d081346 100644
--- a/src/backend/replication/logical/logical.c
+++ b/src/backend/replication/logical/logical.c
@@ -524,6 +524,31 @@ CreateDecodingContext(XLogRecPtr start_lsn,
 				 errmsg("replication slot \"%s\" was not created in this database",
 						NameStr(slot->data.name))));
 
+	if (RecoveryInProgress())
+	{
+		/*
+		 * Do not allow consumption of a "synchronized" slot until the standby
+		 * gets promoted.
+		 */
+		if (slot->data.sync_state != SYNCSLOT_STATE_NONE)
+			ereport(ERROR,
+					(errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+					 errmsg("cannot use replication slot \"%s\" for logical "
+						"decoding", NameStr(slot->data.name)),
+					 errdetail("This slot is being synced from the primary server."),
+					 errhint("Specify another replication slot.")));
+	}
+	else
+	{
+		/*
+		 * Slots in state SYNCSLOT_STATE_INITIATED should have been dropped on
+		 * promotion.
+		 */
+		if (slot->data.sync_state == SYNCSLOT_STATE_INITIATED)
+			elog(ERROR, "replication slot \"%s\" was not synced completely "
+				"from the primary server", NameStr(slot->data.name));
+	}
+
 	/*
 	 * Check if slot has been invalidated due to max_slot_wal_keep_size. Avoid
 	 * "cannot get changes" wording in this errmsg because that'd be
diff --git a/src/backend/replication/logical/meson.build b/src/backend/replication/logical/meson.build
index d48cd4c590..9e52ec421f 100644
--- a/src/backend/replication/logical/meson.build
+++ b/src/backend/replication/logical/meson.build
@@ -11,6 +11,7 @@ backend_sources += files(
   'proto.c',
   'relation.c',
   'reorderbuffer.c',
+  'slotsync.c',
   'snapbuild.c',
   'tablesync.c',
   'worker.c',
diff --git a/src/backend/replication/logical/slotsync.c b/src/backend/replication/logical/slotsync.c
new file mode 100644
index 0000000000..553492058e
--- /dev/null
+++ b/src/backend/replication/logical/slotsync.c
@@ -0,0 +1,1282 @@
+/*-------------------------------------------------------------------------
+ * slotsync.c
+ *	   PostgreSQL worker for synchronizing slots to a standby server from the
+ *         primary server.
+ *
+ * Copyright (c) 2023, PostgreSQL Global Development Group
+ *
+ * IDENTIFICATION
+ *	  src/backend/replication/logical/slotsync.c
+ *
+ * This file contains the code for slot sync worker on a physical standby
+ * to fetch logical failover slots information from the primary server,
+ * create the slots on the standby and synchronize them periodically.
+ *
+ * While creating the slot on physical standby, if the local restart_lsn and/or
+ * local catalog_xmin is ahead of those on the remote then the worker cannot
+ * create the local slot in sync with the primary server because that would
+ * mean moving the local slot backwards and the standby might not have WALs
+ * retained for old LSN. In this case, the worker will wait for the primary
+ * server slot's restart_lsn and catalog_xmin to catch up with the local one
+ * before attempting the actual sync. Meanwhile, it will persist the slot with
+ * sync_state as SYNCSLOT_STATE_INITIATED('i'). Once the primary server catches
+ * up, it will move the slot to SYNCSLOT_STATE_READY('r') state and will perform
+ * the sync periodically.
+ *
+ * The worker also takes care of dropping the slots which were created by it
+ * and are currently not needed to be synchronized.
+ *
+ * It takes a nap of WORKER_DEFAULT_NAPTIME_MS before every next
+ * synchronization. If there is no activity observed on the primary server for
+ * some time, the nap time is increased to WORKER_INACTIVITY_NAPTIME_MS, but if
+ * any activity is observed, the nap time reverts to the default value.
+ *---------------------------------------------------------------------------
+ */
+
+#include "postgres.h"
+
+#include "access/genam.h"
+#include "access/table.h"
+#include "access/xlogrecovery.h"
+#include "catalog/pg_database.h"
+#include "commands/dbcommands.h"
+#include "pgstat.h"
+#include "postmaster/bgworker.h"
+#include "postmaster/interrupt.h"
+#include "replication/logical.h"
+#include "replication/logicallauncher.h"
+#include "replication/logicalworker.h"
+#include "replication/walreceiver.h"
+#include "replication/worker_internal.h"
+#include "storage/ipc.h"
+#include "storage/procarray.h"
+#include "tcop/tcopprot.h"
+#include "utils/builtins.h"
+#include "utils/fmgroids.h"
+#include "utils/guc_hooks.h"
+#include "utils/pg_lsn.h"
+#include "utils/varlena.h"
+
+/*
+ * Structure to hold information fetched from the primary server about a logical
+ * replication slot.
+ */
+typedef struct RemoteSlot
+{
+	char	   *name;
+	char	   *plugin;
+	char	   *database;
+	bool		two_phase;
+	bool		failover;
+	XLogRecPtr	restart_lsn;
+	XLogRecPtr	confirmed_lsn;
+	TransactionId catalog_xmin;
+
+	/* RS_INVAL_NONE if valid, or the reason of invalidation */
+	ReplicationSlotInvalidationCause invalidated;
+} RemoteSlot;
+
+/*
+ * Struct for sharing information between startup process and slot
+ * sync worker.
+ *
+ * Slot sync worker's pid is needed by startup process in order to
+ * shut it down during promotion.
+ */
+typedef struct SlotSyncWorkerCtx
+{
+	pid_t		pid;
+	slock_t		mutex;
+} SlotSyncWorkerCtx;
+
+SlotSyncWorkerCtx *SlotSyncWorker = NULL;
+
+/* GUC variable */
+bool		enable_syncslot = false;
+
+/* The last sync-cycle time when the worker updated any of the slots. */
+static TimestampTz last_update_time;
+
+/* Worker's nap time in case of regular activity on the primary server */
+#define WORKER_DEFAULT_NAPTIME_MS                   10L /* 10 ms */
+
+/* Worker's nap time in case of no-activity on the primary server */
+#define WORKER_INACTIVITY_NAPTIME_MS                10000L	/* 10 sec */
+
+/*
+ * Inactivity Threshold in ms before increasing nap time of worker.
+ *
+ * If the lsn of slot being monitored did not change for this threshold time,
+ * then increase nap time of current worker from WORKER_DEFAULT_NAPTIME_MS to
+ * WORKER_INACTIVITY_NAPTIME_MS.
+ */
+#define WORKER_INACTIVITY_THRESHOLD_MS 10000L	/* 10 sec */
+
+static void ProcessSlotSyncInterrupts(WalReceiverConn *wrconn);
+
+/*
+ * Wait for remote slot to pass locally reserved position.
+ *
+ * Ping and wait for the primary server for
+ * WORKER_PRIMARY_CATCHUP_WAIT_ATTEMPTS during a slot creation, if it still
+ * does not catch up, abort the wait. The ones for which wait is aborted will
+ * attempt the wait and sync in the next sync-cycle.
+ *
+ * If passed, *wait_attempts_exceeded will be set to true only if this
+ * function exits after exhausting its wait attempts. It will be false
+ * in all the other cases like failure, remote-slot invalidation, primary
+ * could catch up.
+ */
+static bool
+wait_for_primary_slot_catchup(WalReceiverConn *wrconn, RemoteSlot *remote_slot,
+							  bool *wait_attempts_exceeded)
+{
+#define WAIT_OUTPUT_COLUMN_COUNT 4
+#define WORKER_PRIMARY_CATCHUP_WAIT_ATTEMPTS 5
+
+	StringInfoData cmd;
+	int			wait_count = 0;
+
+
+	ereport(LOG,
+			errmsg("waiting for remote slot \"%s\" LSN (%X/%X) and catalog xmin"
+				   " (%u) to pass local slot LSN (%X/%X) and catalog xmin (%u)",
+				   remote_slot->name,
+				   LSN_FORMAT_ARGS(remote_slot->restart_lsn),
+				   remote_slot->catalog_xmin,
+				   LSN_FORMAT_ARGS(MyReplicationSlot->data.restart_lsn),
+				   MyReplicationSlot->data.catalog_xmin));
+
+	initStringInfo(&cmd);
+	appendStringInfo(&cmd,
+					 "SELECT conflicting, restart_lsn,"
+					 " confirmed_flush_lsn, catalog_xmin"
+					 " FROM pg_catalog.pg_replication_slots"
+					 " WHERE slot_name = %s",
+					 quote_literal_cstr(remote_slot->name));
+
+	for (;;)
+	{
+		XLogRecPtr	new_invalidated;
+		XLogRecPtr	new_restart_lsn;
+		XLogRecPtr	new_confirmed_lsn;
+		TransactionId new_catalog_xmin;
+		WalRcvExecResult *res;
+		TupleTableSlot *slot;
+		int			rc;
+		bool		isnull;
+		Oid			slotRow[WAIT_OUTPUT_COLUMN_COUNT] = {BOOLOID, LSNOID, LSNOID,
+		XIDOID};
+
+		CHECK_FOR_INTERRUPTS();
+
+		/* Handle any termination request if any */
+		ProcessSlotSyncInterrupts(wrconn);
+
+		res = walrcv_exec(wrconn, cmd.data, WAIT_OUTPUT_COLUMN_COUNT, slotRow);
+
+		if (res->status != WALRCV_OK_TUPLES)
+			ereport(ERROR,
+					(errmsg("could not fetch slot \"%s\" info from the"
+							" primary server: %s",
+							remote_slot->name, res->err)));
+
+		slot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
+		if (!tuplestore_gettupleslot(res->tuplestore, true, false, slot))
+		{
+			ereport(WARNING,
+					(errmsg("slot \"%s\" creation aborted", remote_slot->name),
+					 errdetail("This slot was not found on the primary server")));
+			pfree(cmd.data);
+			walrcv_clear_result(res);
+
+			return false;
+		}
+
+		/*
+		 * It is possible to get null values for LSN and Xmin if slot is
+		 * invalidated on the primary server, so handle accordingly.
+		 */
+		new_invalidated = DatumGetBool(slot_getattr(slot, 1, &isnull));
+		Assert(!isnull);
+
+		new_restart_lsn = DatumGetLSN(slot_getattr(slot, 2, &isnull));
+		if (new_invalidated || isnull)
+		{
+			ereport(WARNING,
+					(errmsg("slot \"%s\" creation aborted", remote_slot->name),
+					 errdetail("This slot was invalidated on the primary server")));
+			pfree(cmd.data);
+			ExecClearTuple(slot);
+			walrcv_clear_result(res);
+
+			return false;
+		}
+
+		/*
+		 * Having got a valid restart_lsn, the confirmed_lsn and catalog_xmin
+		 * are expected to be valid/non-null.
+		 */
+		new_confirmed_lsn = DatumGetLSN(slot_getattr(slot, 3, &isnull));
+		Assert(!isnull);
+
+		new_catalog_xmin = DatumGetTransactionId(slot_getattr(slot,
+															  4, &isnull));
+		Assert(!isnull);
+
+		ExecClearTuple(slot);
+		walrcv_clear_result(res);
+
+		if (new_restart_lsn >= MyReplicationSlot->data.restart_lsn &&
+			TransactionIdFollowsOrEquals(new_catalog_xmin,
+										 MyReplicationSlot->data.catalog_xmin))
+		{
+			/* Update new values in remote_slot */
+			remote_slot->restart_lsn = new_restart_lsn;
+			remote_slot->confirmed_lsn = new_confirmed_lsn;
+			remote_slot->catalog_xmin = new_catalog_xmin;
+
+			ereport(LOG,
+					errmsg("wait over for remote slot \"%s\" as its LSN (%X/%X)"
+						   " and catalog xmin (%u) has now passed local slot LSN"
+						   " (%X/%X) and catalog xmin (%u)",
+						   remote_slot->name,
+						   LSN_FORMAT_ARGS(new_restart_lsn),
+						   new_catalog_xmin,
+						   LSN_FORMAT_ARGS(MyReplicationSlot->data.restart_lsn),
+						   MyReplicationSlot->data.catalog_xmin));
+			pfree(cmd.data);
+
+			return true;
+		}
+
+		if (++wait_count >= WORKER_PRIMARY_CATCHUP_WAIT_ATTEMPTS)
+		{
+			ereport(LOG,
+					errmsg("aborting the wait for remote slot \"%s\"",
+						   remote_slot->name));
+			pfree(cmd.data);
+
+			if (wait_attempts_exceeded)
+				*wait_attempts_exceeded = true;
+
+			return false;
+		}
+
+		/*
+		 * XXX: Is waiting for 2 seconds before retrying enough or more or
+		 * less?
+		 */
+		rc = WaitLatch(MyLatch,
+					   WL_LATCH_SET | WL_TIMEOUT | WL_POSTMASTER_DEATH,
+					   2000L,
+					   WAIT_EVENT_REPL_SLOTSYNC_PRIMARY_CATCHUP);
+
+		ResetLatch(MyLatch);
+
+		/* Emergency bailout if postmaster has died */
+		if (rc & WL_POSTMASTER_DEATH)
+			proc_exit(1);
+	}
+}
+
+/*
+ * Update local slot metadata as per remote_slot's positions
+ */
+static void
+local_slot_update(RemoteSlot *remote_slot)
+{
+	Assert(MyReplicationSlot->data.invalidated == RS_INVAL_NONE);
+
+	LogicalConfirmReceivedLocation(remote_slot->confirmed_lsn);
+	LogicalIncreaseXminForSlot(remote_slot->confirmed_lsn,
+							   remote_slot->catalog_xmin);
+	LogicalIncreaseRestartDecodingForSlot(remote_slot->confirmed_lsn,
+										  remote_slot->restart_lsn);
+
+	SpinLockAcquire(&MyReplicationSlot->mutex);
+	MyReplicationSlot->data.invalidated = remote_slot->invalidated;
+	SpinLockRelease(&MyReplicationSlot->mutex);
+
+	ReplicationSlotMarkDirty();
+}
+
+/*
+ * Drop the slots for which sync is initiated but not yet completed
+ * i.e. they are still waiting for the primary server to catch up (refer
+ * to the comment atop the file for details on this wait)
+ */
+void
+slotsync_drop_initiated_slots(void)
+{
+	List	   *local_slots = NIL;
+	ListCell   *lc;
+
+	LWLockAcquire(ReplicationSlotControlLock, LW_SHARED);
+
+	for (int i = 0; i < max_replication_slots; i++)
+	{
+		ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i];
+
+		if (s->in_use && s->data.sync_state == SYNCSLOT_STATE_INITIATED)
+			local_slots = lappend(local_slots, s);
+	}
+
+	LWLockRelease(ReplicationSlotControlLock);
+
+	foreach(lc, local_slots)
+	{
+		ReplicationSlot *s = (ReplicationSlot *) lfirst(lc);
+
+		ReplicationSlotDrop(NameStr(s->data.name), true, false);
+		ereport(LOG,
+				(errmsg("dropped replication slot \"%s\" of dbid %d as it "
+						"was not sync-ready", NameStr(s->data.name),
+						s->data.database)));
+	}
+
+	list_free(local_slots);
+}
+
+/*
+ * Get list of local logical slots which are synchronized from
+ * the primary server.
+ */
+static List *
+get_local_synced_slots(void)
+{
+	List	   *local_slots = NIL;
+
+	LWLockAcquire(ReplicationSlotControlLock, LW_SHARED);
+
+	for (int i = 0; i < max_replication_slots; i++)
+	{
+		ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i];
+
+		/* Check if it is logical synchronized slot */
+		if (s->in_use && SlotIsLogical(s) &&
+			(s->data.sync_state != SYNCSLOT_STATE_NONE))
+		{
+			local_slots = lappend(local_slots, s);
+		}
+	}
+
+	LWLockRelease(ReplicationSlotControlLock);
+
+	return local_slots;
+}
+
+/*
+ * Helper function to check if local_slot is present in remote_slots list.
+ *
+ * It also checks if logical slot is locally invalidated i.e. invalidated on
+ * the standby but valid on the primary server. If found so, it sets
+ * locally_invalidated to true.
+ */
+static bool
+check_sync_slot_on_remote(ReplicationSlot *local_slot, List *remote_slots,
+						  bool *locally_invalidated)
+{
+	ListCell   *lc;
+
+	foreach(lc, remote_slots)
+	{
+		RemoteSlot *remote_slot = (RemoteSlot *) lfirst(lc);
+
+		if (strcmp(remote_slot->name, NameStr(local_slot->data.name)) == 0)
+		{
+			/*
+			 * If remote slot is not invalidated but local slot is marked as
+			 * invalidated, then set the bool.
+			 */
+			SpinLockAcquire(&local_slot->mutex);
+			*locally_invalidated =
+				(remote_slot->invalidated == RS_INVAL_NONE) &&
+				(local_slot->data.invalidated != RS_INVAL_NONE);
+			SpinLockRelease(&local_slot->mutex);
+
+			return true;
+		}
+	}
+
+	return false;
+}
+
+/*
+ * Drop obsolete slots
+ *
+ * Drop the slots that no longer need to be synced i.e. these either do not
+ * exist on the primary or are no longer enabled for failover.
+ *
+ * Additionally, it drops slots that are valid on the primary but got
+ * invalidated on the standby. This situation may occur due to the following
+ * reasons:
+ * - The max_slot_wal_keep_size on the standby is insufficient to retain WAL
+ *   records from the restart_lsn of the slot.
+ * - primary_slot_name is temporarily reset to null and the physical slot is
+ *   removed.
+ * - The primary changes wal_level to a level lower than logical.
+ *
+ * The assumption is that these dropped local invalidated slots will get
+ * recreated in next sync-cycle and it is okay to drop and recreate such slots
+ * as long as these are not consumable on the standby (which is the case
+ * currently).
+ */
+static void
+drop_obsolete_slots(List *remote_slot_list)
+{
+	List	   *local_slots = NIL;
+	ListCell   *lc;
+
+	local_slots = get_local_synced_slots();
+
+	foreach(lc, local_slots)
+	{
+		ReplicationSlot *local_slot = (ReplicationSlot *) lfirst(lc);
+		bool		remote_exists = false;
+		bool		locally_invalidated = false;
+
+		remote_exists = check_sync_slot_on_remote(local_slot, remote_slot_list,
+												  &locally_invalidated);
+
+		/*
+		 * Drop the local slot either if it is not in the remote slots list or
+		 * is invalidated while remote slot is still valid.
+		 */
+		if (!remote_exists || locally_invalidated)
+		{
+			ReplicationSlotDrop(NameStr(local_slot->data.name), true, false);
+
+			ereport(LOG,
+					(errmsg("dropped replication slot \"%s\" of dbid %d",
+							NameStr(local_slot->data.name),
+							local_slot->data.database)));
+		}
+	}
+}
+
+/*
+ * Synchronize single slot to given position.
+ *
+ * This creates a new slot if there is no existing one and updates the
+ * metadata of the slot as per the data received from the primary server.
+ *
+ * The 'sync_state' in slot.data is set to SYNCSLOT_STATE_INITIATED
+ * immediately after creation. It stays in same state until the
+ * initialization is complete. The initialization is considered to
+ * be completed once the remote_slot catches up with locally reserved
+ * position and local slot is updated. The sync_state is then changed
+ * to SYNCSLOT_STATE_READY.
+ */
+static void
+synchronize_one_slot(WalReceiverConn *wrconn, RemoteSlot *remote_slot,
+					 bool *slot_updated)
+{
+	ReplicationSlot *s;
+	ReplicationSlot *slot;
+	char		sync_state = '\0';
+
+	/*
+	 * Sanity check: Make sure that concerned WAL is received before syncing
+	 * slot to target lsn received from the primary server.
+	 *
+	 * This check should never pass as on the primary server, we have waited
+	 * for the standby's confirmation before updating the logical slot.
+	 */
+	SpinLockAcquire(&WalRcv->mutex);
+	if (remote_slot->confirmed_lsn > WalRcv->latestWalEnd)
+	{
+		SpinLockRelease(&WalRcv->mutex);
+		elog(ERROR, "skipping sync of slot \"%s\" as the received slot sync "
+			 "LSN %X/%X is ahead of the standby position %X/%X",
+			 remote_slot->name,
+			 LSN_FORMAT_ARGS(remote_slot->confirmed_lsn),
+			 LSN_FORMAT_ARGS(WalRcv->latestWalEnd));
+	}
+	SpinLockRelease(&WalRcv->mutex);
+
+	/* Search for the named slot */
+	if ((s = SearchNamedReplicationSlot(remote_slot->name, true)))
+	{
+		SpinLockAcquire(&s->mutex);
+		sync_state = s->data.sync_state;
+		SpinLockRelease(&s->mutex);
+
+		/* User created slot with the same name exists, raise ERROR. */
+		if (sync_state == SYNCSLOT_STATE_NONE)
+		{
+			ereport(ERROR,
+					(errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+					 errmsg("skipping sync of slot \"%s\" as it is a user created"
+							" slot", remote_slot->name),
+					 errdetail("This slot has failover enabled on the primary and"
+							   " thus is sync candidate but user created slot with"
+							   " the same name already exists on the standby")));
+		}
+	}
+
+	StartTransactionCommand();
+
+	/* Slot created by the slot sync worker exists, sync it */
+	if (sync_state)
+	{
+		Assert(sync_state == SYNCSLOT_STATE_READY ||
+			   sync_state == SYNCSLOT_STATE_INITIATED);
+
+		ReplicationSlotAcquire(remote_slot->name, true);
+
+		slot = MyReplicationSlot;
+
+		/*
+		 * Copy the invalidation cause from remote only if local slot is not
+		 * invalidated locally, we don't want to overwrite existing one.
+		 */
+		if (slot->data.invalidated == RS_INVAL_NONE)
+		{
+			SpinLockAcquire(&slot->mutex);
+			slot->data.invalidated = remote_slot->invalidated;
+			SpinLockRelease(&slot->mutex);
+		}
+
+		/* Skip the sync if slot has been invalidated locally. */
+		if (slot->data.invalidated != RS_INVAL_NONE)
+			goto cleanup;
+
+		/* Slot ready for sync, so sync it. */
+		if (sync_state == SYNCSLOT_STATE_READY)
+		{
+			/*
+			 * Sanity check: With hot_standby_feedback enabled and
+			 * invalidations handled apropriately as above, this should never
+			 * happen.
+			 */
+			if (remote_slot->restart_lsn < slot->data.restart_lsn)
+			{
+				elog(ERROR,
+					 "not synchronizing local slot \"%s\" LSN(%X/%X)"
+					 " to remote slot's LSN(%X/%X) as synchronization "
+					 " would move it backwards", remote_slot->name,
+					 LSN_FORMAT_ARGS(slot->data.restart_lsn),
+					 LSN_FORMAT_ARGS(remote_slot->restart_lsn));
+			}
+
+			if (remote_slot->confirmed_lsn != slot->data.confirmed_flush ||
+				remote_slot->restart_lsn != slot->data.restart_lsn ||
+				remote_slot->catalog_xmin != slot->data.catalog_xmin)
+			{
+				/* Update LSN of slot to remote slot's current position */
+				local_slot_update(remote_slot);
+				ReplicationSlotSave();
+				*slot_updated = true;
+			}
+		}
+
+		/* Slot not ready yet, let's attempt to make it sync-ready now. */
+		else if (sync_state == SYNCSLOT_STATE_INITIATED)
+		{
+			/*
+			 * Wait for the primary server to catch-up. Refer to the comment
+			 * atop the file for details on this wait.
+			 */
+			if (remote_slot->restart_lsn < slot->data.restart_lsn ||
+				TransactionIdPrecedes(remote_slot->catalog_xmin,
+									  slot->data.catalog_xmin))
+			{
+				if (!wait_for_primary_slot_catchup(wrconn, remote_slot, NULL))
+					goto cleanup;
+			}
+
+			/*
+			 * Wait for primary is over, update the lsns and mark the slot as
+			 * READY for further syncs.
+			 */
+			local_slot_update(remote_slot);
+			SpinLockAcquire(&slot->mutex);
+			slot->data.sync_state = SYNCSLOT_STATE_READY;
+			SpinLockRelease(&slot->mutex);
+
+			/* Save the changes */
+			ReplicationSlotMarkDirty();
+			ReplicationSlotSave();
+			*slot_updated = true;
+
+			ereport(LOG,
+					errmsg("newly locally created slot \"%s\" is sync-ready now",
+						   remote_slot->name));
+		}
+	}
+	/* Otherwise create the slot first. */
+	else
+	{
+		TransactionId xmin_horizon = InvalidTransactionId;
+
+		ReplicationSlotCreate(remote_slot->name, true, RS_EPHEMERAL,
+							  remote_slot->two_phase,
+							  remote_slot->failover,
+							  SYNCSLOT_STATE_INITIATED);
+
+		slot = MyReplicationSlot;
+
+		SpinLockAcquire(&slot->mutex);
+		slot->data.database = get_database_oid(remote_slot->database, false);
+		namestrcpy(&slot->data.plugin, remote_slot->plugin);
+		SpinLockRelease(&slot->mutex);
+
+		ReplicationSlotReserveWal();
+
+		LWLockAcquire(ProcArrayLock, LW_EXCLUSIVE);
+		xmin_horizon = GetOldestSafeDecodingTransactionId(true);
+		SpinLockAcquire(&slot->mutex);
+		slot->effective_catalog_xmin = xmin_horizon;
+		slot->data.catalog_xmin = xmin_horizon;
+		SpinLockRelease(&slot->mutex);
+		ReplicationSlotsComputeRequiredXmin(true);
+		LWLockRelease(ProcArrayLock);
+
+		/*
+		 * Wait for the primary server to catch-up. Refer to the comment atop
+		 * the file for details on this wait.
+		 */
+		if (remote_slot->restart_lsn < slot->data.restart_lsn ||
+			TransactionIdPrecedes(remote_slot->catalog_xmin,
+								  slot->data.catalog_xmin))
+		{
+			bool		wait_attempts_exceeded = false;
+
+			if (!wait_for_primary_slot_catchup(wrconn, remote_slot, &wait_attempts_exceeded))
+			{
+				/*
+				 * The remote slot didn't catch up to locally reserved
+				 * position.
+				 *
+				 * We do not drop the slot because the restart_lsn can be
+				 * ahead of the current location when recreating the slot in
+				 * the next cycle. It may take more time to create such a
+				 * slot. Therefore, we persist it (provided remote-slot is
+				 * still valid) and attempt the wait and synchronization in
+				 * the next cycle.
+				 */
+				if (wait_attempts_exceeded)
+				{
+					ReplicationSlotPersist();
+					*slot_updated = true;
+				}
+
+				goto cleanup;
+			}
+		}
+
+		/*
+		 * Wait for primary is either not needed or is over. Update the lsns
+		 * and mark the slot as READY for further syncs.
+		 */
+		local_slot_update(remote_slot);
+		SpinLockAcquire(&slot->mutex);
+		slot->data.sync_state = SYNCSLOT_STATE_READY;
+		SpinLockRelease(&slot->mutex);
+
+		/* Mark the slot as PERSISTENT and save the changes to disk */
+		ReplicationSlotPersist();
+		*slot_updated = true;
+
+		ereport(LOG,
+				errmsg("newly locally created slot \"%s\" is sync-ready now",
+					   remote_slot->name));
+	}
+
+cleanup:
+
+	ReplicationSlotRelease();
+	CommitTransactionCommand();
+
+	return;
+}
+
+/*
+ * Synchronize slots.
+ *
+ * Gets the failover logical slots info from the primary server and updates
+ * the slots locally. Creates the slots if not present on the standby.
+ *
+ * Returns TRUE if any of the slots gets updated in this sync-cycle.
+ */
+static bool
+synchronize_slots(WalReceiverConn *wrconn)
+{
+#define SLOTSYNC_COLUMN_COUNT 9
+	Oid			slotRow[SLOTSYNC_COLUMN_COUNT] = {TEXTOID, TEXTOID, LSNOID,
+	LSNOID, XIDOID, BOOLOID, BOOLOID, TEXTOID, INT2OID};
+
+	WalRcvExecResult *res;
+	TupleTableSlot *tupslot;
+	StringInfoData s;
+	List	   *remote_slot_list = NIL;
+	MemoryContext oldctx = CurrentMemoryContext;
+	ListCell   *lc;
+	bool		slot_updated = false;
+
+	/*
+	 * The primary_slot_name is not set yet or WALs not received yet.
+	 * Synchronization is not possible if the walreceiver is not started.
+	 */
+	SpinLockAcquire(&WalRcv->mutex);
+	if (!WalRcv ||
+		(WalRcv->slotname[0] == '\0') ||
+		XLogRecPtrIsInvalid(WalRcv->latestWalEnd))
+	{
+		SpinLockRelease(&WalRcv->mutex);
+		return slot_updated;
+	}
+	SpinLockRelease(&WalRcv->mutex);
+
+	/* The syscache access in walrcv_exec() needs a transaction env. */
+	StartTransactionCommand();
+
+	/*
+	 * Make result tuples live outside TopTransactionContext to make them
+	 * accessible even after transaction is committed.
+	 */
+	MemoryContextSwitchTo(oldctx);
+
+	initStringInfo(&s);
+
+	/* Construct query to fetch slots with failover enabled. */
+	appendStringInfo(&s,
+					 "SELECT slot_name, plugin, confirmed_flush_lsn,"
+					 " restart_lsn, catalog_xmin, two_phase, failover,"
+					 " database, pg_get_slot_invalidation_cause(slot_name)"
+					 " FROM pg_catalog.pg_replication_slots"
+					 " WHERE failover");
+
+	elog(DEBUG2, "slot sync worker's query:%s \n", s.data);
+
+	/* Execute the query */
+	res = walrcv_exec(wrconn, s.data, SLOTSYNC_COLUMN_COUNT, slotRow);
+	pfree(s.data);
+
+	if (res->status != WALRCV_OK_TUPLES)
+		ereport(ERROR,
+				(errmsg("could not fetch failover logical slots info "
+						"from the primary server: %s", res->err)));
+
+	CommitTransactionCommand();
+
+	/* Switch to oldctx we saved */
+	MemoryContextSwitchTo(oldctx);
+
+	/* Construct the remote_slot tuple and synchronize each slot locally */
+	tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
+	while (tuplestore_gettupleslot(res->tuplestore, true, false, tupslot))
+	{
+		bool		isnull;
+		RemoteSlot *remote_slot = palloc0(sizeof(RemoteSlot));
+
+		remote_slot->name = TextDatumGetCString(slot_getattr(tupslot, 1, &isnull));
+		Assert(!isnull);
+
+		remote_slot->plugin = TextDatumGetCString(slot_getattr(tupslot, 2, &isnull));
+		Assert(!isnull);
+
+		/*
+		 * It is possible to get null values for LSN and Xmin if slot is
+		 * invalidated on the primary server, so handle accordingly.
+		 */
+		remote_slot->confirmed_lsn = DatumGetLSN(slot_getattr(tupslot, 3, &isnull));
+		if (isnull)
+			remote_slot->confirmed_lsn = InvalidXLogRecPtr;
+
+		remote_slot->restart_lsn = DatumGetLSN(slot_getattr(tupslot, 4, &isnull));
+		if (isnull)
+			remote_slot->restart_lsn = InvalidXLogRecPtr;
+
+		remote_slot->catalog_xmin = DatumGetTransactionId(slot_getattr(tupslot, 5,
+																	   &isnull));
+		if (isnull)
+			remote_slot->catalog_xmin = InvalidTransactionId;
+
+		remote_slot->two_phase = DatumGetBool(slot_getattr(tupslot, 6, &isnull));
+		Assert(!isnull);
+
+		remote_slot->failover = DatumGetBool(slot_getattr(tupslot, 7, &isnull));
+		Assert(!isnull);
+
+		remote_slot->database = TextDatumGetCString(slot_getattr(tupslot,
+																 8, &isnull));
+		Assert(!isnull);
+
+		remote_slot->invalidated = DatumGetInt16(slot_getattr(tupslot, 9, &isnull));
+		Assert(!isnull);
+
+		/* Create list of remote slots */
+		remote_slot_list = lappend(remote_slot_list, remote_slot);
+
+		ExecClearTuple(tupslot);
+	}
+
+	/*
+	 * Drop local slots that no longer need to be synced. Do it before
+	 * synchronize_one_slot to allow dropping of slots before actual sync
+	 * which are invalidated locally while still valid on the primary server.
+	 */
+	drop_obsolete_slots(remote_slot_list);
+
+	/* Now sync the slots locally */
+	foreach(lc, remote_slot_list)
+	{
+		RemoteSlot *remote_slot = (RemoteSlot *) lfirst(lc);
+
+		synchronize_one_slot(wrconn, remote_slot, &slot_updated);
+	}
+
+	/* We are done, free remote_slot_list elements */
+	list_free_deep(remote_slot_list);
+
+	walrcv_clear_result(res);
+
+	return slot_updated;
+}
+
+/*
+ * Connect to the remote (primary) server.
+ *
+ * This uses GUC primary_conninfo in order to connect to the primary.
+ * For slot sync to work, primary_conninfo is required to specify dbname
+ * as well.
+ */
+static WalReceiverConn *
+remote_connect(void)
+{
+	WalReceiverConn *wrconn = NULL;
+	char	   *err;
+
+	wrconn = walrcv_connect(PrimaryConnInfo, true, false,
+							cluster_name[0] ? cluster_name : "slotsyncworker",
+							&err);
+	if (wrconn == NULL)
+		ereport(ERROR,
+				(errcode(ERRCODE_CONNECTION_FAILURE),
+				 errmsg("could not connect to the primary server: %s", err)));
+	return wrconn;
+}
+
+/*
+ * Using the specified primary server connection, validate if the
+ * physical slot identified by GUC primary_slot_name exists.
+ *
+ * Exit the worker if the slot is not found.
+ */
+static void
+validate_primary_slot(WalReceiverConn *wrconn)
+{
+	WalRcvExecResult *res;
+	Oid			slotRow[1] = {BOOLOID};
+	StringInfoData cmd;
+	bool		isnull;
+	TupleTableSlot *slot;
+	bool		valid;
+	bool		tuple_ok PG_USED_FOR_ASSERTS_ONLY;
+
+	/* The syscache access in walrcv_exec() needs a transaction env. */
+	StartTransactionCommand();
+
+	initStringInfo(&cmd);
+	appendStringInfo(&cmd,
+					 "SELECT count(*) = 1 from pg_replication_slots "
+					 "WHERE slot_type='physical' and slot_name=%s",
+					 quote_literal_cstr(PrimarySlotName));
+
+	res = walrcv_exec(wrconn, cmd.data, 1, slotRow);
+	pfree(cmd.data);
+
+	if (res->status != WALRCV_OK_TUPLES)
+		ereport(ERROR,
+				(errmsg("could not fetch primary_slot_name \"%s\" info from the "
+						"primary: %s", PrimarySlotName, res->err)));
+
+	slot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple);
+	tuple_ok = tuplestore_gettupleslot(res->tuplestore, true, false, slot);
+	Assert(tuple_ok);			/* It must return one tuple */
+
+	valid = DatumGetBool(slot_getattr(slot, 1, &isnull));
+	Assert(!isnull);
+
+	if (!valid)
+		ereport(ERROR,
+				(errcode(ERRCODE_INVALID_PARAMETER_VALUE),
+				 errmsg("exiting from slot synchronization due to bad configuration"),
+		/* translator: second %s is a GUC variable name */
+				 errdetail("The primary slot \"%s\" specified by %s is not valid.",
+						   PrimarySlotName, "primary_slot_name")));
+	ExecClearTuple(slot);
+	walrcv_clear_result(res);
+	CommitTransactionCommand();
+}
+
+/*
+ * Checks if GUCs are set appropriately before starting slot sync worker
+ *
+ * The slot sync worker can not start if 'enable_syncslot' is off and
+ * since 'enable_syncslot' is ON, check that the other GUC settings
+ * (primary_slot_name, hot_standby_feedback, wal_level, primary_conninfo)
+ * are compatible with slot synchronization. If not, raise ERROR.
+ */
+static void
+validate_slotsync_parameters(char **dbname)
+{
+	/*
+	 * A physical replication slot(primary_slot_name) is required on the
+	 * primary to ensure that the rows needed by the standby are not removed
+	 * after restarting, so that the synchronized slot on the standby will not
+	 * be invalidated.
+	 */
+	if (PrimarySlotName == NULL || strcmp(PrimarySlotName, "") == 0)
+		ereport(ERROR,
+		/* translator: %s is a GUC variable name */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("%s must be defined.", "primary_slot_name"));
+
+	/*
+	 * Hot_standby_feedback must be enabled to cooperate with the physical
+	 * replication slot, which allows informing the primary about the xmin and
+	 * catalog_xmin values on the standby.
+	 */
+	if (!hot_standby_feedback)
+		ereport(ERROR,
+		/* translator: %s is a GUC variable name */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("%s must be enabled.", "hot_standby_feedback"));
+
+	/*
+	 * Logical decoding requires wal_level >= logical and we currently only
+	 * synchronize logical slots.
+	 */
+	if (wal_level < WAL_LEVEL_LOGICAL)
+		ereport(ERROR,
+		/* translator: %s is a GUC variable name */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("wal_level must be >= logical."));
+
+	/*
+	 * The primary_conninfo is required to make connection to primary for
+	 * getting slots information.
+	 */
+	if (PrimaryConnInfo == NULL || strcmp(PrimaryConnInfo, "") == 0)
+		ereport(ERROR,
+		/* translator: %s is a GUC variable name */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("%s must be defined.", "primary_conninfo"));
+
+	/*
+	 * The slot sync worker needs a database connection for walrcv_exec to
+	 * work.
+	 */
+	*dbname = walrcv_get_dbname_from_conninfo(PrimaryConnInfo);
+	if (*dbname == NULL)
+		ereport(ERROR,
+
+		/*
+		 * translator: 'dbname' is a specific option; %s is a GUC variable
+		 * name
+		 */
+				errmsg("exiting from slot synchronization due to bad configuration"),
+				errhint("'dbname' must be specified in %s.", "primary_conninfo"));
+}
+
+/*
+ * Re-read the config file.
+ *
+ * If any of the slot sync GUCs have changed, re-validate them. The
+ * worker will exit if the check fails.
+ */
+static void
+slotsync_reread_config(WalReceiverConn *wrconn)
+{
+	char	   *old_primary_conninfo = pstrdup(PrimaryConnInfo);
+	char	   *old_primary_slot_name = pstrdup(PrimarySlotName);
+	bool		old_hot_standby_feedback = hot_standby_feedback;
+	bool		revalidate = false;
+	char	   *old_dbname;
+	bool		conninfoChanged;
+	bool		slotnameChanged;
+
+	old_dbname = walrcv_get_dbname_from_conninfo(PrimaryConnInfo);
+	Assert(old_dbname);
+
+	ConfigReloadPending = false;
+	ProcessConfigFile(PGC_SIGHUP);
+
+	conninfoChanged = strcmp(old_primary_conninfo, PrimaryConnInfo) != 0;
+	slotnameChanged = strcmp(old_primary_slot_name, PrimarySlotName) != 0;
+
+	revalidate = conninfoChanged || slotnameChanged ||
+		(old_hot_standby_feedback != hot_standby_feedback);
+
+	pfree(old_primary_conninfo);
+	pfree(old_primary_slot_name);
+
+	if (revalidate)
+	{
+		char	   *new_dbname;
+
+		validate_slotsync_parameters(&new_dbname);
+
+		/*
+		 * Since we have initialized this worker with the old dbname, thus
+		 * exit if dbname changed. Let it get restarted and connect to the new
+		 * dbname specified.
+		 */
+		if (conninfoChanged && strcmp(old_dbname, new_dbname) != 0)
+			ereport(ERROR,
+					errmsg("exiting slot sync worker as dbname in "
+						   "primary_conninfo changed"));
+
+		if (slotnameChanged)
+			validate_primary_slot(wrconn);
+	}
+}
+
+/*
+ * Interrupt handler for main loop of slot sync worker.
+ */
+static void
+ProcessSlotSyncInterrupts(WalReceiverConn *wrconn)
+{
+	CHECK_FOR_INTERRUPTS();
+
+	if (ShutdownRequestPending)
+	{
+		ereport(LOG,
+				errmsg("replication slot sync worker is shutting"
+					   " down on receiving SIGINT"));
+
+		walrcv_disconnect(wrconn);
+		proc_exit(0);
+	}
+
+	if (ConfigReloadPending)
+		slotsync_reread_config(wrconn);
+}
+
+/*
+ * Cleanup function for logical replication launcher.
+ *
+ * Called on logical replication launcher exit.
+ */
+static void
+slotsync_worker_onexit(int code, Datum arg)
+{
+	SpinLockAcquire(&SlotSyncWorker->mutex);
+	SlotSyncWorker->pid = InvalidPid;
+	SpinLockRelease(&SlotSyncWorker->mutex);
+}
+
+/*
+ * The main loop of our worker process.
+ *
+ * It connects to the primary server, fetches logical failover slots
+ * information periodically in order to create and sync the slots.
+ */
+void
+ReplSlotSyncWorkerMain(Datum main_arg)
+{
+	WalReceiverConn *wrconn = NULL;
+	char	   *dbname;
+
+	ereport(LOG, errmsg("replication slot sync worker started"));
+
+	before_shmem_exit(slotsync_worker_onexit, (Datum) 0);
+
+	SpinLockAcquire(&SlotSyncWorker->mutex);
+
+	Assert(SlotSyncWorker->pid == InvalidPid);
+
+	/* Advertise our PID so that the startup process can kill us on promotion */
+	SlotSyncWorker->pid = MyProcPid;
+
+	SpinLockRelease(&SlotSyncWorker->mutex);
+
+	/* Setup signal handling */
+	pqsignal(SIGHUP, SignalHandlerForConfigReload);
+	pqsignal(SIGINT, SignalHandlerForShutdownRequest);
+	pqsignal(SIGTERM, die);
+	BackgroundWorkerUnblockSignals();
+
+	/* Load the libpq-specific functions */
+	load_file("libpqwalreceiver", false);
+
+	validate_slotsync_parameters(&dbname);
+
+	/*
+	 * Connect to the database specified by user in primary_conninfo. We need
+	 * a database connection for walrcv_exec to work. Please see comments atop
+	 * libpqrcv_exec.
+	 */
+	BackgroundWorkerInitializeConnection(dbname, NULL, 0);
+
+	/* Connect to the primary server */
+	wrconn = remote_connect();
+
+	/*
+	 * Using the existing primary server connection, validate the slot
+	 * specified in primary_slot_name.
+	 */
+	validate_primary_slot(wrconn);
+
+	/* Main wait loop. */
+	for (;;)
+	{
+		int			rc;
+		long		naptime = WORKER_DEFAULT_NAPTIME_MS;
+		TimestampTz now;
+		bool		slot_updated;
+
+		ProcessSlotSyncInterrupts(wrconn);
+
+		slot_updated = synchronize_slots(wrconn);
+
+		/*
+		 * If any of the slots get updated in this sync-cycle, use default
+		 * naptime and update 'last_update_time'. But if no activity is
+		 * observed in this sync-cycle, then increase naptime provided
+		 * inactivity time reaches threshold.
+		 */
+		now = GetCurrentTimestamp();
+		if (slot_updated)
+			last_update_time = now;
+		else if (TimestampDifferenceExceeds(last_update_time,
+											now, WORKER_INACTIVITY_THRESHOLD_MS))
+			naptime = WORKER_INACTIVITY_NAPTIME_MS;
+
+		rc = WaitLatch(MyLatch,
+					   WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
+					   naptime,
+					   WAIT_EVENT_REPL_SLOTSYNC_MAIN);
+
+		if (rc & WL_LATCH_SET)
+			ResetLatch(MyLatch);
+	}
+
+	/*
+	 * The slot sync worker can not get here because it will only stop when it
+	 * receives a SIGINT from the logical replication launcher, or when there
+	 * is an error.
+	 */
+	Assert(false);
+}
+
+/*
+ * Is current process the slot sync worker?
+ */
+bool
+IsLogicalSlotSyncWorker(void)
+{
+	return SlotSyncWorker->pid == MyProcPid;
+}
+
+/*
+ * Shut down the slot sync worker.
+ */
+void
+ShutDownSlotSync(void)
+{
+	SpinLockAcquire(&SlotSyncWorker->mutex);
+	if (SlotSyncWorker->pid == InvalidPid)
+	{
+		SpinLockRelease(&SlotSyncWorker->mutex);
+		return;
+	}
+
+	kill(SlotSyncWorker->pid, SIGINT);
+
+	SpinLockRelease(&SlotSyncWorker->mutex);
+
+	/* Wait for it to die. */
+	for (;;)
+	{
+		int			rc;
+
+		/* Wait a bit, we don't expect to have to wait long. */
+		rc = WaitLatch(MyLatch,
+					   WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH,
+					   10L, WAIT_EVENT_BGWORKER_SHUTDOWN);
+
+		if (rc & WL_LATCH_SET)
+		{
+			ResetLatch(MyLatch);
+			CHECK_FOR_INTERRUPTS();
+		}
+
+		SpinLockAcquire(&SlotSyncWorker->mutex);
+
+		/* Is it gone? */
+		if (SlotSyncWorker->pid == InvalidPid)
+			break;
+
+		SpinLockRelease(&SlotSyncWorker->mutex);
+	}
+
+	SpinLockRelease(&SlotSyncWorker->mutex);
+}
+
+/*
+ * Allocate and initialize slot sync worker shared memory
+ */
+void
+SlotSyncWorkerShmemInit(void)
+{
+	Size		size;
+	bool		found;
+
+	size = sizeof(SlotSyncWorkerCtx);
+	size = MAXALIGN(size);
+
+	SlotSyncWorker = (SlotSyncWorkerCtx *)
+		ShmemInitStruct("Slot Sync Worker Data", size, &found);
+
+	if (!found)
+	{
+		memset(SlotSyncWorker, 0, size);
+		SlotSyncWorker->pid = InvalidPid;
+		SpinLockInit(&SlotSyncWorker->mutex);
+	}
+}
+
+/*
+ * Register the background worker for slots synchronization provided
+ * enable_syncslot is ON.
+ */
+void
+SlotSyncWorkerRegister(void)
+{
+	BackgroundWorker bgw;
+
+	if (!enable_syncslot)
+	{
+		ereport(LOG,
+				errmsg("skipping slots synchronization because enable_syncslot is "
+					   "disabled."));
+		return;
+	}
+
+	memset(&bgw, 0, sizeof(bgw));
+
+	/* We need database connection which needs shared-memory access as well. */
+	bgw.bgw_flags = BGWORKER_SHMEM_ACCESS |
+		BGWORKER_BACKEND_DATABASE_CONNECTION;
+
+	/* Start as soon as a consistent state has been reached in a hot standby */
+	bgw.bgw_start_time = BgWorkerStart_ConsistentState_HotStandby;
+
+	snprintf(bgw.bgw_library_name, MAXPGPATH, "postgres");
+	snprintf(bgw.bgw_function_name, BGW_MAXLEN, "ReplSlotSyncWorkerMain");
+	snprintf(bgw.bgw_name, BGW_MAXLEN,
+			 "replication slot sync worker");
+	snprintf(bgw.bgw_type, BGW_MAXLEN,
+			 "slot sync worker");
+
+	bgw.bgw_restart_time = BGW_DEFAULT_RESTART_INTERVAL;
+	bgw.bgw_notify_pid = 0;
+	bgw.bgw_main_arg = (Datum) 0;
+
+	RegisterBackgroundWorker(&bgw);
+}
diff --git a/src/backend/replication/logical/tablesync.c b/src/backend/replication/logical/tablesync.c
index 7b6170fe55..64fcfdac9a 100644
--- a/src/backend/replication/logical/tablesync.c
+++ b/src/backend/replication/logical/tablesync.c
@@ -100,6 +100,7 @@
 #include "catalog/pg_subscription_rel.h"
 #include "catalog/pg_type.h"
 #include "commands/copy.h"
+#include "commands/subscriptioncmds.h"
 #include "miscadmin.h"
 #include "nodes/makefuncs.h"
 #include "parser/parse_relation.h"
diff --git a/src/backend/replication/logical/worker.c b/src/backend/replication/logical/worker.c
index e46a1955e8..7b3784c212 100644
--- a/src/backend/replication/logical/worker.c
+++ b/src/backend/replication/logical/worker.c
@@ -141,7 +141,20 @@
  * subscribe to the new primary without losing any data.
  *
  * However, we do not enable failover for slots created by the table sync
- * worker.
+ * worker. This is because the table sync slot might not be fully synced on the
+ * standby due to the following reasons:
+ *
+ * - The standby needs to wait for the primary server to catch up because the
+ *   local restart_lsn of the newly created slot on the standby is set using
+ *   the latest redo position (GetXLogReplayRecPtr()), which is typically ahead
+ *   of the primary's restart_lsn.
+ * - The table sync slot's restart_lsn won't be advanced until the state
+ *   becomes SUBREL_STATE_CATCHUP.
+ *
+ * Therefore, if a failover happens before the restart_lsn advances, the table
+ * sync slot will not be synced to the standby. Consequently, we will not be
+ * able to subscribe to the promoted standby due to the absence of the
+ * necessary table sync slot.
  *
  * Additionally, failover is not enabled for the main slot if the table sync is
  * in progress. This is because if a failover occurs while the table sync
diff --git a/src/backend/replication/slot.c b/src/backend/replication/slot.c
index 49d2de5024..a21a57c09c 100644
--- a/src/backend/replication/slot.c
+++ b/src/backend/replication/slot.c
@@ -47,6 +47,7 @@
 #include "miscadmin.h"
 #include "pgstat.h"
 #include "replication/slot.h"
+#include "replication/walsender.h"
 #include "storage/fd.h"
 #include "storage/ipc.h"
 #include "storage/proc.h"
@@ -262,11 +263,15 @@ ReplicationSlotValidateName(const char *name, int elevel)
  *     user will only get commit prepared.
  * failover: If enabled, allows the slot to be synced to physical standbys so
  *     that logical replication can be resumed after failover.
+ * sync_state: Defines slot synchronization state. For user created slots, it
+ *     is SYNCSLOT_STATE_NONE and for the slots being synchronized on the
+ *     physical standby, it is either SYNCSLOT_STATE_INITIATED or
+ *     SYNCSLOT_STATE_READY.
  */
 void
 ReplicationSlotCreate(const char *name, bool db_specific,
 					  ReplicationSlotPersistency persistency,
-					  bool two_phase, bool failover)
+					  bool two_phase, bool failover, char sync_state)
 {
 	ReplicationSlot *slot = NULL;
 	int			i;
@@ -327,6 +332,7 @@ ReplicationSlotCreate(const char *name, bool db_specific,
 	slot->data.two_phase = two_phase;
 	slot->data.two_phase_at = InvalidXLogRecPtr;
 	slot->data.failover = failover;
+	slot->data.sync_state = sync_state;
 
 	/* and then data only present in shared memory */
 	slot->just_dirtied = false;
@@ -686,12 +692,26 @@ restart:
  * Permanently drop replication slot identified by the passed in name.
  */
 void
-ReplicationSlotDrop(const char *name, bool nowait)
+ReplicationSlotDrop(const char *name, bool nowait, bool user_cmd)
 {
 	Assert(MyReplicationSlot == NULL);
 
 	ReplicationSlotAcquire(name, nowait);
 
+	/*
+	 * Do not allow users to drop the slots which are currently being synced
+	 * from the primary to the standby.
+	 */
+	if (user_cmd && RecoveryInProgress() &&
+		MyReplicationSlot->data.sync_state != SYNCSLOT_STATE_NONE)
+	{
+		ReplicationSlotRelease();
+		ereport(ERROR,
+				(errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE),
+				 errmsg("cannot drop replication slot \"%s\"", name),
+				 errdetail("This slot is being synced from the primary server.")));
+	}
+
 	ReplicationSlotDropAcquired();
 }
 
diff --git a/src/backend/replication/slotfuncs.c b/src/backend/replication/slotfuncs.c
index c87f61666d..e5ba5956aa 100644
--- a/src/backend/replication/slotfuncs.c
+++ b/src/backend/replication/slotfuncs.c
@@ -44,7 +44,7 @@ create_physical_replication_slot(char *name, bool immediately_reserve,
 	/* acquire replication slot, this will check for conflicting names */
 	ReplicationSlotCreate(name, false,
 						  temporary ? RS_TEMPORARY : RS_PERSISTENT, false,
-						  false);
+						  false, SYNCSLOT_STATE_NONE);
 
 	if (immediately_reserve)
 	{
@@ -137,7 +137,7 @@ create_logical_replication_slot(char *name, char *plugin,
 	 */
 	ReplicationSlotCreate(name, true,
 						  temporary ? RS_TEMPORARY : RS_EPHEMERAL, two_phase,
-						  failover);
+						  failover, SYNCSLOT_STATE_NONE);
 
 	/*
 	 * Create logical decoding context to find start point or, if we don't
@@ -226,11 +226,38 @@ pg_drop_replication_slot(PG_FUNCTION_ARGS)
 
 	CheckSlotRequirements();
 
-	ReplicationSlotDrop(NameStr(*name), true);
+	ReplicationSlotDrop(NameStr(*name), true, true);
 
 	PG_RETURN_VOID();
 }
 
+/*
+ * SQL function for getting invalidation cause of a slot.
+ *
+ * Returns ReplicationSlotInvalidationCause enum value for valid slot_name;
+ * returns NULL if slot with given name is not found.
+ *
+ * Returns RS_INVAL_NONE if the given slot is not invalidated.
+ */
+Datum
+pg_get_slot_invalidation_cause(PG_FUNCTION_ARGS)
+{
+	Name		name = PG_GETARG_NAME(0);
+	ReplicationSlot *s;
+	ReplicationSlotInvalidationCause cause;
+
+	s = SearchNamedReplicationSlot(NameStr(*name), true);
+
+	if (s == NULL)
+		PG_RETURN_NULL();
+
+	SpinLockAcquire(&s->mutex);
+	cause = s->data.invalidated;
+	SpinLockRelease(&s->mutex);
+
+	PG_RETURN_INT16(cause);
+}
+
 /*
  * pg_get_replication_slots - SQL SRF showing all replication slots
  * that currently exist on the database cluster.
@@ -238,7 +265,7 @@ pg_drop_replication_slot(PG_FUNCTION_ARGS)
 Datum
 pg_get_replication_slots(PG_FUNCTION_ARGS)
 {
-#define PG_GET_REPLICATION_SLOTS_COLS 16
+#define PG_GET_REPLICATION_SLOTS_COLS 17
 	ReturnSetInfo *rsinfo = (ReturnSetInfo *) fcinfo->resultinfo;
 	XLogRecPtr	currlsn;
 	int			slotno;
@@ -420,6 +447,8 @@ pg_get_replication_slots(PG_FUNCTION_ARGS)
 
 		values[i++] = BoolGetDatum(slot_contents.data.failover);
 
+		values[i++] = CharGetDatum(slot_contents.data.sync_state);
+
 		Assert(i == PG_GET_REPLICATION_SLOTS_COLS);
 
 		tuplestore_putvalues(rsinfo->setResult, rsinfo->setDesc,
diff --git a/src/backend/replication/walsender.c b/src/backend/replication/walsender.c
index fddc9310c6..8d48d7c8f4 100644
--- a/src/backend/replication/walsender.c
+++ b/src/backend/replication/walsender.c
@@ -1071,7 +1071,7 @@ CreateReplicationSlot(CreateReplicationSlotCmd *cmd)
 	{
 		ReplicationSlotCreate(cmd->slotname, false,
 							  cmd->temporary ? RS_TEMPORARY : RS_PERSISTENT,
-							  false, false);
+							  false, false, SYNCSLOT_STATE_NONE);
 
 		if (reserve_wal)
 		{
@@ -1102,7 +1102,7 @@ CreateReplicationSlot(CreateReplicationSlotCmd *cmd)
 		 */
 		ReplicationSlotCreate(cmd->slotname, true,
 							  cmd->temporary ? RS_TEMPORARY : RS_EPHEMERAL,
-							  two_phase, failover);
+							  two_phase, failover, SYNCSLOT_STATE_NONE);
 
 		/*
 		 * Do options check early so that we can bail before calling the
@@ -1254,7 +1254,7 @@ CreateReplicationSlot(CreateReplicationSlotCmd *cmd)
 static void
 DropReplicationSlot(DropReplicationSlotCmd *cmd)
 {
-	ReplicationSlotDrop(cmd->slotname, !cmd->wait);
+	ReplicationSlotDrop(cmd->slotname, !cmd->wait, true);
 }
 
 /*
diff --git a/src/backend/storage/ipc/ipci.c b/src/backend/storage/ipc/ipci.c
index 0e0ac22bdd..ae2daff87b 100644
--- a/src/backend/storage/ipc/ipci.c
+++ b/src/backend/storage/ipc/ipci.c
@@ -37,6 +37,7 @@
 #include "replication/slot.h"
 #include "replication/walreceiver.h"
 #include "replication/walsender.h"
+#include "replication/worker_internal.h"
 #include "storage/bufmgr.h"
 #include "storage/dsm.h"
 #include "storage/ipc.h"
@@ -339,6 +340,7 @@ CreateOrAttachShmemStructs(void)
 	WalRcvShmemInit();
 	PgArchShmemInit();
 	ApplyLauncherShmemInit();
+	SlotSyncWorkerShmemInit();
 
 	/*
 	 * Set up other modules that need some shared memory space
diff --git a/src/backend/tcop/postgres.c b/src/backend/tcop/postgres.c
index 7298a187d1..d87020821c 100644
--- a/src/backend/tcop/postgres.c
+++ b/src/backend/tcop/postgres.c
@@ -3286,6 +3286,17 @@ ProcessInterrupts(void)
 			 */
 			proc_exit(1);
 		}
+		else if (IsLogicalSlotSyncWorker())
+		{
+			elog(DEBUG1,
+				"replication slot sync worker is shutting down due to administrator command");
+
+			/*
+			 * Slot sync worker can be stopped at any time.
+			 * Use exit status 1 so the background worker is restarted.
+			 */
+			proc_exit(1);
+		}
 		else if (IsBackgroundWorker)
 			ereport(FATAL,
 					(errcode(ERRCODE_ADMIN_SHUTDOWN),
diff --git a/src/backend/utils/activity/wait_event_names.txt b/src/backend/utils/activity/wait_event_names.txt
index ede94a1ede..7eb735824c 100644
--- a/src/backend/utils/activity/wait_event_names.txt
+++ b/src/backend/utils/activity/wait_event_names.txt
@@ -53,6 +53,8 @@ LOGICAL_APPLY_MAIN	"Waiting in main loop of logical replication apply process."
 LOGICAL_LAUNCHER_MAIN	"Waiting in main loop of logical replication launcher process."
 LOGICAL_PARALLEL_APPLY_MAIN	"Waiting in main loop of logical replication parallel apply process."
 RECOVERY_WAL_STREAM	"Waiting in main loop of startup process for WAL to arrive, during streaming recovery."
+REPL_SLOTSYNC_MAIN	"Waiting in main loop of slot sync worker."
+REPL_SLOTSYNC_PRIMARY_CATCHUP	"Waiting for the primary to catch-up, in slot sync worker."
 SYSLOGGER_MAIN	"Waiting in main loop of syslogger process."
 WAL_RECEIVER_MAIN	"Waiting in main loop of WAL receiver process."
 WAL_SENDER_MAIN	"Waiting in main loop of WAL sender process."
diff --git a/src/backend/utils/misc/guc_tables.c b/src/backend/utils/misc/guc_tables.c
index 9a54e04821..7d50971fd7 100644
--- a/src/backend/utils/misc/guc_tables.c
+++ b/src/backend/utils/misc/guc_tables.c
@@ -67,6 +67,7 @@
 #include "replication/logicallauncher.h"
 #include "replication/slot.h"
 #include "replication/syncrep.h"
+#include "replication/worker_internal.h"
 #include "storage/bufmgr.h"
 #include "storage/large_object.h"
 #include "storage/pg_shmem.h"
@@ -2020,6 +2021,15 @@ struct config_bool ConfigureNamesBool[] =
 		NULL, NULL, NULL
 	},
 
+	{
+		{"enable_syncslot", PGC_POSTMASTER, REPLICATION_STANDBY,
+			gettext_noop("Enables a physical standby to synchronize logical failover slots from the primary server."),
+		},
+		&enable_syncslot,
+		false,
+		NULL, NULL, NULL
+	},
+
 	/* End-of-list marker */
 	{
 		{NULL, 0, 0, NULL, NULL}, NULL, false, NULL, NULL, NULL
diff --git a/src/backend/utils/misc/postgresql.conf.sample b/src/backend/utils/misc/postgresql.conf.sample
index 5d940b72cd..39224137e1 100644
--- a/src/backend/utils/misc/postgresql.conf.sample
+++ b/src/backend/utils/misc/postgresql.conf.sample
@@ -358,6 +358,7 @@
 #wal_retrieve_retry_interval = 5s	# time to wait before retrying to
 					# retrieve WAL after a failed attempt
 #recovery_min_apply_delay = 0		# minimum delay for applying changes during recovery
+#enable_syncslot = off			# enables slot synchronization on the physical standby from the primary
 
 # - Subscribers -
 
diff --git a/src/include/catalog/pg_proc.dat b/src/include/catalog/pg_proc.dat
index bbc03bb76b..82a11e4a31 100644
--- a/src/include/catalog/pg_proc.dat
+++ b/src/include/catalog/pg_proc.dat
@@ -11095,14 +11095,18 @@
   proname => 'pg_drop_replication_slot', provolatile => 'v', proparallel => 'u',
   prorettype => 'void', proargtypes => 'name',
   prosrc => 'pg_drop_replication_slot' },
+{ oid => '8484', descr => 'what caused the replication slot to become invalid',
+  proname => 'pg_get_slot_invalidation_cause', provolatile => 's', proisstrict => 't',
+  prorettype => 'int2', proargtypes => 'name',
+  prosrc => 'pg_get_slot_invalidation_cause' },
 { oid => '3781',
   descr => 'information about replication slots currently in use',
   proname => 'pg_get_replication_slots', prorows => '10', proisstrict => 'f',
   proretset => 't', provolatile => 's', prorettype => 'record',
   proargtypes => '',
-  proallargtypes => '{name,name,text,oid,bool,bool,int4,xid,xid,pg_lsn,pg_lsn,text,int8,bool,bool,bool}',
-  proargmodes => '{o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o}',
-  proargnames => '{slot_name,plugin,slot_type,datoid,temporary,active,active_pid,xmin,catalog_xmin,restart_lsn,confirmed_flush_lsn,wal_status,safe_wal_size,two_phase,conflicting,failover}',
+  proallargtypes => '{name,name,text,oid,bool,bool,int4,xid,xid,pg_lsn,pg_lsn,text,int8,bool,bool,bool,char}',
+  proargmodes => '{o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o,o}',
+  proargnames => '{slot_name,plugin,slot_type,datoid,temporary,active,active_pid,xmin,catalog_xmin,restart_lsn,confirmed_flush_lsn,wal_status,safe_wal_size,two_phase,conflicting,failover,sync_state}',
   prosrc => 'pg_get_replication_slots' },
 { oid => '3786', descr => 'set up a logical replication slot',
   proname => 'pg_create_logical_replication_slot', provolatile => 'v',
diff --git a/src/include/commands/subscriptioncmds.h b/src/include/commands/subscriptioncmds.h
index 214dc6c29e..75b4b2040d 100644
--- a/src/include/commands/subscriptioncmds.h
+++ b/src/include/commands/subscriptioncmds.h
@@ -17,6 +17,7 @@
 
 #include "catalog/objectaddress.h"
 #include "parser/parse_node.h"
+#include "replication/walreceiver.h"
 
 extern ObjectAddress CreateSubscription(ParseState *pstate, CreateSubscriptionStmt *stmt,
 										bool isTopLevel);
@@ -28,4 +29,7 @@ extern void AlterSubscriptionOwner_oid(Oid subid, Oid newOwnerId);
 
 extern char defGetStreamingMode(DefElem *def);
 
+extern void ReplicationSlotDropAtPubNode(WalReceiverConn *wrconn,
+										char *slotname, bool missing_ok);
+
 #endif							/* SUBSCRIPTIONCMDS_H */
diff --git a/src/include/postmaster/bgworker.h b/src/include/postmaster/bgworker.h
index e90ff376a6..8559900b70 100644
--- a/src/include/postmaster/bgworker.h
+++ b/src/include/postmaster/bgworker.h
@@ -79,6 +79,7 @@ typedef enum
 	BgWorkerStart_PostmasterStart,
 	BgWorkerStart_ConsistentState,
 	BgWorkerStart_RecoveryFinished,
+	BgWorkerStart_ConsistentState_HotStandby,
 } BgWorkerStartTime;
 
 #define BGW_DEFAULT_RESTART_INTERVAL	60
diff --git a/src/include/replication/logicalworker.h b/src/include/replication/logicalworker.h
index bbd71d0b42..945d2608f6 100644
--- a/src/include/replication/logicalworker.h
+++ b/src/include/replication/logicalworker.h
@@ -22,6 +22,7 @@ extern void TablesyncWorkerMain(Datum main_arg);
 
 extern bool IsLogicalWorker(void);
 extern bool IsLogicalParallelApplyWorker(void);
+extern bool IsLogicalSlotSyncWorker(void);
 
 extern void HandleParallelApplyMessageInterrupt(void);
 extern void HandleParallelApplyMessages(void);
diff --git a/src/include/replication/slot.h b/src/include/replication/slot.h
index 5ddad69348..5a03f8c8bb 100644
--- a/src/include/replication/slot.h
+++ b/src/include/replication/slot.h
@@ -15,7 +15,6 @@
 #include "storage/lwlock.h"
 #include "storage/shmem.h"
 #include "storage/spin.h"
-#include "replication/walreceiver.h"
 
 /*
  * Behaviour of replication slots, upon release or crash.
@@ -52,6 +51,14 @@ typedef enum ReplicationSlotInvalidationCause
 	RS_INVAL_WAL_LEVEL,
 } ReplicationSlotInvalidationCause;
 
+/* The possible values for 'sync_state' in ReplicationSlotPersistentData */
+#define SYNCSLOT_STATE_NONE          'n'	/* None for user created slots */
+#define SYNCSLOT_STATE_INITIATED     'i'	/* Sync initiated for the slot but
+											 * not completed yet, waiting for
+											 * the primary server to catch-up */
+#define SYNCSLOT_STATE_READY         'r'	/* Initialization complete, ready
+											 * to be synced further */
+
 /*
  * On-Disk data of a replication slot, preserved across restarts.
  */
@@ -112,6 +119,13 @@ typedef struct ReplicationSlotPersistentData
 	/* plugin name */
 	NameData	plugin;
 
+	/*
+	 * Is this a slot created by a sync-slot worker?
+	 *
+	 * Only relevant for logical slots on the physical standby.
+	 */
+	char		sync_state;
+
 	/*
 	 * Is this a failover slot (sync candidate for physical standbys)? Only
 	 * relevant for logical slots on the primary server.
@@ -225,9 +239,10 @@ extern void ReplicationSlotsShmemInit(void);
 /* management of individual slots */
 extern void ReplicationSlotCreate(const char *name, bool db_specific,
 								  ReplicationSlotPersistency persistency,
-								  bool two_phase, bool failover);
+								  bool two_phase, bool failover,
+								  char sync_state);
 extern void ReplicationSlotPersist(void);
-extern void ReplicationSlotDrop(const char *name, bool nowait);
+extern void ReplicationSlotDrop(const char *name, bool nowait, bool user_cmd);
 extern void ReplicationSlotAlter(const char *name, bool failover);
 
 extern void ReplicationSlotAcquire(const char *name, bool nowait);
@@ -253,7 +268,6 @@ extern ReplicationSlot *SearchNamedReplicationSlot(const char *name, bool need_l
 extern int	ReplicationSlotIndex(ReplicationSlot *slot);
 extern bool ReplicationSlotName(int index, Name name);
 extern void ReplicationSlotNameForTablesync(Oid suboid, Oid relid, char *syncslotname, Size szslot);
-extern void ReplicationSlotDropAtPubNode(WalReceiverConn *wrconn, char *slotname, bool missing_ok);
 
 extern void StartupReplicationSlots(void);
 extern void CheckPointReplicationSlots(bool is_shutdown);
diff --git a/src/include/replication/walreceiver.h b/src/include/replication/walreceiver.h
index f1135762fb..c96a814b26 100644
--- a/src/include/replication/walreceiver.h
+++ b/src/include/replication/walreceiver.h
@@ -19,6 +19,7 @@
 #include "pgtime.h"
 #include "port/atomics.h"
 #include "replication/logicalproto.h"
+#include "replication/slot.h"
 #include "replication/walsender.h"
 #include "storage/condition_variable.h"
 #include "storage/latch.h"
@@ -279,6 +280,21 @@ typedef void (*walrcv_get_senderinfo_fn) (WalReceiverConn *conn,
 typedef char *(*walrcv_identify_system_fn) (WalReceiverConn *conn,
 											TimeLineID *primary_tli);
 
+/*
+ * walrcv_get_dbinfo_for_failover_slots_fn
+ *
+ * Run LIST_DBID_FOR_FAILOVER_SLOTS on primary server to get the
+ * list of unique DBIDs for failover logical slots
+ */
+typedef List *(*walrcv_get_dbinfo_for_failover_slots_fn) (WalReceiverConn *conn);
+
+/*
+ * walrcv_get_dbname_from_conninfo_fn
+ *
+ * Returns the dbid from the primary_conninfo
+ */
+typedef char *(*walrcv_get_dbname_from_conninfo_fn) (const char *conninfo);
+
 /*
  * walrcv_server_version_fn
  *
@@ -403,6 +419,7 @@ typedef struct WalReceiverFunctionsType
 	walrcv_get_conninfo_fn walrcv_get_conninfo;
 	walrcv_get_senderinfo_fn walrcv_get_senderinfo;
 	walrcv_identify_system_fn walrcv_identify_system;
+	walrcv_get_dbname_from_conninfo_fn walrcv_get_dbname_from_conninfo;
 	walrcv_server_version_fn walrcv_server_version;
 	walrcv_readtimelinehistoryfile_fn walrcv_readtimelinehistoryfile;
 	walrcv_startstreaming_fn walrcv_startstreaming;
@@ -428,6 +445,8 @@ extern PGDLLIMPORT WalReceiverFunctionsType *WalReceiverFunctions;
 	WalReceiverFunctions->walrcv_get_senderinfo(conn, sender_host, sender_port)
 #define walrcv_identify_system(conn, primary_tli) \
 	WalReceiverFunctions->walrcv_identify_system(conn, primary_tli)
+#define walrcv_get_dbname_from_conninfo(conninfo) \
+	WalReceiverFunctions->walrcv_get_dbname_from_conninfo(conninfo)
 #define walrcv_server_version(conn) \
 	WalReceiverFunctions->walrcv_server_version(conn)
 #define walrcv_readtimelinehistoryfile(conn, tli, filename, content, size) \
diff --git a/src/include/replication/worker_internal.h b/src/include/replication/worker_internal.h
index 84bb79ac0f..9406a2666f 100644
--- a/src/include/replication/worker_internal.h
+++ b/src/include/replication/worker_internal.h
@@ -237,6 +237,11 @@ extern PGDLLIMPORT bool in_remote_transaction;
 
 extern PGDLLIMPORT bool InitializingApplyWorker;
 
+/* Slot sync worker objects */
+extern PGDLLIMPORT char *PrimaryConnInfo;
+extern PGDLLIMPORT char *PrimarySlotName;
+extern PGDLLIMPORT bool enable_syncslot;
+
 extern void logicalrep_worker_attach(int slot);
 extern LogicalRepWorker *logicalrep_worker_find(Oid subid, Oid relid,
 												bool only_running);
@@ -326,6 +331,12 @@ extern void pa_decr_and_wait_stream_block(void);
 extern void pa_xact_finish(ParallelApplyWorkerInfo *winfo,
 						   XLogRecPtr remote_lsn);
 
+extern void ReplSlotSyncWorkerMain(Datum main_arg);
+extern void SlotSyncWorkerRegister(void);
+extern void ShutDownSlotSync(void);
+extern void slotsync_drop_initiated_slots(void);
+extern void SlotSyncWorkerShmemInit(void);
+
 #define isParallelApplyWorker(worker) ((worker)->in_use && \
 									   (worker)->type == WORKERTYPE_PARALLEL_APPLY)
 #define isTablesyncWorker(worker) ((worker)->in_use && \
diff --git a/src/test/recovery/t/050_standby_failover_slots_sync.pl b/src/test/recovery/t/050_standby_failover_slots_sync.pl
index bd6affaf48..20f9d825e7 100644
--- a/src/test/recovery/t/050_standby_failover_slots_sync.pl
+++ b/src/test/recovery/t/050_standby_failover_slots_sync.pl
@@ -296,4 +296,207 @@ is( $primary->safe_psql(
 
 $subscriber1->safe_psql('postgres', "DROP SUBSCRIPTION regress_mysub3");
 
+##################################################
+# Test logical failover slots on the standby
+# Configure standby3 to replicate and synchronize logical slots configured
+# for failover on the primary
+#
+#              failover slot lsub3_slot->| ----> subscriber3 (connected via logical replication)
+# primary --->                           |
+#              physical slot sb3_slot--->| ----> standby3 (connected via streaming replication)
+#                                        |                 lsub3_slot(synced_slot)
+##################################################
+
+# Cleanup old standby_slot_names
+$primary->stop;
+$primary->append_conf(
+	'postgresql.conf', qq(
+standby_slot_names = ''
+));
+$primary->start;
+
+$primary->psql('postgres',
+		q{SELECT pg_create_physical_replication_slot('sb3_slot');});
+
+# Create table and publication on primary
+$primary->safe_psql('postgres', "CREATE TABLE tab_mypub3 (a int PRIMARY KEY);");
+$primary->safe_psql('postgres', "CREATE PUBLICATION mypub3 FOR TABLE tab_mypub3;");
+
+$backup_name = 'backup3';
+$primary->backup($backup_name);
+
+# Create standby3
+my $standby3 = PostgreSQL::Test::Cluster->new('standby3');
+$standby3->init_from_backup(
+	$primary, $backup_name,
+	has_streaming => 1,
+	has_restoring => 1);
+
+my $connstr_1 = $primary->connstr;
+$standby3->stop;
+$standby3->append_conf(
+	'postgresql.conf', q{
+enable_syncslot = true
+hot_standby_feedback = on
+primary_slot_name = 'sb3_slot'
+});
+$standby3->append_conf(
+        'postgresql.conf', qq(
+primary_conninfo = '$connstr_1 dbname=postgres'
+));
+$standby3->start;
+
+# Add this standby into the primary's configuration
+$primary->stop;
+$primary->append_conf(
+	'postgresql.conf', qq(
+standby_slot_names = 'sb3_slot'
+));
+$primary->start;
+
+# Restart the standby
+$standby3->restart;
+my $standby3_conninfo = $standby3->connstr . ' dbname=postgres';
+
+# Create a subscriber node
+my $subscriber3 = PostgreSQL::Test::Cluster->new('subscriber3');
+$subscriber3->init(allows_streaming => 'logical');
+$subscriber3->start;
+$subscriber3->safe_psql('postgres', "CREATE TABLE tab_mypub3 (a int PRIMARY KEY);");
+
+# Create a subscription with failover = true & wait for sync to complete.
+$subscriber3->safe_psql('postgres',
+		"CREATE SUBSCRIPTION mysub3 CONNECTION '$publisher_connstr' "
+	  . "PUBLICATION mypub3 WITH (slot_name = lsub3_slot, failover = true);");
+$subscriber3->wait_for_subscription_sync;
+
+# Wait for the standby to start sync
+$offset = -s $standby3->logfile;
+$standby3->wait_for_log(
+	qr/LOG: ( [A-Z0-9]+:)? waiting for remote slot \"lsub3_slot\"/,
+	$offset);
+
+# Advance lsn on the primary
+$primary->safe_psql('postgres',
+	"SELECT pg_log_standby_snapshot();");
+$primary->safe_psql('postgres',
+	"SELECT pg_log_standby_snapshot();");
+$primary->safe_psql('postgres',
+	"SELECT pg_log_standby_snapshot();");
+
+# Wait for the standby to finish sync
+$offset = -s $standby3->logfile;
+$standby3->wait_for_log(
+	qr/LOG: ( [A-Z0-9]+:)? wait over for remote slot \"lsub3_slot\"/,
+	$offset);
+
+# Confirm that logical failover slot is created on the standby and is sync ready
+is($standby3->safe_psql('postgres',
+	q{SELECT failover, sync_state FROM pg_replication_slots WHERE slot_name = 'lsub3_slot';}),
+	"t|r",
+	'logical slot has failover as true and sync_state as ready on standby');
+
+##################################################
+# Test to confirm that restart_lsn and confirmed_flush_lsn of the logical slot
+# on the primary is synced to the standby
+##################################################
+
+# Truncate table on primary
+$primary->safe_psql('postgres',
+	"TRUNCATE TABLE tab_mypub3;");
+
+# Insert data on the primary
+$primary->safe_psql('postgres',
+	"INSERT INTO tab_mypub3 SELECT generate_series(1, 10);");
+
+# Get the restart_lsn for the logical slot lsub3_slot on the primary
+my $primary_lsn = $primary->safe_psql('postgres',
+	"SELECT restart_lsn from pg_replication_slots WHERE slot_name = 'lsub3_slot';");
+
+# Confirm that restart_lsn of lsub3_slot slot is synced to the standby
+$result = $standby3->safe_psql('postgres',
+	qq[SELECT '$primary_lsn' <= restart_lsn from pg_replication_slots WHERE slot_name = 'lsub3_slot';]);
+is($result, 't', 'restart_lsn of slot lsub3_slot synced to standby');
+
+# Get the confirmed_flush_lsn for the logical slot lsub3_slot on the primary
+$primary_lsn = $primary->safe_psql('postgres',
+	"SELECT confirmed_flush_lsn from pg_replication_slots WHERE slot_name = 'lsub3_slot';");
+
+# Confirm that confirmed_flush_lsn of lsub3_slot slot is synced to the standby
+$result = $standby3->safe_psql('postgres',
+	qq[SELECT '$primary_lsn' <= confirmed_flush_lsn from pg_replication_slots WHERE slot_name = 'lsub3_slot';]);
+is($result, 't', 'confirmed_flush_lsn of slot lsub3_slot synced to the standby');
+
+##################################################
+# Test that synchronized slot can neither be docoded nor dropped by the user
+##################################################
+
+# Disable hot_standby_feedback
+$standby3->safe_psql('postgres', 'ALTER SYSTEM SET hot_standby_feedback = off;');
+$standby3->restart;
+
+# Dropping of synced slot should result in error
+my ($result1, $stdout, $stderr) = $standby3->psql('postgres',
+	"SELECT pg_drop_replication_slot('lsub3_slot');");
+ok($stderr =~ /ERROR:  cannot drop replication slot "lsub3_slot"/,
+	"synced slot on standby cannot be dropped");
+
+# Logical decoding on synced slot should result in error
+($result1, $stdout, $stderr) = $standby3->psql('postgres',
+	"select * from pg_logical_slot_get_changes('lsub3_slot',NULL,NULL);");
+ok($stderr =~ /ERROR:  cannot use replication slot "lsub3_slot" for logical decoding/,
+	"logical decoding is not allowed on synced slot");
+
+# Enable hot_standby_feedback and restart standby
+$standby3->safe_psql('postgres', 'ALTER SYSTEM SET hot_standby_feedback = on;');
+$standby3->restart;
+
+##################################################
+# Create another slot which stays in sync_state as initiated ('i')
+##################################################
+
+# Create a logical slot with failover = true
+$primary->psql('postgres',
+		q{SELECT pg_create_logical_replication_slot('logical_slot','pgoutput', false, true, true);});
+
+# Wait for the standby to start sync
+$offset = -s $standby3->logfile;
+$standby3->wait_for_log(
+	qr/LOG: ( [A-Z0-9]+:)? waiting for remote slot \"logical_slot\"/,
+	$offset);
+
+# Confirm that the logical slot is created on the standby and is in sync initiated state
+  is($standby3->safe_psql('postgres',
+	q{SELECT failover, sync_state FROM pg_replication_slots WHERE slot_name = 'logical_slot';}),
+	"t|i",
+	'logical slot has failover as true and sync_state as initiated on standby');
+
+##################################################
+# Promote the standby3 to primary. Confirm that:
+# a) the sync-ready('r') slot 'lsub3_slot' is retained on new primary
+# b) the initiated('i') slot 'logical_slot'is dropped on promotion
+# c) logical replication for mysub3 is resumed succesfully after failover
+##################################################
+
+$standby3->promote;
+
+# Update subscription with new primary's connection info
+$subscriber3->safe_psql('postgres', "ALTER SUBSCRIPTION mysub3 DISABLE;");
+$subscriber3->safe_psql('postgres', "ALTER SUBSCRIPTION mysub3 CONNECTION '$standby3_conninfo';");
+$subscriber3->safe_psql('postgres', "ALTER SUBSCRIPTION mysub3 ENABLE;");
+
+is($standby3->safe_psql('postgres',
+	q{SELECT slot_name FROM pg_replication_slots WHERE slot_name in ('logical_slot','lsub3_slot');}),
+	'lsub3_slot',
+	'synced slot retained on new primary');
+
+# Insert data on the new primary
+$standby3->safe_psql('postgres',
+	"INSERT INTO tab_mypub3 SELECT generate_series(11, 20);");
+
+# Confirm that data in tab_mypub3 replicated on subscriber
+is( $subscriber3->safe_psql('postgres', q{SELECT count(*) FROM tab_mypub3;}),
+	"20",
+	'data replicated from new primary');
+
 done_testing();
diff --git a/src/test/regress/expected/rules.out b/src/test/regress/expected/rules.out
index cb3b04aa0c..f2e5a3849c 100644
--- a/src/test/regress/expected/rules.out
+++ b/src/test/regress/expected/rules.out
@@ -1474,8 +1474,9 @@ pg_replication_slots| SELECT l.slot_name,
     l.safe_wal_size,
     l.two_phase,
     l.conflicting,
-    l.failover
-   FROM (pg_get_replication_slots() l(slot_name, plugin, slot_type, datoid, temporary, active, active_pid, xmin, catalog_xmin, restart_lsn, confirmed_flush_lsn, wal_status, safe_wal_size, two_phase, conflicting, failover)
+    l.failover,
+    l.sync_state
+   FROM (pg_get_replication_slots() l(slot_name, plugin, slot_type, datoid, temporary, active, active_pid, xmin, catalog_xmin, restart_lsn, confirmed_flush_lsn, wal_status, safe_wal_size, two_phase, conflicting, failover, sync_state)
      LEFT JOIN pg_database d ON ((l.datoid = d.oid)));
 pg_roles| SELECT pg_authid.rolname,
     pg_authid.rolsuper,
diff --git a/src/test/regress/expected/sysviews.out b/src/test/regress/expected/sysviews.out
index 271313ebf8..aac83755de 100644
--- a/src/test/regress/expected/sysviews.out
+++ b/src/test/regress/expected/sysviews.out
@@ -132,8 +132,9 @@ select name, setting from pg_settings where name like 'enable%';
  enable_self_join_removal       | on
  enable_seqscan                 | on
  enable_sort                    | on
+ enable_syncslot                | off
  enable_tidscan                 | on
-(22 rows)
+(23 rows)
 
 -- There are always wait event descriptions for various types.
 select type, count(*) > 0 as ok FROM pg_wait_events
diff --git a/src/tools/pgindent/typedefs.list b/src/tools/pgindent/typedefs.list
index 199863c6b5..10c6f32a30 100644
--- a/src/tools/pgindent/typedefs.list
+++ b/src/tools/pgindent/typedefs.list
@@ -2321,6 +2321,7 @@ RelocationBufferInfo
 RelptrFreePageBtree
 RelptrFreePageManager
 RelptrFreePageSpanLeader
+RemoteSlot
 RenameStmt
 ReopenPtrType
 ReorderBuffer
@@ -2579,6 +2580,7 @@ SlabBlock
 SlabContext
 SlabSlot
 SlotNumber
+SlotSyncWorkerCtx
 SlruCtl
 SlruCtlData
 SlruErrorCause
-- 
2.30.0.windows.2